From 5a41e1faf09df5bf93fe48d3cda5ce3c0fd69fd6 Mon Sep 17 00:00:00 2001 From: Mohammed Al-Dokimi Date: Fri, 20 Feb 2026 21:42:55 +0000 Subject: [PATCH 1/9] Scaffold VolumeSnapshot controller boilerplate Generated initial VolumeSnapshot controller files using the scaffold tool: go run ./cmd/scaffold-controller -interactive=false -kind=VolumeSnapshot -gophercloud-client=NewBlockStorageV3 -gophercloud-module=github.com/gophercloud/gophercloud/v2/openstack/blockstorage/v3/snapshots -gophercloud-type=Snapshot -openstack-json-object=snapshot -available-polling-period=15 -deleting-polling-period=15 -required-create-dependency=Volume --- api/v1alpha1/volumesnapshot_types.go | 84 ++++++ .../openstack_v1alpha1_volumesnapshot.yaml | 14 + .../controllers/volumesnapshot/actuator.go | 265 ++++++++++++++++++ .../volumesnapshot/actuator_test.go | 119 ++++++++ .../controllers/volumesnapshot/controller.go | 93 ++++++ internal/controllers/volumesnapshot/status.go | 76 +++++ .../volumesnapshot-create-full/00-assert.yaml | 33 +++ .../00-create-resource.yaml | 29 ++ .../volumesnapshot-create-full/00-secret.yaml | 6 + .../volumesnapshot-create-full/README.md | 11 + .../00-assert.yaml | 32 +++ .../00-create-resource.yaml | 28 ++ .../00-secret.yaml | 6 + .../01-assert.yaml | 11 + .../01-delete-secret.yaml | 7 + .../volumesnapshot-create-minimal/README.md | 15 + .../volumesnapshot-dependency/00-assert.yaml | 30 ++ .../00-create-resources-missing-deps.yaml | 42 +++ .../volumesnapshot-dependency/00-secret.yaml | 6 + .../volumesnapshot-dependency/01-assert.yaml | 30 ++ .../01-create-dependencies.yaml | 19 ++ .../volumesnapshot-dependency/02-assert.yaml | 17 ++ .../02-delete-dependencies.yaml | 9 + .../volumesnapshot-dependency/03-assert.yaml | 9 + .../03-delete-resources.yaml | 10 + .../tests/volumesnapshot-dependency/README.md | 21 ++ .../00-assert.yaml | 30 ++ .../00-create-resources.yaml | 43 +++ .../00-secret.yaml | 6 + .../01-assert.yaml | 15 + .../01-import-resource.yaml | 13 + .../volumesnapshot-import-error/README.md | 13 + .../volumesnapshot-import/00-assert.yaml | 15 + .../00-import-resource.yaml | 15 + .../volumesnapshot-import/00-secret.yaml | 6 + .../volumesnapshot-import/01-assert.yaml | 34 +++ .../01-create-trap-resource.yaml | 31 ++ .../volumesnapshot-import/02-assert.yaml | 33 +++ .../02-create-resource.yaml | 28 ++ .../tests/volumesnapshot-import/README.md | 18 ++ .../volumesnapshot-update/00-assert.yaml | 26 ++ .../00-minimal-resource.yaml | 28 ++ .../volumesnapshot-update/00-secret.yaml | 6 + .../volumesnapshot-update/01-assert.yaml | 17 ++ .../01-updated-resource.yaml | 10 + .../volumesnapshot-update/02-assert.yaml | 26 ++ .../02-reverted-resource.yaml | 7 + .../tests/volumesnapshot-update/README.md | 17 ++ internal/osclients/volumesnapshot.go | 104 +++++++ 49 files changed, 1563 insertions(+) create mode 100644 api/v1alpha1/volumesnapshot_types.go create mode 100644 config/samples/openstack_v1alpha1_volumesnapshot.yaml create mode 100644 internal/controllers/volumesnapshot/actuator.go create mode 100644 internal/controllers/volumesnapshot/actuator_test.go create mode 100644 internal/controllers/volumesnapshot/controller.go create mode 100644 internal/controllers/volumesnapshot/status.go create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-create-full/00-assert.yaml create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-create-full/00-create-resource.yaml create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-create-full/00-secret.yaml create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-create-full/README.md create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-create-minimal/00-assert.yaml create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-create-minimal/00-create-resource.yaml create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-create-minimal/00-secret.yaml create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-create-minimal/01-assert.yaml create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-create-minimal/01-delete-secret.yaml create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-create-minimal/README.md create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/00-assert.yaml create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/00-create-resources-missing-deps.yaml create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/00-secret.yaml create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/01-assert.yaml create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/01-create-dependencies.yaml create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/02-assert.yaml create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/02-delete-dependencies.yaml create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/03-assert.yaml create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/03-delete-resources.yaml create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/README.md create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/00-assert.yaml create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/00-create-resources.yaml create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/00-secret.yaml create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/01-assert.yaml create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/01-import-resource.yaml create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/README.md create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-import/00-assert.yaml create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-import/00-import-resource.yaml create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-import/00-secret.yaml create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-import/01-assert.yaml create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-import/01-create-trap-resource.yaml create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-import/02-assert.yaml create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-import/02-create-resource.yaml create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-import/README.md create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-update/00-assert.yaml create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-update/00-minimal-resource.yaml create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-update/00-secret.yaml create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-update/01-assert.yaml create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-update/01-updated-resource.yaml create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-update/02-assert.yaml create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-update/02-reverted-resource.yaml create mode 100644 internal/controllers/volumesnapshot/tests/volumesnapshot-update/README.md create mode 100644 internal/osclients/volumesnapshot.go diff --git a/api/v1alpha1/volumesnapshot_types.go b/api/v1alpha1/volumesnapshot_types.go new file mode 100644 index 000000000..32da724ae --- /dev/null +++ b/api/v1alpha1/volumesnapshot_types.go @@ -0,0 +1,84 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package v1alpha1 + +// VolumeSnapshotResourceSpec contains the desired state of the resource. +type VolumeSnapshotResourceSpec struct { + // name will be the name of the created resource. If not specified, the + // name of the ORC object will be used. + // +optional + Name *OpenStackName `json:"name,omitempty"` + + // description is a human-readable description for the resource. + // +kubebuilder:validation:MinLength:=1 + // +kubebuilder:validation:MaxLength:=255 + // +optional + Description *string `json:"description,omitempty"` + + // volumeRef is a reference to the ORC Volume which this resource is associated with. + // +required + // +kubebuilder:validation:XValidation:rule="self == oldSelf",message="volumeRef is immutable" + VolumeRef KubernetesNameRef `json:"volumeRef,omitempty"` + + // TODO(scaffolding): Add more types. + // To see what is supported, you can take inspiration from the CreateOpts structure from + // github.com/gophercloud/gophercloud/v2/openstack/blockstorage/v3/snapshots + // + // Until you have implemented mutability for the field, you must add a CEL validation + // preventing the field being modified: + // `// +kubebuilder:validation:XValidation:rule="self == oldSelf",message=" is immutable"` +} + +// VolumeSnapshotFilter defines an existing resource by its properties +// +kubebuilder:validation:MinProperties:=1 +type VolumeSnapshotFilter struct { + // name of the existing resource + // +optional + Name *OpenStackName `json:"name,omitempty"` + + // description of the existing resource + // +kubebuilder:validation:MinLength:=1 + // +kubebuilder:validation:MaxLength:=255 + // +optional + Description *string `json:"description,omitempty"` + + // TODO(scaffolding): Add more types. + // To see what is supported, you can take inspiration from the ListOpts structure from + // github.com/gophercloud/gophercloud/v2/openstack/blockstorage/v3/snapshots +} + +// VolumeSnapshotResourceStatus represents the observed state of the resource. +type VolumeSnapshotResourceStatus struct { + // name is a Human-readable name for the resource. Might not be unique. + // +kubebuilder:validation:MaxLength=1024 + // +optional + Name string `json:"name,omitempty"` + + // description is a human-readable description for the resource. + // +kubebuilder:validation:MaxLength=1024 + // +optional + Description string `json:"description,omitempty"` + + // volumeID is the ID of the Volume to which the resource is associated. + // +kubebuilder:validation:MaxLength=1024 + // +optional + VolumeID string `json:"volumeID,omitempty"` + + // TODO(scaffolding): Add more types. + // To see what is supported, you can take inspiration from the Snapshot structure from + // github.com/gophercloud/gophercloud/v2/openstack/blockstorage/v3/snapshots +} diff --git a/config/samples/openstack_v1alpha1_volumesnapshot.yaml b/config/samples/openstack_v1alpha1_volumesnapshot.yaml new file mode 100644 index 000000000..8497c4fd4 --- /dev/null +++ b/config/samples/openstack_v1alpha1_volumesnapshot.yaml @@ -0,0 +1,14 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: VolumeSnapshot +metadata: + name: volumesnapshot-sample +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + description: Sample VolumeSnapshot + # TODO(scaffolding): Add all fields the resource supports diff --git a/internal/controllers/volumesnapshot/actuator.go b/internal/controllers/volumesnapshot/actuator.go new file mode 100644 index 000000000..2250a447f --- /dev/null +++ b/internal/controllers/volumesnapshot/actuator.go @@ -0,0 +1,265 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package volumesnapshot + +import ( + "context" + "iter" + "time" + + "github.com/gophercloud/gophercloud/v2/openstack/blockstorage/v3/snapshots" + corev1 "k8s.io/api/core/v1" + "k8s.io/utils/ptr" + ctrl "sigs.k8s.io/controller-runtime" + "sigs.k8s.io/controller-runtime/pkg/client" + + orcv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/generic/interfaces" + "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/generic/progress" + "github.com/k-orc/openstack-resource-controller/v2/internal/logging" + "github.com/k-orc/openstack-resource-controller/v2/internal/osclients" + orcerrors "github.com/k-orc/openstack-resource-controller/v2/internal/util/errors" +) + +// OpenStack resource types +type ( + osResourceT = snapshots.Snapshot + + createResourceActuator = interfaces.CreateResourceActuator[orcObjectPT, orcObjectT, filterT, osResourceT] + deleteResourceActuator = interfaces.DeleteResourceActuator[orcObjectPT, orcObjectT, osResourceT] + resourceReconciler = interfaces.ResourceReconciler[orcObjectPT, osResourceT] + helperFactory = interfaces.ResourceHelperFactory[orcObjectPT, orcObjectT, resourceSpecT, filterT, osResourceT] +) +// The frequency to poll when waiting for the resource to become available +const volumesnapshotAvailablePollingPeriod = 15 * time.Second +// The frequency to poll when waiting for the resource to be deleted +const volumesnapshotDeletingPollingPeriod = 15 * time.Second + +type volumesnapshotActuator struct { + osClient osclients.VolumeSnapshotClient + k8sClient client.Client +} + +var _ createResourceActuator = volumesnapshotActuator{} +var _ deleteResourceActuator = volumesnapshotActuator{} + +func (volumesnapshotActuator) GetResourceID(osResource *osResourceT) string { + return osResource.ID +} + +func (actuator volumesnapshotActuator) GetOSResourceByID(ctx context.Context, id string) (*osResourceT, progress.ReconcileStatus) { + resource, err := actuator.osClient.GetVolumeSnapshot(ctx, id) + if err != nil { + return nil, progress.WrapError(err) + } + return resource, nil +} + +func (actuator volumesnapshotActuator) ListOSResourcesForAdoption(ctx context.Context, orcObject orcObjectPT) (iter.Seq2[*osResourceT, error], bool) { + resourceSpec := orcObject.Spec.Resource + if resourceSpec == nil { + return nil, false + } + + // TODO(scaffolding) If you need to filter resources on fields that the List() function + // of gophercloud does not support, it's possible to perform client-side filtering. + // Check osclients.ResourceFilter + + listOpts := snapshots.ListOpts{ + Name: getResourceName(orcObject), + Description: ptr.Deref(resourceSpec.Description, ""), + } + + return actuator.osClient.ListVolumeSnapshots(ctx, listOpts), true +} + +func (actuator volumesnapshotActuator) ListOSResourcesForImport(ctx context.Context, obj orcObjectPT, filter filterT) (iter.Seq2[*osResourceT, error], progress.ReconcileStatus) { + // TODO(scaffolding) If you need to filter resources on fields that the List() function + // of gophercloud does not support, it's possible to perform client-side filtering. + // Check osclients.ResourceFilter + + listOpts := snapshots.ListOpts{ + Name: string(ptr.Deref(filter.Name, "")), + Description: string(ptr.Deref(filter.Description, "")), + // TODO(scaffolding): Add more import filters + } + + return actuator.osClient.ListVolumeSnapshots(ctx, listOpts), nil +} + +func (actuator volumesnapshotActuator) CreateResource(ctx context.Context, obj orcObjectPT) (*osResourceT, progress.ReconcileStatus) { + resource := obj.Spec.Resource + + if resource == nil { + // Should have been caught by API validation + return nil, progress.WrapError( + orcerrors.Terminal(orcv1alpha1.ConditionReasonInvalidConfiguration, "Creation requested, but spec.resource is not set")) + } + var reconcileStatus progress.ReconcileStatus + + var volumeID string + volume, volumeDepRS := volumeDependency.GetDependency( + ctx, actuator.k8sClient, obj, func(dep *orcv1alpha1.Volume) bool { + return orcv1alpha1.IsAvailable(dep) && dep.Status.ID != nil + }, + ) + reconcileStatus = reconcileStatus.WithReconcileStatus(volumeDepRS) + if volume != nil { + volumeID = ptr.Deref(volume.Status.ID, "") + } + if needsReschedule, _ := reconcileStatus.NeedsReschedule(); needsReschedule { + return nil, reconcileStatus + } + createOpts := snapshots.CreateOpts{ + Name: getResourceName(obj), + Description: ptr.Deref(resource.Description, ""), + VolumeID: volumeID, + // TODO(scaffolding): Add more fields + } + + osResource, err := actuator.osClient.CreateVolumeSnapshot(ctx, createOpts) + if err != nil { + // We should require the spec to be updated before retrying a create which returned a conflict + if !orcerrors.IsRetryable(err) { + err = orcerrors.Terminal(orcv1alpha1.ConditionReasonInvalidConfiguration, "invalid configuration creating resource: "+err.Error(), err) + } + return nil, progress.WrapError(err) + } + + return osResource, nil +} + +func (actuator volumesnapshotActuator) DeleteResource(ctx context.Context, _ orcObjectPT, resource *osResourceT) progress.ReconcileStatus { + if resource.Status == SnapshotStatusDeleting { + return progress.WaitingOnOpenStack(progress.WaitingOnReady, volumesnapshotDeletingPollingPeriod) + } + return progress.WrapError(actuator.osClient.DeleteVolumeSnapshot(ctx, resource.ID)) +} + +func (actuator volumesnapshotActuator) updateResource(ctx context.Context, obj orcObjectPT, osResource *osResourceT) progress.ReconcileStatus { + log := ctrl.LoggerFrom(ctx) + resource := obj.Spec.Resource + if resource == nil { + // Should have been caught by API validation + return progress.WrapError( + orcerrors.Terminal(orcv1alpha1.ConditionReasonInvalidConfiguration, "Update requested, but spec.resource is not set")) + } + + updateOpts := snapshots.UpdateOpts{} + + handleNameUpdate(&updateOpts, obj, osResource) + handleDescriptionUpdate(&updateOpts, resource, osResource) + + // TODO(scaffolding): add handler for all fields supporting mutability + + needsUpdate, err := needsUpdate(updateOpts) + if err != nil { + return progress.WrapError( + orcerrors.Terminal(orcv1alpha1.ConditionReasonInvalidConfiguration, "invalid configuration updating resource: "+err.Error(), err)) + } + if !needsUpdate { + log.V(logging.Debug).Info("No changes") + return nil + } + + _, err = actuator.osClient.UpdateVolumeSnapshot(ctx, osResource.ID, updateOpts) + + // We should require the spec to be updated before retrying an update which returned a conflict + if orcerrors.IsConflict(err) { + err = orcerrors.Terminal(orcv1alpha1.ConditionReasonInvalidConfiguration, "invalid configuration updating resource: "+err.Error(), err) + } + + if err != nil { + return progress.WrapError(err) + } + + return progress.NeedsRefresh() +} + +func needsUpdate(updateOpts snapshots.UpdateOpts) (bool, error) { + updateOptsMap, err := updateOpts.ToSnapshotUpdateMap() + if err != nil { + return false, err + } + + updateMap, ok := updateOptsMap["snapshot"].(map[string]any) + if !ok { + updateMap = make(map[string]any) + } + + return len(updateMap) > 0, nil +} + +func handleNameUpdate(updateOpts *snapshots.UpdateOpts, obj orcObjectPT, osResource *osResourceT) { + name := getResourceName(obj) + if osResource.Name != name { + updateOpts.Name = &name + } +} + +func handleDescriptionUpdate(updateOpts *snapshots.UpdateOpts, resource *resourceSpecT, osResource *osResourceT) { + description := ptr.Deref(resource.Description, "") + if osResource.Description != description { + updateOpts.Description = &description + } +} + +func (actuator volumesnapshotActuator) GetResourceReconcilers(ctx context.Context, orcObject orcObjectPT, osResource *osResourceT, controller interfaces.ResourceController) ([]resourceReconciler, progress.ReconcileStatus) { + return []resourceReconciler{ + actuator.updateResource, + }, nil +} + +type volumesnapshotHelperFactory struct{} + +var _ helperFactory = volumesnapshotHelperFactory{} + +func newActuator(ctx context.Context, orcObject *orcv1alpha1.VolumeSnapshot, controller interfaces.ResourceController) (volumesnapshotActuator, progress.ReconcileStatus) { + log := ctrl.LoggerFrom(ctx) + + // Ensure credential secrets exist and have our finalizer + _, reconcileStatus := credentialsDependency.GetDependencies(ctx, controller.GetK8sClient(), orcObject, func(*corev1.Secret) bool { return true }) + if needsReschedule, _ := reconcileStatus.NeedsReschedule(); needsReschedule { + return volumesnapshotActuator{}, reconcileStatus + } + + clientScope, err := controller.GetScopeFactory().NewClientScopeFromObject(ctx, controller.GetK8sClient(), log, orcObject) + if err != nil { + return volumesnapshotActuator{}, progress.WrapError(err) + } + osClient, err := clientScope.NewVolumeSnapshotClient() + if err != nil { + return volumesnapshotActuator{}, progress.WrapError(err) + } + + return volumesnapshotActuator{ + osClient: osClient, + k8sClient: controller.GetK8sClient(), + }, nil +} + +func (volumesnapshotHelperFactory) NewAPIObjectAdapter(obj orcObjectPT) adapterI { + return volumesnapshotAdapter{obj} +} + +func (volumesnapshotHelperFactory) NewCreateActuator(ctx context.Context, orcObject orcObjectPT, controller interfaces.ResourceController) (createResourceActuator, progress.ReconcileStatus) { + return newActuator(ctx, orcObject, controller) +} + +func (volumesnapshotHelperFactory) NewDeleteActuator(ctx context.Context, orcObject orcObjectPT, controller interfaces.ResourceController) (deleteResourceActuator, progress.ReconcileStatus) { + return newActuator(ctx, orcObject, controller) +} diff --git a/internal/controllers/volumesnapshot/actuator_test.go b/internal/controllers/volumesnapshot/actuator_test.go new file mode 100644 index 000000000..1465c7c89 --- /dev/null +++ b/internal/controllers/volumesnapshot/actuator_test.go @@ -0,0 +1,119 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package volumesnapshot + +import ( + "testing" + + "github.com/gophercloud/gophercloud/v2/openstack/blockstorage/v3/snapshots" + orcv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + "k8s.io/utils/ptr" +) + +func TestNeedsUpdate(t *testing.T) { + testCases := []struct { + name string + updateOpts snapshots.UpdateOpts + expectChange bool + }{ + { + name: "Empty base opts", + updateOpts: snapshots.UpdateOpts{}, + expectChange: false, + }, + { + name: "Updated opts", + updateOpts: snapshots.UpdateOpts{Name: ptr.To("updated")}, + expectChange: true, + }, + } + + for _, tt := range testCases { + t.Run(tt.name, func(t *testing.T) { + got, _ := needsUpdate(tt.updateOpts) + if got != tt.expectChange { + t.Errorf("Expected change: %v, got: %v", tt.expectChange, got) + } + }) + } +} + +func TestHandleNameUpdate(t *testing.T) { + ptrToName := ptr.To[orcv1alpha1.OpenStackName] + testCases := []struct { + name string + newValue *orcv1alpha1.OpenStackName + existingValue string + expectChange bool + }{ + {name: "Identical", newValue: ptrToName("name"), existingValue: "name", expectChange: false}, + {name: "Different", newValue: ptrToName("new-name"), existingValue: "name", expectChange: true}, + {name: "No value provided, existing is identical to object name", newValue: nil, existingValue: "object-name", expectChange: false}, + {name: "No value provided, existing is different from object name", newValue: nil, existingValue: "different-from-object-name", expectChange: true}, + } + + for _, tt := range testCases { + t.Run(tt.name, func(t *testing.T) { + resource := &orcv1alpha1.VolumeSnapshot{} + resource.Name = "object-name" + resource.Spec = orcv1alpha1.VolumeSnapshotSpec{ + Resource: &orcv1alpha1.VolumeSnapshotResourceSpec{Name: tt.newValue}, + } + osResource := &osResourceT{Name: tt.existingValue} + + updateOpts := snapshots.UpdateOpts{} + handleNameUpdate(&updateOpts, resource, osResource) + + got, _ := needsUpdate(updateOpts) + if got != tt.expectChange { + t.Errorf("Expected change: %v, got: %v", tt.expectChange, got) + } + }) + + } +} + +func TestHandleDescriptionUpdate(t *testing.T) { + ptrToDescription := ptr.To[string] + testCases := []struct { + name string + newValue *string + existingValue string + expectChange bool + }{ + {name: "Identical", newValue: ptrToDescription("desc"), existingValue: "desc", expectChange: false}, + {name: "Different", newValue: ptrToDescription("new-desc"), existingValue: "desc", expectChange: true}, + {name: "No value provided, existing is set", newValue: nil, existingValue: "desc", expectChange: true}, + {name: "No value provided, existing is empty", newValue: nil, existingValue: "", expectChange: false}, + } + + for _, tt := range testCases { + t.Run(tt.name, func(t *testing.T) { + resource := &orcv1alpha1.VolumeSnapshotResourceSpec{Description: tt.newValue} + osResource := &osResourceT{Description: tt.existingValue} + + updateOpts := snapshots.UpdateOpts{} + handleDescriptionUpdate(&updateOpts, resource, osResource) + + got, _ := needsUpdate(updateOpts) + if got != tt.expectChange { + t.Errorf("Expected change: %v, got: %v", tt.expectChange, got) + } + }) + + } +} diff --git a/internal/controllers/volumesnapshot/controller.go b/internal/controllers/volumesnapshot/controller.go new file mode 100644 index 000000000..aef288dcc --- /dev/null +++ b/internal/controllers/volumesnapshot/controller.go @@ -0,0 +1,93 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package volumesnapshot + +import ( + "context" + "errors" + + ctrl "sigs.k8s.io/controller-runtime" + "sigs.k8s.io/controller-runtime/pkg/builder" + "sigs.k8s.io/controller-runtime/pkg/controller" + + orcv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + + "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/generic/interfaces" + "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/generic/reconciler" + "github.com/k-orc/openstack-resource-controller/v2/internal/scope" + "github.com/k-orc/openstack-resource-controller/v2/internal/util/credentials" + "github.com/k-orc/openstack-resource-controller/v2/internal/util/dependency" + "github.com/k-orc/openstack-resource-controller/v2/pkg/predicates" +) + +const controllerName = "volumesnapshot" + +// +kubebuilder:rbac:groups=openstack.k-orc.cloud,resources=volumesnapshots,verbs=get;list;watch;create;update;patch;delete +// +kubebuilder:rbac:groups=openstack.k-orc.cloud,resources=volumesnapshots/status,verbs=get;update;patch + +type volumesnapshotReconcilerConstructor struct { + scopeFactory scope.Factory +} + +func New(scopeFactory scope.Factory) interfaces.Controller { + return volumesnapshotReconcilerConstructor{scopeFactory: scopeFactory} +} + +func (volumesnapshotReconcilerConstructor) GetName() string { + return controllerName +} + +var volumeDependency = dependency.NewDeletionGuardDependency[*orcv1alpha1.VolumeSnapshotList, *orcv1alpha1.Volume]( + "spec.resource.volumeRef", + func(volumesnapshot *orcv1alpha1.VolumeSnapshot) []string { + resource := volumesnapshot.Spec.Resource + if resource == nil { + return nil + } + return []string{string(resource.VolumeRef)} + }, + finalizer, externalObjectFieldOwner, +) + +// SetupWithManager sets up the controller with the Manager. +func (c volumesnapshotReconcilerConstructor) SetupWithManager(ctx context.Context, mgr ctrl.Manager, options controller.Options) error { + log := ctrl.LoggerFrom(ctx) + k8sClient := mgr.GetClient() + + volumeWatchEventHandler, err := volumeDependency.WatchEventHandler(log, k8sClient) + if err != nil { + return err + } + + builder := ctrl.NewControllerManagedBy(mgr). + WithOptions(options). + Watches(&orcv1alpha1.Volume{}, volumeWatchEventHandler, + builder.WithPredicates(predicates.NewBecameAvailable(log, &orcv1alpha1.Volume{})), + ). + For(&orcv1alpha1.VolumeSnapshot{}) + + if err := errors.Join( + volumeDependency.AddToManager(ctx, mgr), + credentialsDependency.AddToManager(ctx, mgr), + credentials.AddCredentialsWatch(log, mgr.GetClient(), builder, credentialsDependency), + ); err != nil { + return err + } + + r := reconciler.NewController(controllerName, mgr.GetClient(), c.scopeFactory, volumesnapshotHelperFactory{}, volumesnapshotStatusWriter{}) + return builder.Complete(&r) +} diff --git a/internal/controllers/volumesnapshot/status.go b/internal/controllers/volumesnapshot/status.go new file mode 100644 index 000000000..04d0370ad --- /dev/null +++ b/internal/controllers/volumesnapshot/status.go @@ -0,0 +1,76 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package volumesnapshot + +import ( + "github.com/go-logr/logr" + metav1 "k8s.io/apimachinery/pkg/apis/meta/v1" + + orcv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/generic/interfaces" + "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/generic/progress" + orcapplyconfigv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/pkg/clients/applyconfiguration/api/v1alpha1" +) +// TODO(scaffolding): these are just examples. Change them to the controller's need. +// Ideally, these constants are defined in gophercloud. +const SnapshotStatusAvailable = "available" +const SnapshotStatusInUse = "in-use" +const SnapshotStatusDeleting = "deleting" + +type volumesnapshotStatusWriter struct{} + +type objectApplyT = orcapplyconfigv1alpha1.VolumeSnapshotApplyConfiguration +type statusApplyT = orcapplyconfigv1alpha1.VolumeSnapshotStatusApplyConfiguration + +var _ interfaces.ResourceStatusWriter[*orcv1alpha1.VolumeSnapshot, *osResourceT, *objectApplyT, *statusApplyT] = volumesnapshotStatusWriter{} + +func (volumesnapshotStatusWriter) GetApplyConfig(name, namespace string) *objectApplyT { + return orcapplyconfigv1alpha1.VolumeSnapshot(name, namespace) +} + +func (volumesnapshotStatusWriter) ResourceAvailableStatus(orcObject *orcv1alpha1.VolumeSnapshot, osResource *osResourceT) (metav1.ConditionStatus, progress.ReconcileStatus) { + if osResource == nil { + if orcObject.Status.ID == nil { + return metav1.ConditionFalse, nil + } else { + return metav1.ConditionUnknown, nil + } + } + // TODO(scaffolding): add conditions for returning available, for instance: + + if osResource.Status == SnapshotStatusAvailable || osResource.Status == SnapshotStatusInUse { + return metav1.ConditionTrue, nil + } + + // Otherwise we should continue to poll + return metav1.ConditionFalse, progress.WaitingOnOpenStack(progress.WaitingOnReady, volumesnapshotAvailablePollingPeriod) +} + +func (volumesnapshotStatusWriter) ApplyResourceStatus(log logr.Logger, osResource *osResourceT, statusApply *statusApplyT) { + resourceStatus := orcapplyconfigv1alpha1.VolumeSnapshotResourceStatus(). + WithVolumeID(osResource.VolumeID). + WithName(osResource.Name) + + // TODO(scaffolding): add all of the fields supported in the VolumeSnapshotResourceStatus struct + // If a zero-value isn't expected in the response, place it behind a conditional + + if osResource.Description != "" { + resourceStatus.WithDescription(osResource.Description) + } + + statusApply.WithResource(resourceStatus) +} diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-create-full/00-assert.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-create-full/00-assert.yaml new file mode 100644 index 000000000..029158544 --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-create-full/00-assert.yaml @@ -0,0 +1,33 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: VolumeSnapshot +metadata: + name: volumesnapshot-create-full +status: + resource: + name: volumesnapshot-create-full-override + description: VolumeSnapshot from "create full" test + # TODO(scaffolding): Add all fields the resource supports + conditions: + - type: Available + status: "True" + reason: Success + - type: Progressing + status: "False" + reason: Success +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +resourceRefs: + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: VolumeSnapshot + name: volumesnapshot-create-full + ref: volumesnapshot + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Volume + name: volumesnapshot-create-full + ref: volume +assertAll: + - celExpr: "volumesnapshot.status.id != ''" + - celExpr: "volumesnapshot.status.resource.volumeID == volume.status.id" + # TODO(scaffolding): Add more checks diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-create-full/00-create-resource.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-create-full/00-create-resource.yaml new file mode 100644 index 000000000..f972ed453 --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-create-full/00-create-resource.yaml @@ -0,0 +1,29 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Volume +metadata: + name: volumesnapshot-create-full +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + # TODO(scaffolding): Add the necessary fields to create the resource + resource: {} +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: VolumeSnapshot +metadata: + name: volumesnapshot-create-full +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + name: volumesnapshot-create-full-override + description: VolumeSnapshot from "create full" test + volumeRef: volumesnapshot-create-full + # TODO(scaffolding): Add all fields the resource supports diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-create-full/00-secret.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-create-full/00-secret.yaml new file mode 100644 index 000000000..045711ee7 --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-create-full/00-secret.yaml @@ -0,0 +1,6 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + - command: kubectl create secret generic openstack-clouds --from-file=clouds.yaml=${E2E_KUTTL_OSCLOUDS} ${E2E_KUTTL_CACERT_OPT} + namespaced: true diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-create-full/README.md b/internal/controllers/volumesnapshot/tests/volumesnapshot-create-full/README.md new file mode 100644 index 000000000..6821d6362 --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-create-full/README.md @@ -0,0 +1,11 @@ +# Create a VolumeSnapshot with all the options + +## Step 00 + +Create a VolumeSnapshot using all available fields, and verify that the observed state corresponds to the spec. + +Also validate that the OpenStack resource uses the name from the spec when it is specified. + +## Reference + +https://k-orc.cloud/development/writing-tests/#create-full diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-create-minimal/00-assert.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-create-minimal/00-assert.yaml new file mode 100644 index 000000000..98a5eeab3 --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-create-minimal/00-assert.yaml @@ -0,0 +1,32 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: VolumeSnapshot +metadata: + name: volumesnapshot-create-minimal +status: + resource: + name: volumesnapshot-create-minimal + # TODO(scaffolding): Add all fields the resource supports + conditions: + - type: Available + status: "True" + reason: Success + - type: Progressing + status: "False" + reason: Success +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +resourceRefs: + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: VolumeSnapshot + name: volumesnapshot-create-minimal + ref: volumesnapshot + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Volume + name: volumesnapshot-create-minimal + ref: volume +assertAll: + - celExpr: "volumesnapshot.status.id != ''" + - celExpr: "volumesnapshot.status.resource.volumeID == volume.status.id" + # TODO(scaffolding): Add more checks diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-create-minimal/00-create-resource.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-create-minimal/00-create-resource.yaml new file mode 100644 index 000000000..197d1b747 --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-create-minimal/00-create-resource.yaml @@ -0,0 +1,28 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Volume +metadata: + name: volumesnapshot-create-minimal +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + # TODO(scaffolding): Add the necessary fields to create the resource + resource: {} +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: VolumeSnapshot +metadata: + name: volumesnapshot-create-minimal +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + # TODO(scaffolding): Only add the mandatory fields. It's possible the resource + # doesn't have mandatory fields, in that case, leave it empty. + resource: + volumeRef: volumesnapshot-create-minimal diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-create-minimal/00-secret.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-create-minimal/00-secret.yaml new file mode 100644 index 000000000..045711ee7 --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-create-minimal/00-secret.yaml @@ -0,0 +1,6 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + - command: kubectl create secret generic openstack-clouds --from-file=clouds.yaml=${E2E_KUTTL_OSCLOUDS} ${E2E_KUTTL_CACERT_OPT} + namespaced: true diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-create-minimal/01-assert.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-create-minimal/01-assert.yaml new file mode 100644 index 000000000..9dd07295e --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-create-minimal/01-assert.yaml @@ -0,0 +1,11 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +resourceRefs: + - apiVersion: v1 + kind: Secret + name: openstack-clouds + ref: secret +assertAll: + - celExpr: "secret.metadata.deletionTimestamp != 0" + - celExpr: "'openstack.k-orc.cloud/volumesnapshot' in secret.metadata.finalizers" diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-create-minimal/01-delete-secret.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-create-minimal/01-delete-secret.yaml new file mode 100644 index 000000000..1620791b9 --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-create-minimal/01-delete-secret.yaml @@ -0,0 +1,7 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + # We expect the deletion to hang due to the finalizer, so use --wait=false + - command: kubectl delete secret openstack-clouds --wait=false + namespaced: true diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-create-minimal/README.md b/internal/controllers/volumesnapshot/tests/volumesnapshot-create-minimal/README.md new file mode 100644 index 000000000..4c9907ec4 --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-create-minimal/README.md @@ -0,0 +1,15 @@ +# Create a VolumeSnapshot with the minimum options + +## Step 00 + +Create a minimal VolumeSnapshot, that sets only the required fields, and verify that the observed state corresponds to the spec. + +Also validate that the OpenStack resource uses the name of the ORC object when no name is explicitly specified. + +## Step 01 + +Try deleting the secret and ensure that it is not deleted thanks to the finalizer. + +## Reference + +https://k-orc.cloud/development/writing-tests/#create-minimal diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/00-assert.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/00-assert.yaml new file mode 100644 index 000000000..fd676b232 --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/00-assert.yaml @@ -0,0 +1,30 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: VolumeSnapshot +metadata: + name: volumesnapshot-dependency-no-secret +status: + conditions: + - type: Available + message: Waiting for Secret/volumesnapshot-dependency to be created + status: "False" + reason: Progressing + - type: Progressing + message: Waiting for Secret/volumesnapshot-dependency to be created + status: "True" + reason: Progressing +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: VolumeSnapshot +metadata: + name: volumesnapshot-dependency-no-volume +status: + conditions: + - type: Available + message: Waiting for Volume/volumesnapshot-dependency-pending to be created + status: "False" + reason: Progressing + - type: Progressing + message: Waiting for Volume/volumesnapshot-dependency-pending to be created + status: "True" + reason: Progressing diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/00-create-resources-missing-deps.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/00-create-resources-missing-deps.yaml new file mode 100644 index 000000000..da663bb24 --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/00-create-resources-missing-deps.yaml @@ -0,0 +1,42 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Volume +metadata: + name: volumesnapshot-dependency +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + # TODO(scaffolding): Add the necessary fields to create the resource + resource: {} +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: VolumeSnapshot +metadata: + name: volumesnapshot-dependency-no-volume +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + volumeRef: volumesnapshot-dependency-pending + # TODO(scaffolding): Add the necessary fields to create the resource + +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: VolumeSnapshot +metadata: + name: volumesnapshot-dependency-no-secret +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created + cloudName: openstack + secretName: volumesnapshot-dependency + managementPolicy: managed + # TODO(scaffolding): Add the necessary fields to create the resource + resource: + volumeRef: volumesnapshot-dependency diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/00-secret.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/00-secret.yaml new file mode 100644 index 000000000..045711ee7 --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/00-secret.yaml @@ -0,0 +1,6 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + - command: kubectl create secret generic openstack-clouds --from-file=clouds.yaml=${E2E_KUTTL_OSCLOUDS} ${E2E_KUTTL_CACERT_OPT} + namespaced: true diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/01-assert.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/01-assert.yaml new file mode 100644 index 000000000..a18ca9b8d --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/01-assert.yaml @@ -0,0 +1,30 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: VolumeSnapshot +metadata: + name: volumesnapshot-dependency-no-secret +status: + conditions: + - type: Available + message: OpenStack resource is available + status: "True" + reason: Success + - type: Progressing + message: OpenStack resource is up to date + status: "False" + reason: Success +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: VolumeSnapshot +metadata: + name: volumesnapshot-dependency-no-volume +status: + conditions: + - type: Available + message: OpenStack resource is available + status: "True" + reason: Success + - type: Progressing + message: OpenStack resource is up to date + status: "False" + reason: Success diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/01-create-dependencies.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/01-create-dependencies.yaml new file mode 100644 index 000000000..25bec4688 --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/01-create-dependencies.yaml @@ -0,0 +1,19 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + - command: kubectl create secret generic volumesnapshot-dependency --from-file=clouds.yaml=${E2E_KUTTL_OSCLOUDS} ${E2E_KUTTL_CACERT_OPT} + namespaced: true +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Volume +metadata: + name: volumesnapshot-dependency-pending +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + # TODO(scaffolding): Add the necessary fields to create the resource + resource: {} diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/02-assert.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/02-assert.yaml new file mode 100644 index 000000000..f8fade314 --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/02-assert.yaml @@ -0,0 +1,17 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +resourceRefs: + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Volume + name: volumesnapshot-dependency + ref: volume + - apiVersion: v1 + kind: Secret + name: volumesnapshot-dependency + ref: secret +assertAll: + - celExpr: "volume.metadata.deletionTimestamp != 0" + - celExpr: "'openstack.k-orc.cloud/volumesnapshot' in volume.metadata.finalizers" + - celExpr: "secret.metadata.deletionTimestamp != 0" + - celExpr: "'openstack.k-orc.cloud/volumesnapshot' in secret.metadata.finalizers" diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/02-delete-dependencies.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/02-delete-dependencies.yaml new file mode 100644 index 000000000..4c24b6c94 --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/02-delete-dependencies.yaml @@ -0,0 +1,9 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + # We expect the deletion to hang due to the finalizer, so use --wait=false + - command: kubectl delete volume.openstack.k-orc.cloud volumesnapshot-dependency --wait=false + namespaced: true + - command: kubectl delete secret volumesnapshot-dependency --wait=false + namespaced: true diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/03-assert.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/03-assert.yaml new file mode 100644 index 000000000..879f88bfa --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/03-assert.yaml @@ -0,0 +1,9 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +commands: +# Dependencies that were prevented deletion before should now be gone +- script: "! kubectl get volume.openstack.k-orc.cloud volumesnapshot-dependency --namespace $NAMESPACE" + skipLogOutput: true +- script: "! kubectl get secret volumesnapshot-dependency --namespace $NAMESPACE" + skipLogOutput: true diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/03-delete-resources.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/03-delete-resources.yaml new file mode 100644 index 000000000..c1f4e9356 --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/03-delete-resources.yaml @@ -0,0 +1,10 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +delete: +- apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: VolumeSnapshot + name: volumesnapshot-dependency-no-secret +- apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: VolumeSnapshot + name: volumesnapshot-dependency-no-volume diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/README.md b/internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/README.md new file mode 100644 index 000000000..a5effdbcb --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/README.md @@ -0,0 +1,21 @@ +# Creation and deletion dependencies + +## Step 00 + +Create VolumeSnapshots referencing non-existing resources. Each VolumeSnapshot is dependent on other non-existing resource. Verify that the VolumeSnapshots are waiting for the needed resources to be created externally. + +## Step 01 + +Create the missing dependencies and verify all the VolumeSnapshots are available. + +## Step 02 + +Delete all the dependencies and check that ORC prevents deletion since there is still a resource that depends on them. + +## Step 03 + +Delete the VolumeSnapshots and validate that all resources are gone. + +## Reference + +https://k-orc.cloud/development/writing-tests/#dependency diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/00-assert.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/00-assert.yaml new file mode 100644 index 000000000..8da50e9c1 --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/00-assert.yaml @@ -0,0 +1,30 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: VolumeSnapshot +metadata: + name: volumesnapshot-import-error-external-1 +status: + conditions: + - type: Available + message: OpenStack resource is available + status: "True" + reason: Success + - type: Progressing + message: OpenStack resource is up to date + status: "False" + reason: Success +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: VolumeSnapshot +metadata: + name: volumesnapshot-import-error-external-2 +status: + conditions: + - type: Available + message: OpenStack resource is available + status: "True" + reason: Success + - type: Progressing + message: OpenStack resource is up to date + status: "False" + reason: Success diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/00-create-resources.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/00-create-resources.yaml new file mode 100644 index 000000000..b86b9e139 --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/00-create-resources.yaml @@ -0,0 +1,43 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Volume +metadata: + name: volumesnapshot-import-error +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + # TODO(scaffolding): Add the necessary fields to create the resource + resource: {} +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: VolumeSnapshot +metadata: + name: volumesnapshot-import-error-external-1 +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + description: VolumeSnapshot from "import error" test + volumeRef: volumesnapshot-import-error + # TODO(scaffolding): add any required field +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: VolumeSnapshot +metadata: + name: volumesnapshot-import-error-external-2 +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + description: VolumeSnapshot from "import error" test + volumeRef: volumesnapshot-import-error + # TODO(scaffolding): add any required field diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/00-secret.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/00-secret.yaml new file mode 100644 index 000000000..045711ee7 --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/00-secret.yaml @@ -0,0 +1,6 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + - command: kubectl create secret generic openstack-clouds --from-file=clouds.yaml=${E2E_KUTTL_OSCLOUDS} ${E2E_KUTTL_CACERT_OPT} + namespaced: true diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/01-assert.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/01-assert.yaml new file mode 100644 index 000000000..4909f8923 --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/01-assert.yaml @@ -0,0 +1,15 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: VolumeSnapshot +metadata: + name: volumesnapshot-import-error +status: + conditions: + - type: Available + message: found more than one matching OpenStack resource during import + status: "False" + reason: InvalidConfiguration + - type: Progressing + message: found more than one matching OpenStack resource during import + status: "False" + reason: InvalidConfiguration diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/01-import-resource.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/01-import-resource.yaml new file mode 100644 index 000000000..9cade4b31 --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/01-import-resource.yaml @@ -0,0 +1,13 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: VolumeSnapshot +metadata: + name: volumesnapshot-import-error +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: unmanaged + import: + filter: + description: VolumeSnapshot from "import error" test diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/README.md b/internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/README.md new file mode 100644 index 000000000..866a472f1 --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/README.md @@ -0,0 +1,13 @@ +# Import VolumeSnapshot with more than one matching resources + +## Step 00 + +Create two VolumeSnapshots with identical specs. + +## Step 01 + +Ensure that an imported VolumeSnapshot with a filter matching the resources returns an error. + +## Reference + +https://k-orc.cloud/development/writing-tests/#import-error diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-import/00-assert.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-import/00-assert.yaml new file mode 100644 index 000000000..01002b11f --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-import/00-assert.yaml @@ -0,0 +1,15 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: VolumeSnapshot +metadata: + name: volumesnapshot-import +status: + conditions: + - type: Available + message: Waiting for OpenStack resource to be created externally + status: "False" + reason: Progressing + - type: Progressing + message: Waiting for OpenStack resource to be created externally + status: "True" + reason: Progressing diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-import/00-import-resource.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-import/00-import-resource.yaml new file mode 100644 index 000000000..bd75f6ec7 --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-import/00-import-resource.yaml @@ -0,0 +1,15 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: VolumeSnapshot +metadata: + name: volumesnapshot-import +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: unmanaged + import: + filter: + name: volumesnapshot-import-external + description: VolumeSnapshot volumesnapshot-import-external from "volumesnapshot-import" test + # TODO(scaffolding): Add all fields supported by the filter diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-import/00-secret.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-import/00-secret.yaml new file mode 100644 index 000000000..045711ee7 --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-import/00-secret.yaml @@ -0,0 +1,6 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + - command: kubectl create secret generic openstack-clouds --from-file=clouds.yaml=${E2E_KUTTL_OSCLOUDS} ${E2E_KUTTL_CACERT_OPT} + namespaced: true diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-import/01-assert.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-import/01-assert.yaml new file mode 100644 index 000000000..07d59f1b1 --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-import/01-assert.yaml @@ -0,0 +1,34 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: VolumeSnapshot +metadata: + name: volumesnapshot-import-external-not-this-one +status: + conditions: + - type: Available + message: OpenStack resource is available + status: "True" + reason: Success + - type: Progressing + message: OpenStack resource is up to date + status: "False" + reason: Success + resource: + name: volumesnapshot-import-external-not-this-one + description: VolumeSnapshot volumesnapshot-import-external from "volumesnapshot-import" test + # TODO(scaffolding): Add fields necessary to match filter +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: VolumeSnapshot +metadata: + name: volumesnapshot-import +status: + conditions: + - type: Available + message: Waiting for OpenStack resource to be created externally + status: "False" + reason: Progressing + - type: Progressing + message: Waiting for OpenStack resource to be created externally + status: "True" + reason: Progressing diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-import/01-create-trap-resource.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-import/01-create-trap-resource.yaml new file mode 100644 index 000000000..be403c937 --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-import/01-create-trap-resource.yaml @@ -0,0 +1,31 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Volume +metadata: + name: volumesnapshot-import-external-not-this-one +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + # TODO(scaffolding): Add the necessary fields to create the resource + resource: {} +--- +# This `volumesnapshot-import-external-not-this-one` resource serves two purposes: +# - ensure that we can successfully create another resource which name is a substring of it (i.e. it's not being adopted) +# - ensure that importing a resource which name is a substring of it will not pick this one. +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: VolumeSnapshot +metadata: + name: volumesnapshot-import-external-not-this-one +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + description: VolumeSnapshot volumesnapshot-import-external from "volumesnapshot-import" test + volumeRef: volumesnapshot-import-external-not-this-one + # TODO(scaffolding): Add fields necessary to match filter diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-import/02-assert.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-import/02-assert.yaml new file mode 100644 index 000000000..889d3389c --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-import/02-assert.yaml @@ -0,0 +1,33 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +resourceRefs: + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: VolumeSnapshot + name: volumesnapshot-import-external + ref: volumesnapshot1 + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: VolumeSnapshot + name: volumesnapshot-import-external-not-this-one + ref: volumesnapshot2 +assertAll: + - celExpr: "volumesnapshot1.status.id != volumesnapshot2.status.id" +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: VolumeSnapshot +metadata: + name: volumesnapshot-import +status: + conditions: + - type: Available + message: OpenStack resource is available + status: "True" + reason: Success + - type: Progressing + message: OpenStack resource is up to date + status: "False" + reason: Success + resource: + name: volumesnapshot-import-external + description: VolumeSnapshot volumesnapshot-import-external from "volumesnapshot-import" test + # TODO(scaffolding): Add all fields the resource supports diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-import/02-create-resource.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-import/02-create-resource.yaml new file mode 100644 index 000000000..884f6ad9e --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-import/02-create-resource.yaml @@ -0,0 +1,28 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Volume +metadata: + name: volumesnapshot-import +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + # TODO(scaffolding): Add the necessary fields to create the resource + resource: {} +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: VolumeSnapshot +metadata: + name: volumesnapshot-import-external +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + description: VolumeSnapshot volumesnapshot-import-external from "volumesnapshot-import" test + volumeRef: volumesnapshot-import + # TODO(scaffolding): Add fields necessary to match filter diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-import/README.md b/internal/controllers/volumesnapshot/tests/volumesnapshot-import/README.md new file mode 100644 index 000000000..7c75e446c --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-import/README.md @@ -0,0 +1,18 @@ +# Import VolumeSnapshot + +## Step 00 + +Import a volumesnapshot that matches all fields in the filter, and verify it is waiting for the external resource to be created. + +## Step 01 + +Create a volumesnapshot whose name is a superstring of the one specified in the import filter, otherwise matching the filter, and verify that it's not being imported. + +## Step 02 + +Create a volumesnapshot matching the filter and verify that the observed status on the imported volumesnapshot corresponds to the spec of the created volumesnapshot. +Also, confirm that it does not adopt any volumesnapshot whose name is a superstring of its own. + +## Reference + +https://k-orc.cloud/development/writing-tests/#import diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-update/00-assert.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-update/00-assert.yaml new file mode 100644 index 000000000..3cd814f61 --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-update/00-assert.yaml @@ -0,0 +1,26 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +resourceRefs: + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: VolumeSnapshot + name: volumesnapshot-update + ref: volumesnapshot +assertAll: + - celExpr: "!has(volumesnapshot.status.resource.description)" +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: VolumeSnapshot +metadata: + name: volumesnapshot-update +status: + resource: + name: volumesnapshot-update + # TODO(scaffolding): Add matches for more fields + conditions: + - type: Available + status: "True" + reason: Success + - type: Progressing + status: "False" + reason: Success diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-update/00-minimal-resource.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-update/00-minimal-resource.yaml new file mode 100644 index 000000000..35b469a16 --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-update/00-minimal-resource.yaml @@ -0,0 +1,28 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Volume +metadata: + name: volumesnapshot-update +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + # TODO(scaffolding): Add the necessary fields to create the resource + resource: {} +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: VolumeSnapshot +metadata: + name: volumesnapshot-update +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created or updated + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + # TODO(scaffolding): Only add the mandatory fields. It's possible the resource + # doesn't have mandatory fields, in that case, leave it empty. + resource: + volumeRef: volumesnapshot-update diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-update/00-secret.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-update/00-secret.yaml new file mode 100644 index 000000000..045711ee7 --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-update/00-secret.yaml @@ -0,0 +1,6 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + - command: kubectl create secret generic openstack-clouds --from-file=clouds.yaml=${E2E_KUTTL_OSCLOUDS} ${E2E_KUTTL_CACERT_OPT} + namespaced: true diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-update/01-assert.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-update/01-assert.yaml new file mode 100644 index 000000000..65cf8fa0b --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-update/01-assert.yaml @@ -0,0 +1,17 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: VolumeSnapshot +metadata: + name: volumesnapshot-update +status: + resource: + name: volumesnapshot-update-updated + description: volumesnapshot-update-updated + # TODO(scaffolding): match all fields that were modified + conditions: + - type: Available + status: "True" + reason: Success + - type: Progressing + status: "False" + reason: Success diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-update/01-updated-resource.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-update/01-updated-resource.yaml new file mode 100644 index 000000000..3f5609470 --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-update/01-updated-resource.yaml @@ -0,0 +1,10 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: VolumeSnapshot +metadata: + name: volumesnapshot-update +spec: + resource: + name: volumesnapshot-update-updated + description: volumesnapshot-update-updated + # TODO(scaffolding): update all mutable fields diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-update/02-assert.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-update/02-assert.yaml new file mode 100644 index 000000000..3258067e9 --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-update/02-assert.yaml @@ -0,0 +1,26 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +resourceRefs: + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: VolumeSnapshot + name: volumesnapshot-update + ref: volumesnapshot +assertAll: + - celExpr: "!has(volumesnapshot.status.resource.description)" +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: VolumeSnapshot +metadata: + name: volumesnapshot-update +status: + resource: + name: volumesnapshot-update + # TODO(scaffolding): validate that updated fields were all reverted to their original value + conditions: + - type: Available + status: "True" + reason: Success + - type: Progressing + status: "False" + reason: Success diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-update/02-reverted-resource.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-update/02-reverted-resource.yaml new file mode 100644 index 000000000..2c6c253ff --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-update/02-reverted-resource.yaml @@ -0,0 +1,7 @@ +# NOTE: kuttl only does patch updates, which means we can't delete a field. +# We have to use a kubectl apply command instead. +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + - command: kubectl replace -f 00-minimal-resource.yaml + namespaced: true diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-update/README.md b/internal/controllers/volumesnapshot/tests/volumesnapshot-update/README.md new file mode 100644 index 000000000..b904777a8 --- /dev/null +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-update/README.md @@ -0,0 +1,17 @@ +# Update VolumeSnapshot + +## Step 00 + +Create a VolumeSnapshot using only mandatory fields. + +## Step 01 + +Update all mutable fields. + +## Step 02 + +Revert the resource to its original value and verify that the resulting object matches its state when first created. + +## Reference + +https://k-orc.cloud/development/writing-tests/#update diff --git a/internal/osclients/volumesnapshot.go b/internal/osclients/volumesnapshot.go new file mode 100644 index 000000000..de4b6f084 --- /dev/null +++ b/internal/osclients/volumesnapshot.go @@ -0,0 +1,104 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package osclients + +import ( + "context" + "fmt" + "iter" + + "github.com/gophercloud/gophercloud/v2" + "github.com/gophercloud/gophercloud/v2/openstack" + "github.com/gophercloud/gophercloud/v2/openstack/blockstorage/v3/snapshots" + "github.com/gophercloud/utils/v2/openstack/clientconfig" +) + +type VolumeSnapshotClient interface { + ListVolumeSnapshots(ctx context.Context, listOpts snapshots.ListOptsBuilder) iter.Seq2[*snapshots.Snapshot, error] + CreateVolumeSnapshot(ctx context.Context, opts snapshots.CreateOptsBuilder) (*snapshots.Snapshot, error) + DeleteVolumeSnapshot(ctx context.Context, resourceID string) error + GetVolumeSnapshot(ctx context.Context, resourceID string) (*snapshots.Snapshot, error) + UpdateVolumeSnapshot(ctx context.Context, id string, opts snapshots.UpdateOptsBuilder) (*snapshots.Snapshot, error) +} + +type volumesnapshotClient struct{ client *gophercloud.ServiceClient } + +// NewVolumeSnapshotClient returns a new OpenStack client. +func NewVolumeSnapshotClient(providerClient *gophercloud.ProviderClient, providerClientOpts *clientconfig.ClientOpts) (VolumeSnapshotClient, error) { + client, err := openstack.NewBlockStorageV3(providerClient, gophercloud.EndpointOpts{ + Region: providerClientOpts.RegionName, + Availability: clientconfig.GetEndpointType(providerClientOpts.EndpointType), + }) + + if err != nil { + return nil, fmt.Errorf("failed to create volumesnapshot service client: %v", err) + } + + return &volumesnapshotClient{client}, nil +} + +func (c volumesnapshotClient) ListVolumeSnapshots(ctx context.Context, listOpts snapshots.ListOptsBuilder) iter.Seq2[*snapshots.Snapshot, error] { + pager := snapshots.List(c.client, listOpts) + return func(yield func(*snapshots.Snapshot, error) bool) { + _ = pager.EachPage(ctx, yieldPage(snapshots.ExtractSnapshots, yield)) + } +} + +func (c volumesnapshotClient) CreateVolumeSnapshot(ctx context.Context, opts snapshots.CreateOptsBuilder) (*snapshots.Snapshot, error) { + return snapshots.Create(ctx, c.client, opts).Extract() +} + +func (c volumesnapshotClient) DeleteVolumeSnapshot(ctx context.Context, resourceID string) error { + return snapshots.Delete(ctx, c.client, resourceID).ExtractErr() +} + +func (c volumesnapshotClient) GetVolumeSnapshot(ctx context.Context, resourceID string) (*snapshots.Snapshot, error) { + return snapshots.Get(ctx, c.client, resourceID).Extract() +} + +func (c volumesnapshotClient) UpdateVolumeSnapshot(ctx context.Context, id string, opts snapshots.UpdateOptsBuilder) (*snapshots.Snapshot, error) { + return snapshots.Update(ctx, c.client, id, opts).Extract() +} + +type volumesnapshotErrorClient struct{ error } + +// NewVolumeSnapshotErrorClient returns a VolumeSnapshotClient in which every method returns the given error. +func NewVolumeSnapshotErrorClient(e error) VolumeSnapshotClient { + return volumesnapshotErrorClient{e} +} + +func (e volumesnapshotErrorClient) ListVolumeSnapshots(_ context.Context, _ snapshots.ListOptsBuilder) iter.Seq2[*snapshots.Snapshot, error] { + return func(yield func(*snapshots.Snapshot, error) bool) { + yield(nil, e.error) + } +} + +func (e volumesnapshotErrorClient) CreateVolumeSnapshot(_ context.Context, _ snapshots.CreateOptsBuilder) (*snapshots.Snapshot, error) { + return nil, e.error +} + +func (e volumesnapshotErrorClient) DeleteVolumeSnapshot(_ context.Context, _ string) error { + return e.error +} + +func (e volumesnapshotErrorClient) GetVolumeSnapshot(_ context.Context, _ string) (*snapshots.Snapshot, error) { + return nil, e.error +} + +func (e volumesnapshotErrorClient) UpdateVolumeSnapshot(_ context.Context, _ string, _ snapshots.UpdateOptsBuilder) (*snapshots.Snapshot, error) { + return nil, e.error +} From a6aad74754929d1036524c6b35d6988cec7d5d85 Mon Sep 17 00:00:00 2001 From: Mohammed Al-Dokimi Date: Fri, 20 Feb 2026 21:59:22 +0000 Subject: [PATCH 2/9] Add VolumeSnapshot API types Add proper fields, validations, and metadata types for VolumeSnapshotResourceSpec (force, metadata), VolumeSnapshotFilter (status, volumeID), and VolumeSnapshotResourceStatus (size, metadata, progress, projectID, userID, groupSnapshotID, consumesQuota, createdAt, updatedAt) to align with the Cinder Volume Snapshot API. Those are all acoording to https://docs.openstack.org/api-ref/block-storage/v3/#volume-snapshots-snapshots:~:text=Volume%20snapshots%20(snapshots)%C2%B6 --- api/v1alpha1/volumesnapshot_types.go | 111 ++++++++++++++++++++++----- cmd/resource-generator/main.go | 3 + 2 files changed, 96 insertions(+), 18 deletions(-) diff --git a/api/v1alpha1/volumesnapshot_types.go b/api/v1alpha1/volumesnapshot_types.go index 32da724ae..486698bb4 100644 --- a/api/v1alpha1/volumesnapshot_types.go +++ b/api/v1alpha1/volumesnapshot_types.go @@ -16,6 +16,8 @@ limitations under the License. package v1alpha1 +import metav1 "k8s.io/apimachinery/pkg/apis/meta/v1" + // VolumeSnapshotResourceSpec contains the desired state of the resource. type VolumeSnapshotResourceSpec struct { // name will be the name of the created resource. If not specified, the @@ -29,18 +31,22 @@ type VolumeSnapshotResourceSpec struct { // +optional Description *string `json:"description,omitempty"` - // volumeRef is a reference to the ORC Volume which this resource is associated with. + // volumeRef is a reference to the ORC Volume to create a snapshot from. // +required // +kubebuilder:validation:XValidation:rule="self == oldSelf",message="volumeRef is immutable" VolumeRef KubernetesNameRef `json:"volumeRef,omitempty"` - // TODO(scaffolding): Add more types. - // To see what is supported, you can take inspiration from the CreateOpts structure from - // github.com/gophercloud/gophercloud/v2/openstack/blockstorage/v3/snapshots - // - // Until you have implemented mutability for the field, you must add a CEL validation - // preventing the field being modified: - // `// +kubebuilder:validation:XValidation:rule="self == oldSelf",message=" is immutable"` + // force allows creating a snapshot even if the volume is attached. + // +optional + // +kubebuilder:validation:XValidation:rule="self == oldSelf",message="force is immutable" + Force *bool `json:"force,omitempty"` + + // metadata key and value pairs to be associated with the snapshot. + // +kubebuilder:validation:XValidation:rule="self == oldSelf",message="metadata is immutable" + // +kubebuilder:validation:MaxItems:=64 + // +listType=atomic + // +optional + Metadata []VolumeSnapshotMetadata `json:"metadata,omitempty"` } // VolumeSnapshotFilter defines an existing resource by its properties @@ -50,20 +56,22 @@ type VolumeSnapshotFilter struct { // +optional Name *OpenStackName `json:"name,omitempty"` - // description of the existing resource + // status of the existing resource // +kubebuilder:validation:MinLength:=1 // +kubebuilder:validation:MaxLength:=255 // +optional - Description *string `json:"description,omitempty"` + Status *string `json:"status,omitempty"` - // TODO(scaffolding): Add more types. - // To see what is supported, you can take inspiration from the ListOpts structure from - // github.com/gophercloud/gophercloud/v2/openstack/blockstorage/v3/snapshots + // volumeID is the ID of the volume the snapshot was created from + // +kubebuilder:validation:MinLength:=1 + // +kubebuilder:validation:MaxLength:=255 + // +optional + VolumeID *string `json:"volumeID,omitempty"` } // VolumeSnapshotResourceStatus represents the observed state of the resource. type VolumeSnapshotResourceStatus struct { - // name is a Human-readable name for the resource. Might not be unique. + // name is a human-readable name for the resource. Might not be unique. // +kubebuilder:validation:MaxLength=1024 // +optional Name string `json:"name,omitempty"` @@ -73,12 +81,79 @@ type VolumeSnapshotResourceStatus struct { // +optional Description string `json:"description,omitempty"` - // volumeID is the ID of the Volume to which the resource is associated. + // status represents the current status of the snapshot. + // +kubebuilder:validation:MaxLength=1024 + // +optional + Status string `json:"status,omitempty"` + + // size is the size of the snapshot in GiB. + // +optional + Size *int32 `json:"size,omitempty"` + + // volumeID is the ID of the volume the snapshot was created from. // +kubebuilder:validation:MaxLength=1024 // +optional VolumeID string `json:"volumeID,omitempty"` - // TODO(scaffolding): Add more types. - // To see what is supported, you can take inspiration from the Snapshot structure from - // github.com/gophercloud/gophercloud/v2/openstack/blockstorage/v3/snapshots + // metadata key and value pairs associated with the snapshot. + // +kubebuilder:validation:MaxItems:=64 + // +listType=atomic + // +optional + Metadata []VolumeSnapshotMetadataStatus `json:"metadata,omitempty"` + + // progress is the percentage of completion of the snapshot creation. + // +kubebuilder:validation:MaxLength=1024 + // +optional + Progress string `json:"progress,omitempty"` + + // projectID is the ID of the project that owns the snapshot. + // +kubebuilder:validation:MaxLength=1024 + // +optional + ProjectID string `json:"projectID,omitempty"` + + // userID is the ID of the user who created the snapshot. + // +kubebuilder:validation:MaxLength=1024 + // +optional + UserID string `json:"userID,omitempty"` + + // groupSnapshotID is the ID of the group snapshot, if applicable. + // +kubebuilder:validation:MaxLength=1024 + // +optional + GroupSnapshotID string `json:"groupSnapshotID,omitempty"` + + // consumesQuota indicates whether the snapshot consumes quota. + // +optional + ConsumesQuota *bool `json:"consumesQuota,omitempty"` + + // createdAt shows the date and time when the resource was created. The date and time stamp format is ISO 8601. + // +optional + CreatedAt *metav1.Time `json:"createdAt,omitempty"` + + // updatedAt shows the date and time when the resource was updated. The date and time stamp format is ISO 8601. + // +optional + UpdatedAt *metav1.Time `json:"updatedAt,omitempty"` +} + +type VolumeSnapshotMetadata struct { + // name is the name of the metadata + // +kubebuilder:validation:MaxLength:=255 + // +required + Name string `json:"name"` + + // value is the value of the metadata + // +kubebuilder:validation:MaxLength:=255 + // +required + Value string `json:"value"` +} + +type VolumeSnapshotMetadataStatus struct { + // name is the name of the metadata + // +kubebuilder:validation:MaxLength:=255 + // +optional + Name string `json:"name,omitempty"` + + // value is the value of the metadata + // +kubebuilder:validation:MaxLength:=255 + // +optional + Value string `json:"value,omitempty"` } diff --git a/cmd/resource-generator/main.go b/cmd/resource-generator/main.go index 37c577523..3d06965db 100644 --- a/cmd/resource-generator/main.go +++ b/cmd/resource-generator/main.go @@ -154,6 +154,9 @@ var resources []templateFields = []templateFields{ { Name: "Volume", }, + { + Name: "VolumeSnapshot", + }, { Name: "VolumeType", }, From 9eb3e2d66fefeff2ae89ff4572d4cb3bd4e1365f Mon Sep 17 00:00:00 2001 From: Mohammed Al-Dokimi Date: Sat, 21 Feb 2026 02:27:16 +0000 Subject: [PATCH 3/9] Add VolumeSnapshot client Wire the scaffolded VolumeSnapshotClient into the Scope interface, provider implementation, and MockScopeFactory. Add go:generate directives for mock generation of the VolumeSnapshotClient. --- internal/osclients/mock/doc.go | 3 +++ internal/scope/mock.go | 7 +++++++ internal/scope/provider.go | 4 ++++ internal/scope/scope.go | 1 + 4 files changed, 15 insertions(+) diff --git a/internal/osclients/mock/doc.go b/internal/osclients/mock/doc.go index 71870a3a7..d4c0662b7 100644 --- a/internal/osclients/mock/doc.go +++ b/internal/osclients/mock/doc.go @@ -62,5 +62,8 @@ import ( //go:generate mockgen -package mock -destination=volume.go -source=../volume.go github.com/k-orc/openstack-resource-controller/internal/osclients/mock VolumeClient //go:generate /usr/bin/env bash -c "cat ../../../hack/boilerplate.go.txt volume.go > _volume.go && mv _volume.go volume.go" +//go:generate mockgen -package mock -destination=volumesnapshot.go -source=../volumesnapshot.go github.com/k-orc/openstack-resource-controller/internal/osclients/mock VolumeSnapshotClient +//go:generate /usr/bin/env bash -c "cat ../../../hack/boilerplate.go.txt volumesnapshot.go > _volumesnapshot.go && mv _volumesnapshot.go volumesnapshot.go" + //go:generate mockgen -package mock -destination=volumetype.go -source=../volumetype.go github.com/k-orc/openstack-resource-controller/internal/osclients/mock VolumeTypeClient //go:generate /usr/bin/env bash -c "cat ../../../hack/boilerplate.go.txt volumetype.go > _volumetype.go && mv _volumetype.go volumetype.go" diff --git a/internal/scope/mock.go b/internal/scope/mock.go index 71bd8d8e6..8ec7fd7cf 100644 --- a/internal/scope/mock.go +++ b/internal/scope/mock.go @@ -48,6 +48,7 @@ type MockScopeFactory struct { UserClient *mock.MockUserClient VolumeClient *mock.MockVolumeClient VolumeTypeClient *mock.MockVolumeTypeClient + VolumeSnapshotClient *mock.MockVolumeSnapshotClient clientScopeCreateError error } @@ -66,6 +67,7 @@ func NewMockScopeFactory(mockCtrl *gomock.Controller) *MockScopeFactory { serviceClient := mock.NewMockServiceClient(mockCtrl) userClient := mock.NewMockUserClient(mockCtrl) volumeClient := mock.NewMockVolumeClient(mockCtrl) + volumesnapshotClient := mock.NewMockVolumeSnapshotClient(mockCtrl) volumetypeClient := mock.NewMockVolumeTypeClient(mockCtrl) return &MockScopeFactory{ @@ -82,6 +84,7 @@ func NewMockScopeFactory(mockCtrl *gomock.Controller) *MockScopeFactory { ServiceClient: serviceClient, UserClient: userClient, VolumeClient: volumeClient, + VolumeSnapshotClient: volumesnapshotClient, VolumeTypeClient: volumetypeClient, } } @@ -125,6 +128,10 @@ func (f *MockScopeFactory) NewVolumeClient() (osclients.VolumeClient, error) { return f.VolumeClient, nil } +func (f *MockScopeFactory) NewVolumeSnapshotClient() (osclients.VolumeSnapshotClient, error) { + return f.VolumeSnapshotClient, nil +} + func (f *MockScopeFactory) NewVolumeTypeClient() (osclients.VolumeTypeClient, error) { return f.VolumeTypeClient, nil } diff --git a/internal/scope/provider.go b/internal/scope/provider.go index 6f9902c39..13b7cf9fc 100644 --- a/internal/scope/provider.go +++ b/internal/scope/provider.go @@ -165,6 +165,10 @@ func (s *providerScope) NewVolumeClient() (clients.VolumeClient, error) { return clients.NewVolumeClient(s.providerClient, s.providerClientOpts) } +func (s *providerScope) NewVolumeSnapshotClient() (clients.VolumeSnapshotClient, error) { + return clients.NewVolumeSnapshotClient(s.providerClient, s.providerClientOpts) +} + func (s *providerScope) NewVolumeTypeClient() (clients.VolumeTypeClient, error) { return clients.NewVolumeTypeClient(s.providerClient, s.providerClientOpts) } diff --git a/internal/scope/scope.go b/internal/scope/scope.go index 6ed103308..5a9588626 100644 --- a/internal/scope/scope.go +++ b/internal/scope/scope.go @@ -61,6 +61,7 @@ type Scope interface { NewServiceClient() (osclients.ServiceClient, error) NewUserClient() (osclients.UserClient, error) NewVolumeClient() (osclients.VolumeClient, error) + NewVolumeSnapshotClient() (osclients.VolumeSnapshotClient, error) NewVolumeTypeClient() (osclients.VolumeTypeClient, error) ExtractToken() (*tokens.Token, error) } From 37b298c3ac7a143348077b42844cd23ea7220c5d Mon Sep 17 00:00:00 2001 From: Mohammed Al-Dokimi Date: Sat, 21 Feb 2026 02:33:55 +0000 Subject: [PATCH 4/9] Create VolumeSnapshot actuator --- .../controllers/volumesnapshot/actuator.go | 69 +++++++++++-------- 1 file changed, 39 insertions(+), 30 deletions(-) diff --git a/internal/controllers/volumesnapshot/actuator.go b/internal/controllers/volumesnapshot/actuator.go index 2250a447f..3aae26f16 100644 --- a/internal/controllers/volumesnapshot/actuator.go +++ b/internal/controllers/volumesnapshot/actuator.go @@ -44,10 +44,11 @@ type ( resourceReconciler = interfaces.ResourceReconciler[orcObjectPT, osResourceT] helperFactory = interfaces.ResourceHelperFactory[orcObjectPT, orcObjectT, resourceSpecT, filterT, osResourceT] ) -// The frequency to poll when waiting for the resource to become available -const volumesnapshotAvailablePollingPeriod = 15 * time.Second -// The frequency to poll when waiting for the resource to be deleted -const volumesnapshotDeletingPollingPeriod = 15 * time.Second + +const ( + volumesnapshotAvailablePollingPeriod = 15 * time.Second + volumesnapshotDeletingPollingPeriod = 15 * time.Second +) type volumesnapshotActuator struct { osClient osclients.VolumeSnapshotClient @@ -75,32 +76,36 @@ func (actuator volumesnapshotActuator) ListOSResourcesForAdoption(ctx context.Co return nil, false } - // TODO(scaffolding) If you need to filter resources on fields that the List() function - // of gophercloud does not support, it's possible to perform client-side filtering. - // Check osclients.ResourceFilter + var filters []osclients.ResourceFilter[osResourceT] + + if resourceSpec.Description != nil { + filters = append(filters, func(s *snapshots.Snapshot) bool { + return s.Description == *resourceSpec.Description + }) + } listOpts := snapshots.ListOpts{ - Name: getResourceName(orcObject), - Description: ptr.Deref(resourceSpec.Description, ""), + Name: getResourceName(orcObject), } - return actuator.osClient.ListVolumeSnapshots(ctx, listOpts), true + return actuator.listOSResources(ctx, filters, listOpts), true } func (actuator volumesnapshotActuator) ListOSResourcesForImport(ctx context.Context, obj orcObjectPT, filter filterT) (iter.Seq2[*osResourceT, error], progress.ReconcileStatus) { - // TODO(scaffolding) If you need to filter resources on fields that the List() function - // of gophercloud does not support, it's possible to perform client-side filtering. - // Check osclients.ResourceFilter - listOpts := snapshots.ListOpts{ - Name: string(ptr.Deref(filter.Name, "")), - Description: string(ptr.Deref(filter.Description, "")), - // TODO(scaffolding): Add more import filters + Name: string(ptr.Deref(filter.Name, "")), + Status: ptr.Deref(filter.Status, ""), + VolumeID: ptr.Deref(filter.VolumeID, ""), } return actuator.osClient.ListVolumeSnapshots(ctx, listOpts), nil } +func (actuator volumesnapshotActuator) listOSResources(ctx context.Context, filters []osclients.ResourceFilter[osResourceT], listOpts snapshots.ListOptsBuilder) iter.Seq2[*snapshots.Snapshot, error] { + results := actuator.osClient.ListVolumeSnapshots(ctx, listOpts) + return osclients.Filter(results, filters...) +} + func (actuator volumesnapshotActuator) CreateResource(ctx context.Context, obj orcObjectPT) (*osResourceT, progress.ReconcileStatus) { resource := obj.Spec.Resource @@ -112,23 +117,29 @@ func (actuator volumesnapshotActuator) CreateResource(ctx context.Context, obj o var reconcileStatus progress.ReconcileStatus var volumeID string - volume, volumeDepRS := volumeDependency.GetDependency( - ctx, actuator.k8sClient, obj, func(dep *orcv1alpha1.Volume) bool { - return orcv1alpha1.IsAvailable(dep) && dep.Status.ID != nil - }, - ) - reconcileStatus = reconcileStatus.WithReconcileStatus(volumeDepRS) - if volume != nil { - volumeID = ptr.Deref(volume.Status.ID, "") - } + volume, volumeDepRS := volumeDependency.GetDependency( + ctx, actuator.k8sClient, obj, func(dep *orcv1alpha1.Volume) bool { + return orcv1alpha1.IsAvailable(dep) && dep.Status.ID != nil + }, + ) + reconcileStatus = reconcileStatus.WithReconcileStatus(volumeDepRS) + if volume != nil { + volumeID = ptr.Deref(volume.Status.ID, "") + } if needsReschedule, _ := reconcileStatus.NeedsReschedule(); needsReschedule { return nil, reconcileStatus } + metadata := make(map[string]string) + for _, m := range resource.Metadata { + metadata[m.Name] = m.Value + } + createOpts := snapshots.CreateOpts{ Name: getResourceName(obj), Description: ptr.Deref(resource.Description, ""), - VolumeID: volumeID, - // TODO(scaffolding): Add more fields + VolumeID: volumeID, + Force: ptr.Deref(resource.Force, false), + Metadata: metadata, } osResource, err := actuator.osClient.CreateVolumeSnapshot(ctx, createOpts) @@ -164,8 +175,6 @@ func (actuator volumesnapshotActuator) updateResource(ctx context.Context, obj o handleNameUpdate(&updateOpts, obj, osResource) handleDescriptionUpdate(&updateOpts, resource, osResource) - // TODO(scaffolding): add handler for all fields supporting mutability - needsUpdate, err := needsUpdate(updateOpts) if err != nil { return progress.WrapError( From 0740d8f1cf90c8cf7a78e00f97c31c61fe237c03 Mon Sep 17 00:00:00 2001 From: Mohammed Al-Dokimi Date: Sat, 21 Feb 2026 02:40:59 +0000 Subject: [PATCH 5/9] Create VolumeSnapshot status and add the controller in the manager --- cmd/manager/main.go | 2 + internal/controllers/volumesnapshot/status.go | 50 +++++++++++++---- internal/scope/mock.go | 56 +++++++++---------- 3 files changed, 69 insertions(+), 39 deletions(-) diff --git a/cmd/manager/main.go b/cmd/manager/main.go index 25eae08f3..96ae851e9 100644 --- a/cmd/manager/main.go +++ b/cmd/manager/main.go @@ -50,6 +50,7 @@ import ( "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/trunk" "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/user" "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/volume" + "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/volumesnapshot" "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/volumetype" internalmanager "github.com/k-orc/openstack-resource-controller/v2/internal/manager" "github.com/k-orc/openstack-resource-controller/v2/internal/scheme" @@ -128,6 +129,7 @@ func main() { project.New(scopeFactory), user.New(scopeFactory), volume.New(scopeFactory), + volumesnapshot.New(scopeFactory), volumetype.New(scopeFactory), domain.New(scopeFactory), service.New(scopeFactory), diff --git a/internal/controllers/volumesnapshot/status.go b/internal/controllers/volumesnapshot/status.go index 04d0370ad..f82b04732 100644 --- a/internal/controllers/volumesnapshot/status.go +++ b/internal/controllers/volumesnapshot/status.go @@ -25,11 +25,11 @@ import ( "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/generic/progress" orcapplyconfigv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/pkg/clients/applyconfiguration/api/v1alpha1" ) -// TODO(scaffolding): these are just examples. Change them to the controller's need. -// Ideally, these constants are defined in gophercloud. -const SnapshotStatusAvailable = "available" -const SnapshotStatusInUse = "in-use" -const SnapshotStatusDeleting = "deleting" + +const ( + SnapshotStatusAvailable = "available" + SnapshotStatusDeleting = "deleting" +) type volumesnapshotStatusWriter struct{} @@ -50,9 +50,7 @@ func (volumesnapshotStatusWriter) ResourceAvailableStatus(orcObject *orcv1alpha1 return metav1.ConditionUnknown, nil } } - // TODO(scaffolding): add conditions for returning available, for instance: - - if osResource.Status == SnapshotStatusAvailable || osResource.Status == SnapshotStatusInUse { + if osResource.Status == SnapshotStatusAvailable { return metav1.ConditionTrue, nil } @@ -62,15 +60,45 @@ func (volumesnapshotStatusWriter) ResourceAvailableStatus(orcObject *orcv1alpha1 func (volumesnapshotStatusWriter) ApplyResourceStatus(log logr.Logger, osResource *osResourceT, statusApply *statusApplyT) { resourceStatus := orcapplyconfigv1alpha1.VolumeSnapshotResourceStatus(). + WithName(osResource.Name). WithVolumeID(osResource.VolumeID). - WithName(osResource.Name) + WithStatus(osResource.Status). + WithSize(int32(osResource.Size)). + WithCreatedAt(metav1.NewTime(osResource.CreatedAt)) - // TODO(scaffolding): add all of the fields supported in the VolumeSnapshotResourceStatus struct - // If a zero-value isn't expected in the response, place it behind a conditional + if !osResource.UpdatedAt.IsZero() { + resourceStatus.WithUpdatedAt(metav1.NewTime(osResource.UpdatedAt)) + } if osResource.Description != "" { resourceStatus.WithDescription(osResource.Description) } + if osResource.Progress != "" { + resourceStatus.WithProgress(osResource.Progress) + } + + if osResource.ProjectID != "" { + resourceStatus.WithProjectID(osResource.ProjectID) + } + + if osResource.UserID != "" { + resourceStatus.WithUserID(osResource.UserID) + } + + if osResource.GroupSnapshotID != "" { + resourceStatus.WithGroupSnapshotID(osResource.GroupSnapshotID) + } + + if osResource.ConsumesQuota { + resourceStatus.WithConsumesQuota(osResource.ConsumesQuota) + } + + for k, v := range osResource.Metadata { + resourceStatus.WithMetadata(orcapplyconfigv1alpha1.VolumeSnapshotMetadataStatus(). + WithName(k). + WithValue(v)) + } + statusApply.WithResource(resourceStatus) } diff --git a/internal/scope/mock.go b/internal/scope/mock.go index 8ec7fd7cf..e46d9bc82 100644 --- a/internal/scope/mock.go +++ b/internal/scope/mock.go @@ -34,20 +34,20 @@ import ( // MockScopeFactory implements both the ScopeFactory and ClientScope interfaces. It can be used in place of the default ProviderScopeFactory // when we want to use mocked service clients which do not attempt to connect to a running OpenStack cloud. type MockScopeFactory struct { - AddressScope *mock.MockAddressScopeClient - ComputeClient *mock.MockComputeClient - DomainClient *mock.MockDomainClient - EndpointClient *mock.MockEndpointClient - GroupClient *mock.MockGroupClient - IdentityClient *mock.MockIdentityClient - ImageClient *mock.MockImageClient - KeyPairClient *mock.MockKeyPairClient - NetworkClient *mock.MockNetworkClient - RoleClient *mock.MockRoleClient - ServiceClient *mock.MockServiceClient - UserClient *mock.MockUserClient - VolumeClient *mock.MockVolumeClient - VolumeTypeClient *mock.MockVolumeTypeClient + AddressScope *mock.MockAddressScopeClient + ComputeClient *mock.MockComputeClient + DomainClient *mock.MockDomainClient + EndpointClient *mock.MockEndpointClient + GroupClient *mock.MockGroupClient + IdentityClient *mock.MockIdentityClient + ImageClient *mock.MockImageClient + KeyPairClient *mock.MockKeyPairClient + NetworkClient *mock.MockNetworkClient + RoleClient *mock.MockRoleClient + ServiceClient *mock.MockServiceClient + UserClient *mock.MockUserClient + VolumeClient *mock.MockVolumeClient + VolumeTypeClient *mock.MockVolumeTypeClient VolumeSnapshotClient *mock.MockVolumeSnapshotClient clientScopeCreateError error @@ -71,21 +71,21 @@ func NewMockScopeFactory(mockCtrl *gomock.Controller) *MockScopeFactory { volumetypeClient := mock.NewMockVolumeTypeClient(mockCtrl) return &MockScopeFactory{ - AddressScope: addressScope, - ComputeClient: computeClient, - DomainClient: domainClient, - EndpointClient: endpointClient, - GroupClient: groupClient, - IdentityClient: identityClient, - ImageClient: imageClient, - KeyPairClient: keypairClient, - NetworkClient: networkClient, - RoleClient: roleClient, - ServiceClient: serviceClient, - UserClient: userClient, - VolumeClient: volumeClient, + AddressScope: addressScope, + ComputeClient: computeClient, + DomainClient: domainClient, + EndpointClient: endpointClient, + GroupClient: groupClient, + IdentityClient: identityClient, + ImageClient: imageClient, + KeyPairClient: keypairClient, + NetworkClient: networkClient, + RoleClient: roleClient, + ServiceClient: serviceClient, + UserClient: userClient, + VolumeClient: volumeClient, VolumeSnapshotClient: volumesnapshotClient, - VolumeTypeClient: volumetypeClient, + VolumeTypeClient: volumetypeClient, } } From 38f7add596e566702d2d2023fad237148b0f4124 Mon Sep 17 00:00:00 2001 From: Mohammed Al-Dokimi Date: Sat, 21 Feb 2026 02:45:11 +0000 Subject: [PATCH 6/9] Add tests implementatoin - STAGE 1 --- .../volumesnapshot-create-full/00-assert.yaml | 7 +++++-- .../00-create-resource.yaml | 11 +++++----- .../00-assert.yaml | 2 -- .../00-create-resource.yaml | 8 ++----- .../00-create-resources-missing-deps.yaml | 9 ++------ .../01-create-dependencies.yaml | 5 ++--- .../00-create-resources.yaml | 11 ++++------ .../01-import-resource.yaml | 2 +- .../00-import-resource.yaml | 2 -- .../volumesnapshot-import/01-assert.yaml | 1 - .../01-create-trap-resource.yaml | 7 ++----- .../volumesnapshot-import/02-assert.yaml | 1 - .../02-create-resource.yaml | 7 ++----- .../volumesnapshot-update/00-assert.yaml | 21 +++++++++---------- .../00-minimal-resource.yaml | 8 ++----- .../volumesnapshot-update/01-assert.yaml | 1 - .../01-updated-resource.yaml | 1 - .../volumesnapshot-update/02-assert.yaml | 21 +++++++++---------- 18 files changed, 48 insertions(+), 77 deletions(-) diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-create-full/00-assert.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-create-full/00-assert.yaml index 029158544..9fd08c99a 100644 --- a/internal/controllers/volumesnapshot/tests/volumesnapshot-create-full/00-assert.yaml +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-create-full/00-assert.yaml @@ -7,7 +7,9 @@ status: resource: name: volumesnapshot-create-full-override description: VolumeSnapshot from "create full" test - # TODO(scaffolding): Add all fields the resource supports + metadata: + - name: testkey + value: testvalue conditions: - type: Available status: "True" @@ -30,4 +32,5 @@ resourceRefs: assertAll: - celExpr: "volumesnapshot.status.id != ''" - celExpr: "volumesnapshot.status.resource.volumeID == volume.status.id" - # TODO(scaffolding): Add more checks + - celExpr: "has(volumesnapshot.status.resource.status)" + - celExpr: "has(volumesnapshot.status.resource.size)" diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-create-full/00-create-resource.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-create-full/00-create-resource.yaml index f972ed453..eff20a083 100644 --- a/internal/controllers/volumesnapshot/tests/volumesnapshot-create-full/00-create-resource.yaml +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-create-full/00-create-resource.yaml @@ -5,12 +5,11 @@ metadata: name: volumesnapshot-create-full spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created cloudName: openstack secretName: openstack-clouds managementPolicy: managed - # TODO(scaffolding): Add the necessary fields to create the resource - resource: {} + resource: + size: 1 --- apiVersion: openstack.k-orc.cloud/v1alpha1 kind: VolumeSnapshot @@ -18,7 +17,6 @@ metadata: name: volumesnapshot-create-full spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created cloudName: openstack secretName: openstack-clouds managementPolicy: managed @@ -26,4 +24,7 @@ spec: name: volumesnapshot-create-full-override description: VolumeSnapshot from "create full" test volumeRef: volumesnapshot-create-full - # TODO(scaffolding): Add all fields the resource supports + force: true + metadata: + - name: testkey + value: testvalue diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-create-minimal/00-assert.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-create-minimal/00-assert.yaml index 98a5eeab3..6c1db12b8 100644 --- a/internal/controllers/volumesnapshot/tests/volumesnapshot-create-minimal/00-assert.yaml +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-create-minimal/00-assert.yaml @@ -6,7 +6,6 @@ metadata: status: resource: name: volumesnapshot-create-minimal - # TODO(scaffolding): Add all fields the resource supports conditions: - type: Available status: "True" @@ -29,4 +28,3 @@ resourceRefs: assertAll: - celExpr: "volumesnapshot.status.id != ''" - celExpr: "volumesnapshot.status.resource.volumeID == volume.status.id" - # TODO(scaffolding): Add more checks diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-create-minimal/00-create-resource.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-create-minimal/00-create-resource.yaml index 197d1b747..8fba284a1 100644 --- a/internal/controllers/volumesnapshot/tests/volumesnapshot-create-minimal/00-create-resource.yaml +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-create-minimal/00-create-resource.yaml @@ -5,12 +5,11 @@ metadata: name: volumesnapshot-create-minimal spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created cloudName: openstack secretName: openstack-clouds managementPolicy: managed - # TODO(scaffolding): Add the necessary fields to create the resource - resource: {} + resource: + size: 1 --- apiVersion: openstack.k-orc.cloud/v1alpha1 kind: VolumeSnapshot @@ -18,11 +17,8 @@ metadata: name: volumesnapshot-create-minimal spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created cloudName: openstack secretName: openstack-clouds managementPolicy: managed - # TODO(scaffolding): Only add the mandatory fields. It's possible the resource - # doesn't have mandatory fields, in that case, leave it empty. resource: volumeRef: volumesnapshot-create-minimal diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/00-create-resources-missing-deps.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/00-create-resources-missing-deps.yaml index da663bb24..605d51e84 100644 --- a/internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/00-create-resources-missing-deps.yaml +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/00-create-resources-missing-deps.yaml @@ -5,12 +5,11 @@ metadata: name: volumesnapshot-dependency spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created cloudName: openstack secretName: openstack-clouds managementPolicy: managed - # TODO(scaffolding): Add the necessary fields to create the resource - resource: {} + resource: + size: 1 --- apiVersion: openstack.k-orc.cloud/v1alpha1 kind: VolumeSnapshot @@ -18,13 +17,11 @@ metadata: name: volumesnapshot-dependency-no-volume spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created cloudName: openstack secretName: openstack-clouds managementPolicy: managed resource: volumeRef: volumesnapshot-dependency-pending - # TODO(scaffolding): Add the necessary fields to create the resource --- apiVersion: openstack.k-orc.cloud/v1alpha1 @@ -33,10 +30,8 @@ metadata: name: volumesnapshot-dependency-no-secret spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created cloudName: openstack secretName: volumesnapshot-dependency managementPolicy: managed - # TODO(scaffolding): Add the necessary fields to create the resource resource: volumeRef: volumesnapshot-dependency diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/01-create-dependencies.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/01-create-dependencies.yaml index 25bec4688..2d6656b07 100644 --- a/internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/01-create-dependencies.yaml +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-dependency/01-create-dependencies.yaml @@ -11,9 +11,8 @@ metadata: name: volumesnapshot-dependency-pending spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created cloudName: openstack secretName: openstack-clouds managementPolicy: managed - # TODO(scaffolding): Add the necessary fields to create the resource - resource: {} + resource: + size: 1 diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/00-create-resources.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/00-create-resources.yaml index b86b9e139..e624cc438 100644 --- a/internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/00-create-resources.yaml +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/00-create-resources.yaml @@ -5,12 +5,11 @@ metadata: name: volumesnapshot-import-error spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created cloudName: openstack secretName: openstack-clouds managementPolicy: managed - # TODO(scaffolding): Add the necessary fields to create the resource - resource: {} + resource: + size: 1 --- apiVersion: openstack.k-orc.cloud/v1alpha1 kind: VolumeSnapshot @@ -18,14 +17,13 @@ metadata: name: volumesnapshot-import-error-external-1 spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created cloudName: openstack secretName: openstack-clouds managementPolicy: managed resource: + name: volumesnapshot-import-error-external description: VolumeSnapshot from "import error" test volumeRef: volumesnapshot-import-error - # TODO(scaffolding): add any required field --- apiVersion: openstack.k-orc.cloud/v1alpha1 kind: VolumeSnapshot @@ -33,11 +31,10 @@ metadata: name: volumesnapshot-import-error-external-2 spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created cloudName: openstack secretName: openstack-clouds managementPolicy: managed resource: + name: volumesnapshot-import-error-external description: VolumeSnapshot from "import error" test volumeRef: volumesnapshot-import-error - # TODO(scaffolding): add any required field diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/01-import-resource.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/01-import-resource.yaml index 9cade4b31..bb29378ba 100644 --- a/internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/01-import-resource.yaml +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/01-import-resource.yaml @@ -10,4 +10,4 @@ spec: managementPolicy: unmanaged import: filter: - description: VolumeSnapshot from "import error" test + name: volumesnapshot-import-error-external diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-import/00-import-resource.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-import/00-import-resource.yaml index bd75f6ec7..cc29be4ae 100644 --- a/internal/controllers/volumesnapshot/tests/volumesnapshot-import/00-import-resource.yaml +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-import/00-import-resource.yaml @@ -11,5 +11,3 @@ spec: import: filter: name: volumesnapshot-import-external - description: VolumeSnapshot volumesnapshot-import-external from "volumesnapshot-import" test - # TODO(scaffolding): Add all fields supported by the filter diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-import/01-assert.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-import/01-assert.yaml index 07d59f1b1..94621f9d3 100644 --- a/internal/controllers/volumesnapshot/tests/volumesnapshot-import/01-assert.yaml +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-import/01-assert.yaml @@ -16,7 +16,6 @@ status: resource: name: volumesnapshot-import-external-not-this-one description: VolumeSnapshot volumesnapshot-import-external from "volumesnapshot-import" test - # TODO(scaffolding): Add fields necessary to match filter --- apiVersion: openstack.k-orc.cloud/v1alpha1 kind: VolumeSnapshot diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-import/01-create-trap-resource.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-import/01-create-trap-resource.yaml index be403c937..182545f65 100644 --- a/internal/controllers/volumesnapshot/tests/volumesnapshot-import/01-create-trap-resource.yaml +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-import/01-create-trap-resource.yaml @@ -5,12 +5,11 @@ metadata: name: volumesnapshot-import-external-not-this-one spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created cloudName: openstack secretName: openstack-clouds managementPolicy: managed - # TODO(scaffolding): Add the necessary fields to create the resource - resource: {} + resource: + size: 1 --- # This `volumesnapshot-import-external-not-this-one` resource serves two purposes: # - ensure that we can successfully create another resource which name is a substring of it (i.e. it's not being adopted) @@ -21,11 +20,9 @@ metadata: name: volumesnapshot-import-external-not-this-one spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created cloudName: openstack secretName: openstack-clouds managementPolicy: managed resource: description: VolumeSnapshot volumesnapshot-import-external from "volumesnapshot-import" test volumeRef: volumesnapshot-import-external-not-this-one - # TODO(scaffolding): Add fields necessary to match filter diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-import/02-assert.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-import/02-assert.yaml index 889d3389c..c076fa4fc 100644 --- a/internal/controllers/volumesnapshot/tests/volumesnapshot-import/02-assert.yaml +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-import/02-assert.yaml @@ -30,4 +30,3 @@ status: resource: name: volumesnapshot-import-external description: VolumeSnapshot volumesnapshot-import-external from "volumesnapshot-import" test - # TODO(scaffolding): Add all fields the resource supports diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-import/02-create-resource.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-import/02-create-resource.yaml index 884f6ad9e..4da7e7a3a 100644 --- a/internal/controllers/volumesnapshot/tests/volumesnapshot-import/02-create-resource.yaml +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-import/02-create-resource.yaml @@ -5,12 +5,11 @@ metadata: name: volumesnapshot-import spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created cloudName: openstack secretName: openstack-clouds managementPolicy: managed - # TODO(scaffolding): Add the necessary fields to create the resource - resource: {} + resource: + size: 1 --- apiVersion: openstack.k-orc.cloud/v1alpha1 kind: VolumeSnapshot @@ -18,11 +17,9 @@ metadata: name: volumesnapshot-import-external spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created cloudName: openstack secretName: openstack-clouds managementPolicy: managed resource: description: VolumeSnapshot volumesnapshot-import-external from "volumesnapshot-import" test volumeRef: volumesnapshot-import - # TODO(scaffolding): Add fields necessary to match filter diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-update/00-assert.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-update/00-assert.yaml index 3cd814f61..72f4c7437 100644 --- a/internal/controllers/volumesnapshot/tests/volumesnapshot-update/00-assert.yaml +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-update/00-assert.yaml @@ -1,14 +1,4 @@ --- -apiVersion: kuttl.dev/v1beta1 -kind: TestAssert -resourceRefs: - - apiVersion: openstack.k-orc.cloud/v1alpha1 - kind: VolumeSnapshot - name: volumesnapshot-update - ref: volumesnapshot -assertAll: - - celExpr: "!has(volumesnapshot.status.resource.description)" ---- apiVersion: openstack.k-orc.cloud/v1alpha1 kind: VolumeSnapshot metadata: @@ -16,7 +6,6 @@ metadata: status: resource: name: volumesnapshot-update - # TODO(scaffolding): Add matches for more fields conditions: - type: Available status: "True" @@ -24,3 +13,13 @@ status: - type: Progressing status: "False" reason: Success +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +resourceRefs: + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: VolumeSnapshot + name: volumesnapshot-update + ref: volumesnapshot +assertAll: + - celExpr: "!has(volumesnapshot.status.resource.description)" diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-update/00-minimal-resource.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-update/00-minimal-resource.yaml index 35b469a16..35fc1c51c 100644 --- a/internal/controllers/volumesnapshot/tests/volumesnapshot-update/00-minimal-resource.yaml +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-update/00-minimal-resource.yaml @@ -5,12 +5,11 @@ metadata: name: volumesnapshot-update spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created cloudName: openstack secretName: openstack-clouds managementPolicy: managed - # TODO(scaffolding): Add the necessary fields to create the resource - resource: {} + resource: + size: 1 --- apiVersion: openstack.k-orc.cloud/v1alpha1 kind: VolumeSnapshot @@ -18,11 +17,8 @@ metadata: name: volumesnapshot-update spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created or updated cloudName: openstack secretName: openstack-clouds managementPolicy: managed - # TODO(scaffolding): Only add the mandatory fields. It's possible the resource - # doesn't have mandatory fields, in that case, leave it empty. resource: volumeRef: volumesnapshot-update diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-update/01-assert.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-update/01-assert.yaml index 65cf8fa0b..3d9ecb505 100644 --- a/internal/controllers/volumesnapshot/tests/volumesnapshot-update/01-assert.yaml +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-update/01-assert.yaml @@ -7,7 +7,6 @@ status: resource: name: volumesnapshot-update-updated description: volumesnapshot-update-updated - # TODO(scaffolding): match all fields that were modified conditions: - type: Available status: "True" diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-update/01-updated-resource.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-update/01-updated-resource.yaml index 3f5609470..9473d5dbb 100644 --- a/internal/controllers/volumesnapshot/tests/volumesnapshot-update/01-updated-resource.yaml +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-update/01-updated-resource.yaml @@ -7,4 +7,3 @@ spec: resource: name: volumesnapshot-update-updated description: volumesnapshot-update-updated - # TODO(scaffolding): update all mutable fields diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-update/02-assert.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-update/02-assert.yaml index 3258067e9..72f4c7437 100644 --- a/internal/controllers/volumesnapshot/tests/volumesnapshot-update/02-assert.yaml +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-update/02-assert.yaml @@ -1,14 +1,4 @@ --- -apiVersion: kuttl.dev/v1beta1 -kind: TestAssert -resourceRefs: - - apiVersion: openstack.k-orc.cloud/v1alpha1 - kind: VolumeSnapshot - name: volumesnapshot-update - ref: volumesnapshot -assertAll: - - celExpr: "!has(volumesnapshot.status.resource.description)" ---- apiVersion: openstack.k-orc.cloud/v1alpha1 kind: VolumeSnapshot metadata: @@ -16,7 +6,6 @@ metadata: status: resource: name: volumesnapshot-update - # TODO(scaffolding): validate that updated fields were all reverted to their original value conditions: - type: Available status: "True" @@ -24,3 +13,13 @@ status: - type: Progressing status: "False" reason: Success +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +resourceRefs: + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: VolumeSnapshot + name: volumesnapshot-update + ref: volumesnapshot +assertAll: + - celExpr: "!has(volumesnapshot.status.resource.description)" From 6a0f3e22e2031e69af021b9ba661d2605287e479 Mon Sep 17 00:00:00 2001 From: Mohammed Al-Dokimi Date: Sat, 21 Feb 2026 02:48:47 +0000 Subject: [PATCH 7/9] Run make generate --- PROJECT | 8 + api/v1alpha1/zz_generated.deepcopy.go | 280 ++++++++++ .../zz_generated.volumesnapshot-resource.go | 179 ++++++ cmd/models-schema/zz_generated.openapi.go | 508 ++++++++++++++++++ ...openstack.k-orc.cloud_volumesnapshots.yaml | 399 ++++++++++++++ config/crd/kustomization.yaml | 1 + config/rbac/role.yaml | 2 + config/samples/kustomization.yaml | 1 + .../volumesnapshot/zz_generated.adapter.go | 88 +++ .../volumesnapshot/zz_generated.controller.go | 45 ++ internal/osclients/mock/volumesnapshot.go | 131 +++++ kuttl-test.yaml | 1 + .../api/v1alpha1/volumesnapshot.go | 281 ++++++++++ .../api/v1alpha1/volumesnapshotfilter.go | 61 +++ .../api/v1alpha1/volumesnapshotimport.go | 48 ++ .../api/v1alpha1/volumesnapshotmetadata.go | 48 ++ .../v1alpha1/volumesnapshotmetadatastatus.go | 48 ++ .../v1alpha1/volumesnapshotresourcespec.go | 84 +++ .../v1alpha1/volumesnapshotresourcestatus.go | 156 ++++++ .../api/v1alpha1/volumesnapshotspec.go | 79 +++ .../api/v1alpha1/volumesnapshotstatus.go | 66 +++ .../applyconfiguration/internal/internal.go | 164 ++++++ pkg/clients/applyconfiguration/utils.go | 18 + .../typed/api/v1alpha1/api_client.go | 5 + .../api/v1alpha1/fake/fake_api_client.go | 4 + .../api/v1alpha1/fake/fake_volumesnapshot.go | 53 ++ .../typed/api/v1alpha1/generated_expansion.go | 2 + .../typed/api/v1alpha1/volumesnapshot.go | 74 +++ .../api/v1alpha1/interface.go | 7 + .../api/v1alpha1/volumesnapshot.go | 102 ++++ .../informers/externalversions/generic.go | 2 + .../api/v1alpha1/expansion_generated.go | 8 + .../listers/api/v1alpha1/volumesnapshot.go | 70 +++ website/docs/crd-reference.md | 185 +++++++ 34 files changed, 3208 insertions(+) create mode 100644 api/v1alpha1/zz_generated.volumesnapshot-resource.go create mode 100644 config/crd/bases/openstack.k-orc.cloud_volumesnapshots.yaml create mode 100644 internal/controllers/volumesnapshot/zz_generated.adapter.go create mode 100644 internal/controllers/volumesnapshot/zz_generated.controller.go create mode 100644 internal/osclients/mock/volumesnapshot.go create mode 100644 pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshot.go create mode 100644 pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshotfilter.go create mode 100644 pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshotimport.go create mode 100644 pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshotmetadata.go create mode 100644 pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshotmetadatastatus.go create mode 100644 pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshotresourcespec.go create mode 100644 pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshotresourcestatus.go create mode 100644 pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshotspec.go create mode 100644 pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshotstatus.go create mode 100644 pkg/clients/clientset/clientset/typed/api/v1alpha1/fake/fake_volumesnapshot.go create mode 100644 pkg/clients/clientset/clientset/typed/api/v1alpha1/volumesnapshot.go create mode 100644 pkg/clients/informers/externalversions/api/v1alpha1/volumesnapshot.go create mode 100644 pkg/clients/listers/api/v1alpha1/volumesnapshot.go diff --git a/PROJECT b/PROJECT index b3181e74c..3c4f6aa9e 100644 --- a/PROJECT +++ b/PROJECT @@ -184,6 +184,14 @@ resources: kind: Volume path: github.com/k-orc/openstack-resource-controller/api/v1alpha1 version: v1alpha1 +- api: + crdVersion: v1 + namespaced: true + domain: k-orc.cloud + group: openstack + kind: VolumeSnapshot + path: github.com/k-orc/openstack-resource-controller/api/v1alpha1 + version: v1alpha1 - api: crdVersion: v1 namespaced: true diff --git a/api/v1alpha1/zz_generated.deepcopy.go b/api/v1alpha1/zz_generated.deepcopy.go index 696af6ca1..0c0a14311 100644 --- a/api/v1alpha1/zz_generated.deepcopy.go +++ b/api/v1alpha1/zz_generated.deepcopy.go @@ -6287,6 +6287,286 @@ func (in *VolumeResourceStatus) DeepCopy() *VolumeResourceStatus { return out } +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *VolumeSnapshot) DeepCopyInto(out *VolumeSnapshot) { + *out = *in + out.TypeMeta = in.TypeMeta + in.ObjectMeta.DeepCopyInto(&out.ObjectMeta) + in.Spec.DeepCopyInto(&out.Spec) + in.Status.DeepCopyInto(&out.Status) +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new VolumeSnapshot. +func (in *VolumeSnapshot) DeepCopy() *VolumeSnapshot { + if in == nil { + return nil + } + out := new(VolumeSnapshot) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *VolumeSnapshot) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *VolumeSnapshotFilter) DeepCopyInto(out *VolumeSnapshotFilter) { + *out = *in + if in.Name != nil { + in, out := &in.Name, &out.Name + *out = new(OpenStackName) + **out = **in + } + if in.Status != nil { + in, out := &in.Status, &out.Status + *out = new(string) + **out = **in + } + if in.VolumeID != nil { + in, out := &in.VolumeID, &out.VolumeID + *out = new(string) + **out = **in + } +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new VolumeSnapshotFilter. +func (in *VolumeSnapshotFilter) DeepCopy() *VolumeSnapshotFilter { + if in == nil { + return nil + } + out := new(VolumeSnapshotFilter) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *VolumeSnapshotImport) DeepCopyInto(out *VolumeSnapshotImport) { + *out = *in + if in.ID != nil { + in, out := &in.ID, &out.ID + *out = new(string) + **out = **in + } + if in.Filter != nil { + in, out := &in.Filter, &out.Filter + *out = new(VolumeSnapshotFilter) + (*in).DeepCopyInto(*out) + } +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new VolumeSnapshotImport. +func (in *VolumeSnapshotImport) DeepCopy() *VolumeSnapshotImport { + if in == nil { + return nil + } + out := new(VolumeSnapshotImport) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *VolumeSnapshotList) DeepCopyInto(out *VolumeSnapshotList) { + *out = *in + out.TypeMeta = in.TypeMeta + in.ListMeta.DeepCopyInto(&out.ListMeta) + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]VolumeSnapshot, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new VolumeSnapshotList. +func (in *VolumeSnapshotList) DeepCopy() *VolumeSnapshotList { + if in == nil { + return nil + } + out := new(VolumeSnapshotList) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *VolumeSnapshotList) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *VolumeSnapshotMetadata) DeepCopyInto(out *VolumeSnapshotMetadata) { + *out = *in +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new VolumeSnapshotMetadata. +func (in *VolumeSnapshotMetadata) DeepCopy() *VolumeSnapshotMetadata { + if in == nil { + return nil + } + out := new(VolumeSnapshotMetadata) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *VolumeSnapshotMetadataStatus) DeepCopyInto(out *VolumeSnapshotMetadataStatus) { + *out = *in +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new VolumeSnapshotMetadataStatus. +func (in *VolumeSnapshotMetadataStatus) DeepCopy() *VolumeSnapshotMetadataStatus { + if in == nil { + return nil + } + out := new(VolumeSnapshotMetadataStatus) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *VolumeSnapshotResourceSpec) DeepCopyInto(out *VolumeSnapshotResourceSpec) { + *out = *in + if in.Name != nil { + in, out := &in.Name, &out.Name + *out = new(OpenStackName) + **out = **in + } + if in.Description != nil { + in, out := &in.Description, &out.Description + *out = new(string) + **out = **in + } + if in.Force != nil { + in, out := &in.Force, &out.Force + *out = new(bool) + **out = **in + } + if in.Metadata != nil { + in, out := &in.Metadata, &out.Metadata + *out = make([]VolumeSnapshotMetadata, len(*in)) + copy(*out, *in) + } +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new VolumeSnapshotResourceSpec. +func (in *VolumeSnapshotResourceSpec) DeepCopy() *VolumeSnapshotResourceSpec { + if in == nil { + return nil + } + out := new(VolumeSnapshotResourceSpec) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *VolumeSnapshotResourceStatus) DeepCopyInto(out *VolumeSnapshotResourceStatus) { + *out = *in + if in.Size != nil { + in, out := &in.Size, &out.Size + *out = new(int32) + **out = **in + } + if in.Metadata != nil { + in, out := &in.Metadata, &out.Metadata + *out = make([]VolumeSnapshotMetadataStatus, len(*in)) + copy(*out, *in) + } + if in.ConsumesQuota != nil { + in, out := &in.ConsumesQuota, &out.ConsumesQuota + *out = new(bool) + **out = **in + } + if in.CreatedAt != nil { + in, out := &in.CreatedAt, &out.CreatedAt + *out = (*in).DeepCopy() + } + if in.UpdatedAt != nil { + in, out := &in.UpdatedAt, &out.UpdatedAt + *out = (*in).DeepCopy() + } +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new VolumeSnapshotResourceStatus. +func (in *VolumeSnapshotResourceStatus) DeepCopy() *VolumeSnapshotResourceStatus { + if in == nil { + return nil + } + out := new(VolumeSnapshotResourceStatus) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *VolumeSnapshotSpec) DeepCopyInto(out *VolumeSnapshotSpec) { + *out = *in + if in.Import != nil { + in, out := &in.Import, &out.Import + *out = new(VolumeSnapshotImport) + (*in).DeepCopyInto(*out) + } + if in.Resource != nil { + in, out := &in.Resource, &out.Resource + *out = new(VolumeSnapshotResourceSpec) + (*in).DeepCopyInto(*out) + } + if in.ManagedOptions != nil { + in, out := &in.ManagedOptions, &out.ManagedOptions + *out = new(ManagedOptions) + **out = **in + } + out.CloudCredentialsRef = in.CloudCredentialsRef +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new VolumeSnapshotSpec. +func (in *VolumeSnapshotSpec) DeepCopy() *VolumeSnapshotSpec { + if in == nil { + return nil + } + out := new(VolumeSnapshotSpec) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *VolumeSnapshotStatus) DeepCopyInto(out *VolumeSnapshotStatus) { + *out = *in + if in.Conditions != nil { + in, out := &in.Conditions, &out.Conditions + *out = make([]v1.Condition, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + if in.ID != nil { + in, out := &in.ID, &out.ID + *out = new(string) + **out = **in + } + if in.Resource != nil { + in, out := &in.Resource, &out.Resource + *out = new(VolumeSnapshotResourceStatus) + (*in).DeepCopyInto(*out) + } +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new VolumeSnapshotStatus. +func (in *VolumeSnapshotStatus) DeepCopy() *VolumeSnapshotStatus { + if in == nil { + return nil + } + out := new(VolumeSnapshotStatus) + in.DeepCopyInto(out) + return out +} + // DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. func (in *VolumeSpec) DeepCopyInto(out *VolumeSpec) { *out = *in diff --git a/api/v1alpha1/zz_generated.volumesnapshot-resource.go b/api/v1alpha1/zz_generated.volumesnapshot-resource.go new file mode 100644 index 000000000..4a4c4bbb3 --- /dev/null +++ b/api/v1alpha1/zz_generated.volumesnapshot-resource.go @@ -0,0 +1,179 @@ +// Code generated by resource-generator. DO NOT EDIT. +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package v1alpha1 + +import ( + metav1 "k8s.io/apimachinery/pkg/apis/meta/v1" +) + +// VolumeSnapshotImport specifies an existing resource which will be imported instead of +// creating a new one +// +kubebuilder:validation:MinProperties:=1 +// +kubebuilder:validation:MaxProperties:=1 +type VolumeSnapshotImport struct { + // id contains the unique identifier of an existing OpenStack resource. Note + // that when specifying an import by ID, the resource MUST already exist. + // The ORC object will enter an error state if the resource does not exist. + // +kubebuilder:validation:Format:=uuid + // +kubebuilder:validation:MaxLength:=36 + // +optional + ID *string `json:"id,omitempty"` //nolint:kubeapilinter + + // filter contains a resource query which is expected to return a single + // result. The controller will continue to retry if filter returns no + // results. If filter returns multiple results the controller will set an + // error state and will not continue to retry. + // +optional + Filter *VolumeSnapshotFilter `json:"filter,omitempty"` +} + +// VolumeSnapshotSpec defines the desired state of an ORC object. +// +kubebuilder:validation:XValidation:rule="self.managementPolicy == 'managed' ? has(self.resource) : true",message="resource must be specified when policy is managed" +// +kubebuilder:validation:XValidation:rule="self.managementPolicy == 'managed' ? !has(self.__import__) : true",message="import may not be specified when policy is managed" +// +kubebuilder:validation:XValidation:rule="self.managementPolicy == 'unmanaged' ? !has(self.resource) : true",message="resource may not be specified when policy is unmanaged" +// +kubebuilder:validation:XValidation:rule="self.managementPolicy == 'unmanaged' ? has(self.__import__) : true",message="import must be specified when policy is unmanaged" +// +kubebuilder:validation:XValidation:rule="has(self.managedOptions) ? self.managementPolicy == 'managed' : true",message="managedOptions may only be provided when policy is managed" +type VolumeSnapshotSpec struct { + // import refers to an existing OpenStack resource which will be imported instead of + // creating a new one. + // +optional + Import *VolumeSnapshotImport `json:"import,omitempty"` + + // resource specifies the desired state of the resource. + // + // resource may not be specified if the management policy is `unmanaged`. + // + // resource must be specified if the management policy is `managed`. + // +optional + Resource *VolumeSnapshotResourceSpec `json:"resource,omitempty"` + + // managementPolicy defines how ORC will treat the object. Valid values are + // `managed`: ORC will create, update, and delete the resource; `unmanaged`: + // ORC will import an existing resource, and will not apply updates to it or + // delete it. + // +kubebuilder:validation:XValidation:rule="self == oldSelf",message="managementPolicy is immutable" + // +kubebuilder:default:=managed + // +optional + ManagementPolicy ManagementPolicy `json:"managementPolicy,omitempty"` + + // managedOptions specifies options which may be applied to managed objects. + // +optional + ManagedOptions *ManagedOptions `json:"managedOptions,omitempty"` + + // cloudCredentialsRef points to a secret containing OpenStack credentials + // +required + CloudCredentialsRef CloudCredentialsReference `json:"cloudCredentialsRef,omitzero"` +} + +// VolumeSnapshotStatus defines the observed state of an ORC resource. +type VolumeSnapshotStatus struct { + // conditions represents the observed status of the object. + // Known .status.conditions.type are: "Available", "Progressing" + // + // Available represents the availability of the OpenStack resource. If it is + // true then the resource is ready for use. + // + // Progressing indicates whether the controller is still attempting to + // reconcile the current state of the OpenStack resource to the desired + // state. Progressing will be False either because the desired state has + // been achieved, or because some terminal error prevents it from ever being + // achieved and the controller is no longer attempting to reconcile. If + // Progressing is True, an observer waiting on the resource should continue + // to wait. + // + // +kubebuilder:validation:MaxItems:=32 + // +patchMergeKey=type + // +patchStrategy=merge + // +listType=map + // +listMapKey=type + // +optional + Conditions []metav1.Condition `json:"conditions,omitempty" patchStrategy:"merge" patchMergeKey:"type"` + + // id is the unique identifier of the OpenStack resource. + // +kubebuilder:validation:MaxLength:=1024 + // +optional + ID *string `json:"id,omitempty"` + + // resource contains the observed state of the OpenStack resource. + // +optional + Resource *VolumeSnapshotResourceStatus `json:"resource,omitempty"` +} + +var _ ObjectWithConditions = &VolumeSnapshot{} + +func (i *VolumeSnapshot) GetConditions() []metav1.Condition { + return i.Status.Conditions +} + +// +genclient +// +kubebuilder:object:root=true +// +kubebuilder:resource:categories=openstack +// +kubebuilder:subresource:status +// +kubebuilder:printcolumn:name="ID",type="string",JSONPath=".status.id",description="Resource ID" +// +kubebuilder:printcolumn:name="Available",type="string",JSONPath=".status.conditions[?(@.type=='Available')].status",description="Availability status of resource" +// +kubebuilder:printcolumn:name="Message",type="string",JSONPath=".status.conditions[?(@.type=='Progressing')].message",description="Message describing current progress status" + +// VolumeSnapshot is the Schema for an ORC resource. +type VolumeSnapshot struct { + metav1.TypeMeta `json:",inline"` + + // metadata contains the object metadata + // +optional + metav1.ObjectMeta `json:"metadata,omitempty"` + + // spec specifies the desired state of the resource. + // +required + Spec VolumeSnapshotSpec `json:"spec,omitzero"` + + // status defines the observed state of the resource. + // +optional + Status VolumeSnapshotStatus `json:"status,omitempty"` +} + +// +kubebuilder:object:root=true + +// VolumeSnapshotList contains a list of VolumeSnapshot. +type VolumeSnapshotList struct { + metav1.TypeMeta `json:",inline"` + + // metadata contains the list metadata + // +optional + metav1.ListMeta `json:"metadata,omitempty"` + + // items contains a list of VolumeSnapshot. + // +required + Items []VolumeSnapshot `json:"items"` +} + +func (l *VolumeSnapshotList) GetItems() []VolumeSnapshot { + return l.Items +} + +func init() { + SchemeBuilder.Register(&VolumeSnapshot{}, &VolumeSnapshotList{}) +} + +func (i *VolumeSnapshot) GetCloudCredentialsRef() (*string, *CloudCredentialsReference) { + if i == nil { + return nil, nil + } + + return &i.Namespace, &i.Spec.CloudCredentialsRef +} + +var _ CloudCredentialsRefProvider = &VolumeSnapshot{} diff --git a/cmd/models-schema/zz_generated.openapi.go b/cmd/models-schema/zz_generated.openapi.go index 3642ebe37..78533fc7d 100644 --- a/cmd/models-schema/zz_generated.openapi.go +++ b/cmd/models-schema/zz_generated.openapi.go @@ -246,6 +246,16 @@ func GetOpenAPIDefinitions(ref common.ReferenceCallback) map[string]common.OpenA "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.VolumeMetadataStatus": schema_openstack_resource_controller_v2_api_v1alpha1_VolumeMetadataStatus(ref), "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.VolumeResourceSpec": schema_openstack_resource_controller_v2_api_v1alpha1_VolumeResourceSpec(ref), "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.VolumeResourceStatus": schema_openstack_resource_controller_v2_api_v1alpha1_VolumeResourceStatus(ref), + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.VolumeSnapshot": schema_openstack_resource_controller_v2_api_v1alpha1_VolumeSnapshot(ref), + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.VolumeSnapshotFilter": schema_openstack_resource_controller_v2_api_v1alpha1_VolumeSnapshotFilter(ref), + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.VolumeSnapshotImport": schema_openstack_resource_controller_v2_api_v1alpha1_VolumeSnapshotImport(ref), + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.VolumeSnapshotList": schema_openstack_resource_controller_v2_api_v1alpha1_VolumeSnapshotList(ref), + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.VolumeSnapshotMetadata": schema_openstack_resource_controller_v2_api_v1alpha1_VolumeSnapshotMetadata(ref), + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.VolumeSnapshotMetadataStatus": schema_openstack_resource_controller_v2_api_v1alpha1_VolumeSnapshotMetadataStatus(ref), + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.VolumeSnapshotResourceSpec": schema_openstack_resource_controller_v2_api_v1alpha1_VolumeSnapshotResourceSpec(ref), + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.VolumeSnapshotResourceStatus": schema_openstack_resource_controller_v2_api_v1alpha1_VolumeSnapshotResourceStatus(ref), + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.VolumeSnapshotSpec": schema_openstack_resource_controller_v2_api_v1alpha1_VolumeSnapshotSpec(ref), + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.VolumeSnapshotStatus": schema_openstack_resource_controller_v2_api_v1alpha1_VolumeSnapshotStatus(ref), "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.VolumeSpec": schema_openstack_resource_controller_v2_api_v1alpha1_VolumeSpec(ref), "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.VolumeStatus": schema_openstack_resource_controller_v2_api_v1alpha1_VolumeStatus(ref), "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.VolumeType": schema_openstack_resource_controller_v2_api_v1alpha1_VolumeType(ref), @@ -12127,6 +12137,504 @@ func schema_openstack_resource_controller_v2_api_v1alpha1_VolumeResourceStatus(r } } +func schema_openstack_resource_controller_v2_api_v1alpha1_VolumeSnapshot(ref common.ReferenceCallback) common.OpenAPIDefinition { + return common.OpenAPIDefinition{ + Schema: spec.Schema{ + SchemaProps: spec.SchemaProps{ + Description: "VolumeSnapshot is the Schema for an ORC resource.", + Type: []string{"object"}, + Properties: map[string]spec.Schema{ + "kind": { + SchemaProps: spec.SchemaProps{ + Description: "Kind is a string value representing the REST resource this object represents. Servers may infer this from the endpoint the client submits requests to. Cannot be updated. In CamelCase. More info: https://git.k8s.io/community/contributors/devel/sig-architecture/api-conventions.md#types-kinds", + Type: []string{"string"}, + Format: "", + }, + }, + "apiVersion": { + SchemaProps: spec.SchemaProps{ + Description: "APIVersion defines the versioned schema of this representation of an object. Servers should convert recognized schemas to the latest internal value, and may reject unrecognized values. More info: https://git.k8s.io/community/contributors/devel/sig-architecture/api-conventions.md#resources", + Type: []string{"string"}, + Format: "", + }, + }, + "metadata": { + SchemaProps: spec.SchemaProps{ + Description: "metadata contains the object metadata", + Default: map[string]interface{}{}, + Ref: ref("k8s.io/apimachinery/pkg/apis/meta/v1.ObjectMeta"), + }, + }, + "spec": { + SchemaProps: spec.SchemaProps{ + Description: "spec specifies the desired state of the resource.", + Default: map[string]interface{}{}, + Ref: ref("github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.VolumeSnapshotSpec"), + }, + }, + "status": { + SchemaProps: spec.SchemaProps{ + Description: "status defines the observed state of the resource.", + Default: map[string]interface{}{}, + Ref: ref("github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.VolumeSnapshotStatus"), + }, + }, + }, + Required: []string{"spec"}, + }, + }, + Dependencies: []string{ + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.VolumeSnapshotSpec", "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.VolumeSnapshotStatus", "k8s.io/apimachinery/pkg/apis/meta/v1.ObjectMeta"}, + } +} + +func schema_openstack_resource_controller_v2_api_v1alpha1_VolumeSnapshotFilter(ref common.ReferenceCallback) common.OpenAPIDefinition { + return common.OpenAPIDefinition{ + Schema: spec.Schema{ + SchemaProps: spec.SchemaProps{ + Description: "VolumeSnapshotFilter defines an existing resource by its properties", + Type: []string{"object"}, + Properties: map[string]spec.Schema{ + "name": { + SchemaProps: spec.SchemaProps{ + Description: "name of the existing resource", + Type: []string{"string"}, + Format: "", + }, + }, + "status": { + SchemaProps: spec.SchemaProps{ + Description: "status of the existing resource", + Type: []string{"string"}, + Format: "", + }, + }, + "volumeID": { + SchemaProps: spec.SchemaProps{ + Description: "volumeID is the ID of the volume the snapshot was created from", + Type: []string{"string"}, + Format: "", + }, + }, + }, + }, + }, + } +} + +func schema_openstack_resource_controller_v2_api_v1alpha1_VolumeSnapshotImport(ref common.ReferenceCallback) common.OpenAPIDefinition { + return common.OpenAPIDefinition{ + Schema: spec.Schema{ + SchemaProps: spec.SchemaProps{ + Description: "VolumeSnapshotImport specifies an existing resource which will be imported instead of creating a new one", + Type: []string{"object"}, + Properties: map[string]spec.Schema{ + "id": { + SchemaProps: spec.SchemaProps{ + Description: "id contains the unique identifier of an existing OpenStack resource. Note that when specifying an import by ID, the resource MUST already exist. The ORC object will enter an error state if the resource does not exist.", + Type: []string{"string"}, + Format: "", + }, + }, + "filter": { + SchemaProps: spec.SchemaProps{ + Description: "filter contains a resource query which is expected to return a single result. The controller will continue to retry if filter returns no results. If filter returns multiple results the controller will set an error state and will not continue to retry.", + Ref: ref("github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.VolumeSnapshotFilter"), + }, + }, + }, + }, + }, + Dependencies: []string{ + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.VolumeSnapshotFilter"}, + } +} + +func schema_openstack_resource_controller_v2_api_v1alpha1_VolumeSnapshotList(ref common.ReferenceCallback) common.OpenAPIDefinition { + return common.OpenAPIDefinition{ + Schema: spec.Schema{ + SchemaProps: spec.SchemaProps{ + Description: "VolumeSnapshotList contains a list of VolumeSnapshot.", + Type: []string{"object"}, + Properties: map[string]spec.Schema{ + "kind": { + SchemaProps: spec.SchemaProps{ + Description: "Kind is a string value representing the REST resource this object represents. Servers may infer this from the endpoint the client submits requests to. Cannot be updated. In CamelCase. More info: https://git.k8s.io/community/contributors/devel/sig-architecture/api-conventions.md#types-kinds", + Type: []string{"string"}, + Format: "", + }, + }, + "apiVersion": { + SchemaProps: spec.SchemaProps{ + Description: "APIVersion defines the versioned schema of this representation of an object. Servers should convert recognized schemas to the latest internal value, and may reject unrecognized values. More info: https://git.k8s.io/community/contributors/devel/sig-architecture/api-conventions.md#resources", + Type: []string{"string"}, + Format: "", + }, + }, + "metadata": { + SchemaProps: spec.SchemaProps{ + Description: "metadata contains the list metadata", + Default: map[string]interface{}{}, + Ref: ref("k8s.io/apimachinery/pkg/apis/meta/v1.ListMeta"), + }, + }, + "items": { + SchemaProps: spec.SchemaProps{ + Description: "items contains a list of VolumeSnapshot.", + Type: []string{"array"}, + Items: &spec.SchemaOrArray{ + Schema: &spec.Schema{ + SchemaProps: spec.SchemaProps{ + Default: map[string]interface{}{}, + Ref: ref("github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.VolumeSnapshot"), + }, + }, + }, + }, + }, + }, + Required: []string{"items"}, + }, + }, + Dependencies: []string{ + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.VolumeSnapshot", "k8s.io/apimachinery/pkg/apis/meta/v1.ListMeta"}, + } +} + +func schema_openstack_resource_controller_v2_api_v1alpha1_VolumeSnapshotMetadata(ref common.ReferenceCallback) common.OpenAPIDefinition { + return common.OpenAPIDefinition{ + Schema: spec.Schema{ + SchemaProps: spec.SchemaProps{ + Type: []string{"object"}, + Properties: map[string]spec.Schema{ + "name": { + SchemaProps: spec.SchemaProps{ + Description: "name is the name of the metadata", + Default: "", + Type: []string{"string"}, + Format: "", + }, + }, + "value": { + SchemaProps: spec.SchemaProps{ + Description: "value is the value of the metadata", + Default: "", + Type: []string{"string"}, + Format: "", + }, + }, + }, + Required: []string{"name", "value"}, + }, + }, + } +} + +func schema_openstack_resource_controller_v2_api_v1alpha1_VolumeSnapshotMetadataStatus(ref common.ReferenceCallback) common.OpenAPIDefinition { + return common.OpenAPIDefinition{ + Schema: spec.Schema{ + SchemaProps: spec.SchemaProps{ + Type: []string{"object"}, + Properties: map[string]spec.Schema{ + "name": { + SchemaProps: spec.SchemaProps{ + Description: "name is the name of the metadata", + Type: []string{"string"}, + Format: "", + }, + }, + "value": { + SchemaProps: spec.SchemaProps{ + Description: "value is the value of the metadata", + Type: []string{"string"}, + Format: "", + }, + }, + }, + }, + }, + } +} + +func schema_openstack_resource_controller_v2_api_v1alpha1_VolumeSnapshotResourceSpec(ref common.ReferenceCallback) common.OpenAPIDefinition { + return common.OpenAPIDefinition{ + Schema: spec.Schema{ + SchemaProps: spec.SchemaProps{ + Description: "VolumeSnapshotResourceSpec contains the desired state of the resource.", + Type: []string{"object"}, + Properties: map[string]spec.Schema{ + "name": { + SchemaProps: spec.SchemaProps{ + Description: "name will be the name of the created resource. If not specified, the name of the ORC object will be used.", + Type: []string{"string"}, + Format: "", + }, + }, + "description": { + SchemaProps: spec.SchemaProps{ + Description: "description is a human-readable description for the resource.", + Type: []string{"string"}, + Format: "", + }, + }, + "volumeRef": { + SchemaProps: spec.SchemaProps{ + Description: "volumeRef is a reference to the ORC Volume to create a snapshot from.", + Type: []string{"string"}, + Format: "", + }, + }, + "force": { + SchemaProps: spec.SchemaProps{ + Description: "force allows creating a snapshot even if the volume is attached.", + Type: []string{"boolean"}, + Format: "", + }, + }, + "metadata": { + VendorExtensible: spec.VendorExtensible{ + Extensions: spec.Extensions{ + "x-kubernetes-list-type": "atomic", + }, + }, + SchemaProps: spec.SchemaProps{ + Description: "metadata key and value pairs to be associated with the snapshot.", + Type: []string{"array"}, + Items: &spec.SchemaOrArray{ + Schema: &spec.Schema{ + SchemaProps: spec.SchemaProps{ + Default: map[string]interface{}{}, + Ref: ref("github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.VolumeSnapshotMetadata"), + }, + }, + }, + }, + }, + }, + Required: []string{"volumeRef"}, + }, + }, + Dependencies: []string{ + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.VolumeSnapshotMetadata"}, + } +} + +func schema_openstack_resource_controller_v2_api_v1alpha1_VolumeSnapshotResourceStatus(ref common.ReferenceCallback) common.OpenAPIDefinition { + return common.OpenAPIDefinition{ + Schema: spec.Schema{ + SchemaProps: spec.SchemaProps{ + Description: "VolumeSnapshotResourceStatus represents the observed state of the resource.", + Type: []string{"object"}, + Properties: map[string]spec.Schema{ + "name": { + SchemaProps: spec.SchemaProps{ + Description: "name is a human-readable name for the resource. Might not be unique.", + Type: []string{"string"}, + Format: "", + }, + }, + "description": { + SchemaProps: spec.SchemaProps{ + Description: "description is a human-readable description for the resource.", + Type: []string{"string"}, + Format: "", + }, + }, + "status": { + SchemaProps: spec.SchemaProps{ + Description: "status represents the current status of the snapshot.", + Type: []string{"string"}, + Format: "", + }, + }, + "size": { + SchemaProps: spec.SchemaProps{ + Description: "size is the size of the snapshot in GiB.", + Type: []string{"integer"}, + Format: "int32", + }, + }, + "volumeID": { + SchemaProps: spec.SchemaProps{ + Description: "volumeID is the ID of the volume the snapshot was created from.", + Type: []string{"string"}, + Format: "", + }, + }, + "metadata": { + VendorExtensible: spec.VendorExtensible{ + Extensions: spec.Extensions{ + "x-kubernetes-list-type": "atomic", + }, + }, + SchemaProps: spec.SchemaProps{ + Description: "metadata key and value pairs associated with the snapshot.", + Type: []string{"array"}, + Items: &spec.SchemaOrArray{ + Schema: &spec.Schema{ + SchemaProps: spec.SchemaProps{ + Default: map[string]interface{}{}, + Ref: ref("github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.VolumeSnapshotMetadataStatus"), + }, + }, + }, + }, + }, + "progress": { + SchemaProps: spec.SchemaProps{ + Description: "progress is the percentage of completion of the snapshot creation.", + Type: []string{"string"}, + Format: "", + }, + }, + "projectID": { + SchemaProps: spec.SchemaProps{ + Description: "projectID is the ID of the project that owns the snapshot.", + Type: []string{"string"}, + Format: "", + }, + }, + "userID": { + SchemaProps: spec.SchemaProps{ + Description: "userID is the ID of the user who created the snapshot.", + Type: []string{"string"}, + Format: "", + }, + }, + "groupSnapshotID": { + SchemaProps: spec.SchemaProps{ + Description: "groupSnapshotID is the ID of the group snapshot, if applicable.", + Type: []string{"string"}, + Format: "", + }, + }, + "consumesQuota": { + SchemaProps: spec.SchemaProps{ + Description: "consumesQuota indicates whether the snapshot consumes quota.", + Type: []string{"boolean"}, + Format: "", + }, + }, + "createdAt": { + SchemaProps: spec.SchemaProps{ + Description: "createdAt shows the date and time when the resource was created. The date and time stamp format is ISO 8601.", + Ref: ref("k8s.io/apimachinery/pkg/apis/meta/v1.Time"), + }, + }, + "updatedAt": { + SchemaProps: spec.SchemaProps{ + Description: "updatedAt shows the date and time when the resource was updated. The date and time stamp format is ISO 8601.", + Ref: ref("k8s.io/apimachinery/pkg/apis/meta/v1.Time"), + }, + }, + }, + }, + }, + Dependencies: []string{ + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.VolumeSnapshotMetadataStatus", "k8s.io/apimachinery/pkg/apis/meta/v1.Time"}, + } +} + +func schema_openstack_resource_controller_v2_api_v1alpha1_VolumeSnapshotSpec(ref common.ReferenceCallback) common.OpenAPIDefinition { + return common.OpenAPIDefinition{ + Schema: spec.Schema{ + SchemaProps: spec.SchemaProps{ + Description: "VolumeSnapshotSpec defines the desired state of an ORC object.", + Type: []string{"object"}, + Properties: map[string]spec.Schema{ + "import": { + SchemaProps: spec.SchemaProps{ + Description: "import refers to an existing OpenStack resource which will be imported instead of creating a new one.", + Ref: ref("github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.VolumeSnapshotImport"), + }, + }, + "resource": { + SchemaProps: spec.SchemaProps{ + Description: "resource specifies the desired state of the resource.\n\nresource may not be specified if the management policy is `unmanaged`.\n\nresource must be specified if the management policy is `managed`.", + Ref: ref("github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.VolumeSnapshotResourceSpec"), + }, + }, + "managementPolicy": { + SchemaProps: spec.SchemaProps{ + Description: "managementPolicy defines how ORC will treat the object. Valid values are `managed`: ORC will create, update, and delete the resource; `unmanaged`: ORC will import an existing resource, and will not apply updates to it or delete it.", + Type: []string{"string"}, + Format: "", + }, + }, + "managedOptions": { + SchemaProps: spec.SchemaProps{ + Description: "managedOptions specifies options which may be applied to managed objects.", + Ref: ref("github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.ManagedOptions"), + }, + }, + "cloudCredentialsRef": { + SchemaProps: spec.SchemaProps{ + Description: "cloudCredentialsRef points to a secret containing OpenStack credentials", + Default: map[string]interface{}{}, + Ref: ref("github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.CloudCredentialsReference"), + }, + }, + }, + Required: []string{"cloudCredentialsRef"}, + }, + }, + Dependencies: []string{ + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.CloudCredentialsReference", "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.ManagedOptions", "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.VolumeSnapshotImport", "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.VolumeSnapshotResourceSpec"}, + } +} + +func schema_openstack_resource_controller_v2_api_v1alpha1_VolumeSnapshotStatus(ref common.ReferenceCallback) common.OpenAPIDefinition { + return common.OpenAPIDefinition{ + Schema: spec.Schema{ + SchemaProps: spec.SchemaProps{ + Description: "VolumeSnapshotStatus defines the observed state of an ORC resource.", + Type: []string{"object"}, + Properties: map[string]spec.Schema{ + "conditions": { + VendorExtensible: spec.VendorExtensible{ + Extensions: spec.Extensions{ + "x-kubernetes-list-map-keys": []interface{}{ + "type", + }, + "x-kubernetes-list-type": "map", + "x-kubernetes-patch-merge-key": "type", + "x-kubernetes-patch-strategy": "merge", + }, + }, + SchemaProps: spec.SchemaProps{ + Description: "conditions represents the observed status of the object. Known .status.conditions.type are: \"Available\", \"Progressing\"\n\nAvailable represents the availability of the OpenStack resource. If it is true then the resource is ready for use.\n\nProgressing indicates whether the controller is still attempting to reconcile the current state of the OpenStack resource to the desired state. Progressing will be False either because the desired state has been achieved, or because some terminal error prevents it from ever being achieved and the controller is no longer attempting to reconcile. If Progressing is True, an observer waiting on the resource should continue to wait.", + Type: []string{"array"}, + Items: &spec.SchemaOrArray{ + Schema: &spec.Schema{ + SchemaProps: spec.SchemaProps{ + Default: map[string]interface{}{}, + Ref: ref("k8s.io/apimachinery/pkg/apis/meta/v1.Condition"), + }, + }, + }, + }, + }, + "id": { + SchemaProps: spec.SchemaProps{ + Description: "id is the unique identifier of the OpenStack resource.", + Type: []string{"string"}, + Format: "", + }, + }, + "resource": { + SchemaProps: spec.SchemaProps{ + Description: "resource contains the observed state of the OpenStack resource.", + Ref: ref("github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.VolumeSnapshotResourceStatus"), + }, + }, + }, + }, + }, + Dependencies: []string{ + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.VolumeSnapshotResourceStatus", "k8s.io/apimachinery/pkg/apis/meta/v1.Condition"}, + } +} + func schema_openstack_resource_controller_v2_api_v1alpha1_VolumeSpec(ref common.ReferenceCallback) common.OpenAPIDefinition { return common.OpenAPIDefinition{ Schema: spec.Schema{ diff --git a/config/crd/bases/openstack.k-orc.cloud_volumesnapshots.yaml b/config/crd/bases/openstack.k-orc.cloud_volumesnapshots.yaml new file mode 100644 index 000000000..9d8109023 --- /dev/null +++ b/config/crd/bases/openstack.k-orc.cloud_volumesnapshots.yaml @@ -0,0 +1,399 @@ +--- +apiVersion: apiextensions.k8s.io/v1 +kind: CustomResourceDefinition +metadata: + annotations: + controller-gen.kubebuilder.io/version: v0.17.1 + name: volumesnapshots.openstack.k-orc.cloud +spec: + group: openstack.k-orc.cloud + names: + categories: + - openstack + kind: VolumeSnapshot + listKind: VolumeSnapshotList + plural: volumesnapshots + singular: volumesnapshot + scope: Namespaced + versions: + - additionalPrinterColumns: + - description: Resource ID + jsonPath: .status.id + name: ID + type: string + - description: Availability status of resource + jsonPath: .status.conditions[?(@.type=='Available')].status + name: Available + type: string + - description: Message describing current progress status + jsonPath: .status.conditions[?(@.type=='Progressing')].message + name: Message + type: string + name: v1alpha1 + schema: + openAPIV3Schema: + description: VolumeSnapshot is the Schema for an ORC resource. + properties: + apiVersion: + description: |- + APIVersion defines the versioned schema of this representation of an object. + Servers should convert recognized schemas to the latest internal value, and + may reject unrecognized values. + More info: https://git.k8s.io/community/contributors/devel/sig-architecture/api-conventions.md#resources + type: string + kind: + description: |- + Kind is a string value representing the REST resource this object represents. + Servers may infer this from the endpoint the client submits requests to. + Cannot be updated. + In CamelCase. + More info: https://git.k8s.io/community/contributors/devel/sig-architecture/api-conventions.md#types-kinds + type: string + metadata: + type: object + spec: + description: spec specifies the desired state of the resource. + properties: + cloudCredentialsRef: + description: cloudCredentialsRef points to a secret containing OpenStack + credentials + properties: + cloudName: + description: cloudName specifies the name of the entry in the + clouds.yaml file to use. + maxLength: 256 + minLength: 1 + type: string + secretName: + description: |- + secretName is the name of a secret in the same namespace as the resource being provisioned. + The secret must contain a key named `clouds.yaml` which contains an OpenStack clouds.yaml file. + The secret may optionally contain a key named `cacert` containing a PEM-encoded CA certificate. + maxLength: 253 + minLength: 1 + type: string + required: + - cloudName + - secretName + type: object + import: + description: |- + import refers to an existing OpenStack resource which will be imported instead of + creating a new one. + maxProperties: 1 + minProperties: 1 + properties: + filter: + description: |- + filter contains a resource query which is expected to return a single + result. The controller will continue to retry if filter returns no + results. If filter returns multiple results the controller will set an + error state and will not continue to retry. + minProperties: 1 + properties: + name: + description: name of the existing resource + maxLength: 255 + minLength: 1 + pattern: ^[^,]+$ + type: string + status: + description: status of the existing resource + maxLength: 255 + minLength: 1 + type: string + volumeID: + description: volumeID is the ID of the volume the snapshot + was created from + maxLength: 255 + minLength: 1 + type: string + type: object + id: + description: |- + id contains the unique identifier of an existing OpenStack resource. Note + that when specifying an import by ID, the resource MUST already exist. + The ORC object will enter an error state if the resource does not exist. + format: uuid + maxLength: 36 + type: string + type: object + managedOptions: + description: managedOptions specifies options which may be applied + to managed objects. + properties: + onDelete: + default: delete + description: |- + onDelete specifies the behaviour of the controller when the ORC + object is deleted. Options are `delete` - delete the OpenStack resource; + `detach` - do not delete the OpenStack resource. If not specified, the + default is `delete`. + enum: + - delete + - detach + type: string + type: object + managementPolicy: + default: managed + description: |- + managementPolicy defines how ORC will treat the object. Valid values are + `managed`: ORC will create, update, and delete the resource; `unmanaged`: + ORC will import an existing resource, and will not apply updates to it or + delete it. + enum: + - managed + - unmanaged + type: string + x-kubernetes-validations: + - message: managementPolicy is immutable + rule: self == oldSelf + resource: + description: |- + resource specifies the desired state of the resource. + + resource may not be specified if the management policy is `unmanaged`. + + resource must be specified if the management policy is `managed`. + properties: + description: + description: description is a human-readable description for the + resource. + maxLength: 255 + minLength: 1 + type: string + force: + description: force allows creating a snapshot even if the volume + is attached. + type: boolean + x-kubernetes-validations: + - message: force is immutable + rule: self == oldSelf + metadata: + description: metadata key and value pairs to be associated with + the snapshot. + items: + properties: + name: + description: name is the name of the metadata + maxLength: 255 + type: string + value: + description: value is the value of the metadata + maxLength: 255 + type: string + required: + - name + - value + type: object + maxItems: 64 + type: array + x-kubernetes-list-type: atomic + x-kubernetes-validations: + - message: metadata is immutable + rule: self == oldSelf + name: + description: |- + name will be the name of the created resource. If not specified, the + name of the ORC object will be used. + maxLength: 255 + minLength: 1 + pattern: ^[^,]+$ + type: string + volumeRef: + description: volumeRef is a reference to the ORC Volume to create + a snapshot from. + maxLength: 253 + minLength: 1 + type: string + x-kubernetes-validations: + - message: volumeRef is immutable + rule: self == oldSelf + required: + - volumeRef + type: object + required: + - cloudCredentialsRef + type: object + x-kubernetes-validations: + - message: resource must be specified when policy is managed + rule: 'self.managementPolicy == ''managed'' ? has(self.resource) : true' + - message: import may not be specified when policy is managed + rule: 'self.managementPolicy == ''managed'' ? !has(self.__import__) + : true' + - message: resource may not be specified when policy is unmanaged + rule: 'self.managementPolicy == ''unmanaged'' ? !has(self.resource) + : true' + - message: import must be specified when policy is unmanaged + rule: 'self.managementPolicy == ''unmanaged'' ? has(self.__import__) + : true' + - message: managedOptions may only be provided when policy is managed + rule: 'has(self.managedOptions) ? self.managementPolicy == ''managed'' + : true' + status: + description: status defines the observed state of the resource. + properties: + conditions: + description: |- + conditions represents the observed status of the object. + Known .status.conditions.type are: "Available", "Progressing" + + Available represents the availability of the OpenStack resource. If it is + true then the resource is ready for use. + + Progressing indicates whether the controller is still attempting to + reconcile the current state of the OpenStack resource to the desired + state. Progressing will be False either because the desired state has + been achieved, or because some terminal error prevents it from ever being + achieved and the controller is no longer attempting to reconcile. If + Progressing is True, an observer waiting on the resource should continue + to wait. + items: + description: Condition contains details for one aspect of the current + state of this API Resource. + properties: + lastTransitionTime: + description: |- + lastTransitionTime is the last time the condition transitioned from one status to another. + This should be when the underlying condition changed. If that is not known, then using the time when the API field changed is acceptable. + format: date-time + type: string + message: + description: |- + message is a human readable message indicating details about the transition. + This may be an empty string. + maxLength: 32768 + type: string + observedGeneration: + description: |- + observedGeneration represents the .metadata.generation that the condition was set based upon. + For instance, if .metadata.generation is currently 12, but the .status.conditions[x].observedGeneration is 9, the condition is out of date + with respect to the current state of the instance. + format: int64 + minimum: 0 + type: integer + reason: + description: |- + reason contains a programmatic identifier indicating the reason for the condition's last transition. + Producers of specific condition types may define expected values and meanings for this field, + and whether the values are considered a guaranteed API. + The value should be a CamelCase string. + This field may not be empty. + maxLength: 1024 + minLength: 1 + pattern: ^[A-Za-z]([A-Za-z0-9_,:]*[A-Za-z0-9_])?$ + type: string + status: + description: status of the condition, one of True, False, Unknown. + enum: + - "True" + - "False" + - Unknown + type: string + type: + description: type of condition in CamelCase or in foo.example.com/CamelCase. + maxLength: 316 + pattern: ^([a-z0-9]([-a-z0-9]*[a-z0-9])?(\.[a-z0-9]([-a-z0-9]*[a-z0-9])?)*/)?(([A-Za-z0-9][-A-Za-z0-9_.]*)?[A-Za-z0-9])$ + type: string + required: + - lastTransitionTime + - message + - reason + - status + - type + type: object + maxItems: 32 + type: array + x-kubernetes-list-map-keys: + - type + x-kubernetes-list-type: map + id: + description: id is the unique identifier of the OpenStack resource. + maxLength: 1024 + type: string + resource: + description: resource contains the observed state of the OpenStack + resource. + properties: + consumesQuota: + description: consumesQuota indicates whether the snapshot consumes + quota. + type: boolean + createdAt: + description: createdAt shows the date and time when the resource + was created. The date and time stamp format is ISO 8601. + format: date-time + type: string + description: + description: description is a human-readable description for the + resource. + maxLength: 1024 + type: string + groupSnapshotID: + description: groupSnapshotID is the ID of the group snapshot, + if applicable. + maxLength: 1024 + type: string + metadata: + description: metadata key and value pairs associated with the + snapshot. + items: + properties: + name: + description: name is the name of the metadata + maxLength: 255 + type: string + value: + description: value is the value of the metadata + maxLength: 255 + type: string + type: object + maxItems: 64 + type: array + x-kubernetes-list-type: atomic + name: + description: name is a human-readable name for the resource. Might + not be unique. + maxLength: 1024 + type: string + progress: + description: progress is the percentage of completion of the snapshot + creation. + maxLength: 1024 + type: string + projectID: + description: projectID is the ID of the project that owns the + snapshot. + maxLength: 1024 + type: string + size: + description: size is the size of the snapshot in GiB. + format: int32 + type: integer + status: + description: status represents the current status of the snapshot. + maxLength: 1024 + type: string + updatedAt: + description: updatedAt shows the date and time when the resource + was updated. The date and time stamp format is ISO 8601. + format: date-time + type: string + userID: + description: userID is the ID of the user who created the snapshot. + maxLength: 1024 + type: string + volumeID: + description: volumeID is the ID of the volume the snapshot was + created from. + maxLength: 1024 + type: string + type: object + type: object + required: + - spec + type: object + served: true + storage: true + subresources: + status: {} diff --git a/config/crd/kustomization.yaml b/config/crd/kustomization.yaml index 592ed3b14..915d6f0c9 100644 --- a/config/crd/kustomization.yaml +++ b/config/crd/kustomization.yaml @@ -25,6 +25,7 @@ resources: - bases/openstack.k-orc.cloud_trunks.yaml - bases/openstack.k-orc.cloud_users.yaml - bases/openstack.k-orc.cloud_volumes.yaml +- bases/openstack.k-orc.cloud_volumesnapshots.yaml - bases/openstack.k-orc.cloud_volumetypes.yaml # +kubebuilder:scaffold:crdkustomizeresource diff --git a/config/rbac/role.yaml b/config/rbac/role.yaml index dbadb7068..96ad6ad0c 100644 --- a/config/rbac/role.yaml +++ b/config/rbac/role.yaml @@ -39,6 +39,7 @@ rules: - trunks - users - volumes + - volumesnapshots - volumetypes verbs: - create @@ -73,6 +74,7 @@ rules: - trunks/status - users/status - volumes/status + - volumesnapshots/status - volumetypes/status verbs: - get diff --git a/config/samples/kustomization.yaml b/config/samples/kustomization.yaml index eb819d448..c7d40d7dd 100644 --- a/config/samples/kustomization.yaml +++ b/config/samples/kustomization.yaml @@ -23,5 +23,6 @@ resources: - openstack_v1alpha1_trunk.yaml - openstack_v1alpha1_user.yaml - openstack_v1alpha1_volume.yaml +- openstack_v1alpha1_volumesnapshot.yaml - openstack_v1alpha1_volumetype.yaml # +kubebuilder:scaffold:manifestskustomizesamples diff --git a/internal/controllers/volumesnapshot/zz_generated.adapter.go b/internal/controllers/volumesnapshot/zz_generated.adapter.go new file mode 100644 index 000000000..7ee837808 --- /dev/null +++ b/internal/controllers/volumesnapshot/zz_generated.adapter.go @@ -0,0 +1,88 @@ +// Code generated by resource-generator. DO NOT EDIT. +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package volumesnapshot + +import ( + orcv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/generic/interfaces" +) + +// Fundamental types +type ( + orcObjectT = orcv1alpha1.VolumeSnapshot + orcObjectListT = orcv1alpha1.VolumeSnapshotList + resourceSpecT = orcv1alpha1.VolumeSnapshotResourceSpec + filterT = orcv1alpha1.VolumeSnapshotFilter +) + +// Derived types +type ( + orcObjectPT = *orcObjectT + adapterI = interfaces.APIObjectAdapter[orcObjectPT, resourceSpecT, filterT] + adapterT = volumesnapshotAdapter +) + +type volumesnapshotAdapter struct { + *orcv1alpha1.VolumeSnapshot +} + +var _ adapterI = &adapterT{} + +func (f adapterT) GetObject() orcObjectPT { + return f.VolumeSnapshot +} + +func (f adapterT) GetManagementPolicy() orcv1alpha1.ManagementPolicy { + return f.Spec.ManagementPolicy +} + +func (f adapterT) GetManagedOptions() *orcv1alpha1.ManagedOptions { + return f.Spec.ManagedOptions +} + +func (f adapterT) GetStatusID() *string { + return f.Status.ID +} + +func (f adapterT) GetResourceSpec() *resourceSpecT { + return f.Spec.Resource +} + +func (f adapterT) GetImportID() *string { + if f.Spec.Import == nil { + return nil + } + return f.Spec.Import.ID +} + +func (f adapterT) GetImportFilter() *filterT { + if f.Spec.Import == nil { + return nil + } + return f.Spec.Import.Filter +} + +// getResourceName returns the name of the OpenStack resource we should use. +// This method is not implemented as part of APIObjectAdapter as it is intended +// to be used by resource actuators, which don't use the adapter. +func getResourceName(orcObject orcObjectPT) string { + if orcObject.Spec.Resource.Name != nil { + return string(*orcObject.Spec.Resource.Name) + } + return orcObject.Name +} diff --git a/internal/controllers/volumesnapshot/zz_generated.controller.go b/internal/controllers/volumesnapshot/zz_generated.controller.go new file mode 100644 index 000000000..53d04a57d --- /dev/null +++ b/internal/controllers/volumesnapshot/zz_generated.controller.go @@ -0,0 +1,45 @@ +// Code generated by resource-generator. DO NOT EDIT. +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package volumesnapshot + +import ( + corev1 "k8s.io/api/core/v1" + + "github.com/k-orc/openstack-resource-controller/v2/internal/util/dependency" + orcstrings "github.com/k-orc/openstack-resource-controller/v2/internal/util/strings" +) + +var ( + // NOTE: controllerName must be defined in any controller using this template + + // finalizer is the string this controller adds to an object's Finalizers + finalizer = orcstrings.GetFinalizerName(controllerName) + + // externalObjectFieldOwner is the field owner we use when using + // server-side-apply on objects we don't control + externalObjectFieldOwner = orcstrings.GetSSAFieldOwner(controllerName) + + credentialsDependency = dependency.NewDeletionGuardDependency[*orcObjectListT, *corev1.Secret]( + "spec.cloudCredentialsRef.secretName", + func(obj orcObjectPT) []string { + return []string{obj.Spec.CloudCredentialsRef.SecretName} + }, + finalizer, externalObjectFieldOwner, + dependency.OverrideDependencyName("credentials"), + ) +) diff --git a/internal/osclients/mock/volumesnapshot.go b/internal/osclients/mock/volumesnapshot.go new file mode 100644 index 000000000..ec7fe315d --- /dev/null +++ b/internal/osclients/mock/volumesnapshot.go @@ -0,0 +1,131 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ +// Code generated by MockGen. DO NOT EDIT. +// Source: ../volumesnapshot.go +// +// Generated by this command: +// +// mockgen -package mock -destination=volumesnapshot.go -source=../volumesnapshot.go github.com/k-orc/openstack-resource-controller/internal/osclients/mock VolumeSnapshotClient +// + +// Package mock is a generated GoMock package. +package mock + +import ( + context "context" + iter "iter" + reflect "reflect" + + snapshots "github.com/gophercloud/gophercloud/v2/openstack/blockstorage/v3/snapshots" + gomock "go.uber.org/mock/gomock" +) + +// MockVolumeSnapshotClient is a mock of VolumeSnapshotClient interface. +type MockVolumeSnapshotClient struct { + ctrl *gomock.Controller + recorder *MockVolumeSnapshotClientMockRecorder + isgomock struct{} +} + +// MockVolumeSnapshotClientMockRecorder is the mock recorder for MockVolumeSnapshotClient. +type MockVolumeSnapshotClientMockRecorder struct { + mock *MockVolumeSnapshotClient +} + +// NewMockVolumeSnapshotClient creates a new mock instance. +func NewMockVolumeSnapshotClient(ctrl *gomock.Controller) *MockVolumeSnapshotClient { + mock := &MockVolumeSnapshotClient{ctrl: ctrl} + mock.recorder = &MockVolumeSnapshotClientMockRecorder{mock} + return mock +} + +// EXPECT returns an object that allows the caller to indicate expected use. +func (m *MockVolumeSnapshotClient) EXPECT() *MockVolumeSnapshotClientMockRecorder { + return m.recorder +} + +// CreateVolumeSnapshot mocks base method. +func (m *MockVolumeSnapshotClient) CreateVolumeSnapshot(ctx context.Context, opts snapshots.CreateOptsBuilder) (*snapshots.Snapshot, error) { + m.ctrl.T.Helper() + ret := m.ctrl.Call(m, "CreateVolumeSnapshot", ctx, opts) + ret0, _ := ret[0].(*snapshots.Snapshot) + ret1, _ := ret[1].(error) + return ret0, ret1 +} + +// CreateVolumeSnapshot indicates an expected call of CreateVolumeSnapshot. +func (mr *MockVolumeSnapshotClientMockRecorder) CreateVolumeSnapshot(ctx, opts any) *gomock.Call { + mr.mock.ctrl.T.Helper() + return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "CreateVolumeSnapshot", reflect.TypeOf((*MockVolumeSnapshotClient)(nil).CreateVolumeSnapshot), ctx, opts) +} + +// DeleteVolumeSnapshot mocks base method. +func (m *MockVolumeSnapshotClient) DeleteVolumeSnapshot(ctx context.Context, resourceID string) error { + m.ctrl.T.Helper() + ret := m.ctrl.Call(m, "DeleteVolumeSnapshot", ctx, resourceID) + ret0, _ := ret[0].(error) + return ret0 +} + +// DeleteVolumeSnapshot indicates an expected call of DeleteVolumeSnapshot. +func (mr *MockVolumeSnapshotClientMockRecorder) DeleteVolumeSnapshot(ctx, resourceID any) *gomock.Call { + mr.mock.ctrl.T.Helper() + return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "DeleteVolumeSnapshot", reflect.TypeOf((*MockVolumeSnapshotClient)(nil).DeleteVolumeSnapshot), ctx, resourceID) +} + +// GetVolumeSnapshot mocks base method. +func (m *MockVolumeSnapshotClient) GetVolumeSnapshot(ctx context.Context, resourceID string) (*snapshots.Snapshot, error) { + m.ctrl.T.Helper() + ret := m.ctrl.Call(m, "GetVolumeSnapshot", ctx, resourceID) + ret0, _ := ret[0].(*snapshots.Snapshot) + ret1, _ := ret[1].(error) + return ret0, ret1 +} + +// GetVolumeSnapshot indicates an expected call of GetVolumeSnapshot. +func (mr *MockVolumeSnapshotClientMockRecorder) GetVolumeSnapshot(ctx, resourceID any) *gomock.Call { + mr.mock.ctrl.T.Helper() + return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "GetVolumeSnapshot", reflect.TypeOf((*MockVolumeSnapshotClient)(nil).GetVolumeSnapshot), ctx, resourceID) +} + +// ListVolumeSnapshots mocks base method. +func (m *MockVolumeSnapshotClient) ListVolumeSnapshots(ctx context.Context, listOpts snapshots.ListOptsBuilder) iter.Seq2[*snapshots.Snapshot, error] { + m.ctrl.T.Helper() + ret := m.ctrl.Call(m, "ListVolumeSnapshots", ctx, listOpts) + ret0, _ := ret[0].(iter.Seq2[*snapshots.Snapshot, error]) + return ret0 +} + +// ListVolumeSnapshots indicates an expected call of ListVolumeSnapshots. +func (mr *MockVolumeSnapshotClientMockRecorder) ListVolumeSnapshots(ctx, listOpts any) *gomock.Call { + mr.mock.ctrl.T.Helper() + return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "ListVolumeSnapshots", reflect.TypeOf((*MockVolumeSnapshotClient)(nil).ListVolumeSnapshots), ctx, listOpts) +} + +// UpdateVolumeSnapshot mocks base method. +func (m *MockVolumeSnapshotClient) UpdateVolumeSnapshot(ctx context.Context, id string, opts snapshots.UpdateOptsBuilder) (*snapshots.Snapshot, error) { + m.ctrl.T.Helper() + ret := m.ctrl.Call(m, "UpdateVolumeSnapshot", ctx, id, opts) + ret0, _ := ret[0].(*snapshots.Snapshot) + ret1, _ := ret[1].(error) + return ret0, ret1 +} + +// UpdateVolumeSnapshot indicates an expected call of UpdateVolumeSnapshot. +func (mr *MockVolumeSnapshotClientMockRecorder) UpdateVolumeSnapshot(ctx, id, opts any) *gomock.Call { + mr.mock.ctrl.T.Helper() + return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "UpdateVolumeSnapshot", reflect.TypeOf((*MockVolumeSnapshotClient)(nil).UpdateVolumeSnapshot), ctx, id, opts) +} diff --git a/kuttl-test.yaml b/kuttl-test.yaml index a6384f50d..7c2def8b4 100644 --- a/kuttl-test.yaml +++ b/kuttl-test.yaml @@ -24,5 +24,6 @@ testDirs: - ./internal/controllers/trunk/tests/ - ./internal/controllers/user/tests/ - ./internal/controllers/volume/tests/ +- ./internal/controllers/volumesnapshot/tests/ - ./internal/controllers/volumetype/tests/ timeout: 240 diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshot.go b/pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshot.go new file mode 100644 index 000000000..d37ba0897 --- /dev/null +++ b/pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshot.go @@ -0,0 +1,281 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by applyconfiguration-gen. DO NOT EDIT. + +package v1alpha1 + +import ( + apiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + internal "github.com/k-orc/openstack-resource-controller/v2/pkg/clients/applyconfiguration/internal" + metav1 "k8s.io/apimachinery/pkg/apis/meta/v1" + types "k8s.io/apimachinery/pkg/types" + managedfields "k8s.io/apimachinery/pkg/util/managedfields" + v1 "k8s.io/client-go/applyconfigurations/meta/v1" +) + +// VolumeSnapshotApplyConfiguration represents a declarative configuration of the VolumeSnapshot type for use +// with apply. +type VolumeSnapshotApplyConfiguration struct { + v1.TypeMetaApplyConfiguration `json:",inline"` + *v1.ObjectMetaApplyConfiguration `json:"metadata,omitempty"` + Spec *VolumeSnapshotSpecApplyConfiguration `json:"spec,omitempty"` + Status *VolumeSnapshotStatusApplyConfiguration `json:"status,omitempty"` +} + +// VolumeSnapshot constructs a declarative configuration of the VolumeSnapshot type for use with +// apply. +func VolumeSnapshot(name, namespace string) *VolumeSnapshotApplyConfiguration { + b := &VolumeSnapshotApplyConfiguration{} + b.WithName(name) + b.WithNamespace(namespace) + b.WithKind("VolumeSnapshot") + b.WithAPIVersion("openstack.k-orc.cloud/v1alpha1") + return b +} + +// ExtractVolumeSnapshot extracts the applied configuration owned by fieldManager from +// volumeSnapshot. If no managedFields are found in volumeSnapshot for fieldManager, a +// VolumeSnapshotApplyConfiguration is returned with only the Name, Namespace (if applicable), +// APIVersion and Kind populated. It is possible that no managed fields were found for because other +// field managers have taken ownership of all the fields previously owned by fieldManager, or because +// the fieldManager never owned fields any fields. +// volumeSnapshot must be a unmodified VolumeSnapshot API object that was retrieved from the Kubernetes API. +// ExtractVolumeSnapshot provides a way to perform a extract/modify-in-place/apply workflow. +// Note that an extracted apply configuration will contain fewer fields than what the fieldManager previously +// applied if another fieldManager has updated or force applied any of the previously applied fields. +// Experimental! +func ExtractVolumeSnapshot(volumeSnapshot *apiv1alpha1.VolumeSnapshot, fieldManager string) (*VolumeSnapshotApplyConfiguration, error) { + return extractVolumeSnapshot(volumeSnapshot, fieldManager, "") +} + +// ExtractVolumeSnapshotStatus is the same as ExtractVolumeSnapshot except +// that it extracts the status subresource applied configuration. +// Experimental! +func ExtractVolumeSnapshotStatus(volumeSnapshot *apiv1alpha1.VolumeSnapshot, fieldManager string) (*VolumeSnapshotApplyConfiguration, error) { + return extractVolumeSnapshot(volumeSnapshot, fieldManager, "status") +} + +func extractVolumeSnapshot(volumeSnapshot *apiv1alpha1.VolumeSnapshot, fieldManager string, subresource string) (*VolumeSnapshotApplyConfiguration, error) { + b := &VolumeSnapshotApplyConfiguration{} + err := managedfields.ExtractInto(volumeSnapshot, internal.Parser().Type("com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.VolumeSnapshot"), fieldManager, b, subresource) + if err != nil { + return nil, err + } + b.WithName(volumeSnapshot.Name) + b.WithNamespace(volumeSnapshot.Namespace) + + b.WithKind("VolumeSnapshot") + b.WithAPIVersion("openstack.k-orc.cloud/v1alpha1") + return b, nil +} +func (b VolumeSnapshotApplyConfiguration) IsApplyConfiguration() {} + +// WithKind sets the Kind field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Kind field is set to the value of the last call. +func (b *VolumeSnapshotApplyConfiguration) WithKind(value string) *VolumeSnapshotApplyConfiguration { + b.TypeMetaApplyConfiguration.Kind = &value + return b +} + +// WithAPIVersion sets the APIVersion field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the APIVersion field is set to the value of the last call. +func (b *VolumeSnapshotApplyConfiguration) WithAPIVersion(value string) *VolumeSnapshotApplyConfiguration { + b.TypeMetaApplyConfiguration.APIVersion = &value + return b +} + +// WithName sets the Name field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Name field is set to the value of the last call. +func (b *VolumeSnapshotApplyConfiguration) WithName(value string) *VolumeSnapshotApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + b.ObjectMetaApplyConfiguration.Name = &value + return b +} + +// WithGenerateName sets the GenerateName field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the GenerateName field is set to the value of the last call. +func (b *VolumeSnapshotApplyConfiguration) WithGenerateName(value string) *VolumeSnapshotApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + b.ObjectMetaApplyConfiguration.GenerateName = &value + return b +} + +// WithNamespace sets the Namespace field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Namespace field is set to the value of the last call. +func (b *VolumeSnapshotApplyConfiguration) WithNamespace(value string) *VolumeSnapshotApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + b.ObjectMetaApplyConfiguration.Namespace = &value + return b +} + +// WithUID sets the UID field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the UID field is set to the value of the last call. +func (b *VolumeSnapshotApplyConfiguration) WithUID(value types.UID) *VolumeSnapshotApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + b.ObjectMetaApplyConfiguration.UID = &value + return b +} + +// WithResourceVersion sets the ResourceVersion field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the ResourceVersion field is set to the value of the last call. +func (b *VolumeSnapshotApplyConfiguration) WithResourceVersion(value string) *VolumeSnapshotApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + b.ObjectMetaApplyConfiguration.ResourceVersion = &value + return b +} + +// WithGeneration sets the Generation field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Generation field is set to the value of the last call. +func (b *VolumeSnapshotApplyConfiguration) WithGeneration(value int64) *VolumeSnapshotApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + b.ObjectMetaApplyConfiguration.Generation = &value + return b +} + +// WithCreationTimestamp sets the CreationTimestamp field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the CreationTimestamp field is set to the value of the last call. +func (b *VolumeSnapshotApplyConfiguration) WithCreationTimestamp(value metav1.Time) *VolumeSnapshotApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + b.ObjectMetaApplyConfiguration.CreationTimestamp = &value + return b +} + +// WithDeletionTimestamp sets the DeletionTimestamp field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the DeletionTimestamp field is set to the value of the last call. +func (b *VolumeSnapshotApplyConfiguration) WithDeletionTimestamp(value metav1.Time) *VolumeSnapshotApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + b.ObjectMetaApplyConfiguration.DeletionTimestamp = &value + return b +} + +// WithDeletionGracePeriodSeconds sets the DeletionGracePeriodSeconds field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the DeletionGracePeriodSeconds field is set to the value of the last call. +func (b *VolumeSnapshotApplyConfiguration) WithDeletionGracePeriodSeconds(value int64) *VolumeSnapshotApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + b.ObjectMetaApplyConfiguration.DeletionGracePeriodSeconds = &value + return b +} + +// WithLabels puts the entries into the Labels field in the declarative configuration +// and returns the receiver, so that objects can be build by chaining "With" function invocations. +// If called multiple times, the entries provided by each call will be put on the Labels field, +// overwriting an existing map entries in Labels field with the same key. +func (b *VolumeSnapshotApplyConfiguration) WithLabels(entries map[string]string) *VolumeSnapshotApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + if b.ObjectMetaApplyConfiguration.Labels == nil && len(entries) > 0 { + b.ObjectMetaApplyConfiguration.Labels = make(map[string]string, len(entries)) + } + for k, v := range entries { + b.ObjectMetaApplyConfiguration.Labels[k] = v + } + return b +} + +// WithAnnotations puts the entries into the Annotations field in the declarative configuration +// and returns the receiver, so that objects can be build by chaining "With" function invocations. +// If called multiple times, the entries provided by each call will be put on the Annotations field, +// overwriting an existing map entries in Annotations field with the same key. +func (b *VolumeSnapshotApplyConfiguration) WithAnnotations(entries map[string]string) *VolumeSnapshotApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + if b.ObjectMetaApplyConfiguration.Annotations == nil && len(entries) > 0 { + b.ObjectMetaApplyConfiguration.Annotations = make(map[string]string, len(entries)) + } + for k, v := range entries { + b.ObjectMetaApplyConfiguration.Annotations[k] = v + } + return b +} + +// WithOwnerReferences adds the given value to the OwnerReferences field in the declarative configuration +// and returns the receiver, so that objects can be build by chaining "With" function invocations. +// If called multiple times, values provided by each call will be appended to the OwnerReferences field. +func (b *VolumeSnapshotApplyConfiguration) WithOwnerReferences(values ...*v1.OwnerReferenceApplyConfiguration) *VolumeSnapshotApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + for i := range values { + if values[i] == nil { + panic("nil value passed to WithOwnerReferences") + } + b.ObjectMetaApplyConfiguration.OwnerReferences = append(b.ObjectMetaApplyConfiguration.OwnerReferences, *values[i]) + } + return b +} + +// WithFinalizers adds the given value to the Finalizers field in the declarative configuration +// and returns the receiver, so that objects can be build by chaining "With" function invocations. +// If called multiple times, values provided by each call will be appended to the Finalizers field. +func (b *VolumeSnapshotApplyConfiguration) WithFinalizers(values ...string) *VolumeSnapshotApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + for i := range values { + b.ObjectMetaApplyConfiguration.Finalizers = append(b.ObjectMetaApplyConfiguration.Finalizers, values[i]) + } + return b +} + +func (b *VolumeSnapshotApplyConfiguration) ensureObjectMetaApplyConfigurationExists() { + if b.ObjectMetaApplyConfiguration == nil { + b.ObjectMetaApplyConfiguration = &v1.ObjectMetaApplyConfiguration{} + } +} + +// WithSpec sets the Spec field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Spec field is set to the value of the last call. +func (b *VolumeSnapshotApplyConfiguration) WithSpec(value *VolumeSnapshotSpecApplyConfiguration) *VolumeSnapshotApplyConfiguration { + b.Spec = value + return b +} + +// WithStatus sets the Status field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Status field is set to the value of the last call. +func (b *VolumeSnapshotApplyConfiguration) WithStatus(value *VolumeSnapshotStatusApplyConfiguration) *VolumeSnapshotApplyConfiguration { + b.Status = value + return b +} + +// GetKind retrieves the value of the Kind field in the declarative configuration. +func (b *VolumeSnapshotApplyConfiguration) GetKind() *string { + return b.TypeMetaApplyConfiguration.Kind +} + +// GetAPIVersion retrieves the value of the APIVersion field in the declarative configuration. +func (b *VolumeSnapshotApplyConfiguration) GetAPIVersion() *string { + return b.TypeMetaApplyConfiguration.APIVersion +} + +// GetName retrieves the value of the Name field in the declarative configuration. +func (b *VolumeSnapshotApplyConfiguration) GetName() *string { + b.ensureObjectMetaApplyConfigurationExists() + return b.ObjectMetaApplyConfiguration.Name +} + +// GetNamespace retrieves the value of the Namespace field in the declarative configuration. +func (b *VolumeSnapshotApplyConfiguration) GetNamespace() *string { + b.ensureObjectMetaApplyConfigurationExists() + return b.ObjectMetaApplyConfiguration.Namespace +} diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshotfilter.go b/pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshotfilter.go new file mode 100644 index 000000000..19aa9bde0 --- /dev/null +++ b/pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshotfilter.go @@ -0,0 +1,61 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by applyconfiguration-gen. DO NOT EDIT. + +package v1alpha1 + +import ( + apiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" +) + +// VolumeSnapshotFilterApplyConfiguration represents a declarative configuration of the VolumeSnapshotFilter type for use +// with apply. +type VolumeSnapshotFilterApplyConfiguration struct { + Name *apiv1alpha1.OpenStackName `json:"name,omitempty"` + Status *string `json:"status,omitempty"` + VolumeID *string `json:"volumeID,omitempty"` +} + +// VolumeSnapshotFilterApplyConfiguration constructs a declarative configuration of the VolumeSnapshotFilter type for use with +// apply. +func VolumeSnapshotFilter() *VolumeSnapshotFilterApplyConfiguration { + return &VolumeSnapshotFilterApplyConfiguration{} +} + +// WithName sets the Name field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Name field is set to the value of the last call. +func (b *VolumeSnapshotFilterApplyConfiguration) WithName(value apiv1alpha1.OpenStackName) *VolumeSnapshotFilterApplyConfiguration { + b.Name = &value + return b +} + +// WithStatus sets the Status field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Status field is set to the value of the last call. +func (b *VolumeSnapshotFilterApplyConfiguration) WithStatus(value string) *VolumeSnapshotFilterApplyConfiguration { + b.Status = &value + return b +} + +// WithVolumeID sets the VolumeID field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the VolumeID field is set to the value of the last call. +func (b *VolumeSnapshotFilterApplyConfiguration) WithVolumeID(value string) *VolumeSnapshotFilterApplyConfiguration { + b.VolumeID = &value + return b +} diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshotimport.go b/pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshotimport.go new file mode 100644 index 000000000..1eb2a3dda --- /dev/null +++ b/pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshotimport.go @@ -0,0 +1,48 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by applyconfiguration-gen. DO NOT EDIT. + +package v1alpha1 + +// VolumeSnapshotImportApplyConfiguration represents a declarative configuration of the VolumeSnapshotImport type for use +// with apply. +type VolumeSnapshotImportApplyConfiguration struct { + ID *string `json:"id,omitempty"` + Filter *VolumeSnapshotFilterApplyConfiguration `json:"filter,omitempty"` +} + +// VolumeSnapshotImportApplyConfiguration constructs a declarative configuration of the VolumeSnapshotImport type for use with +// apply. +func VolumeSnapshotImport() *VolumeSnapshotImportApplyConfiguration { + return &VolumeSnapshotImportApplyConfiguration{} +} + +// WithID sets the ID field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the ID field is set to the value of the last call. +func (b *VolumeSnapshotImportApplyConfiguration) WithID(value string) *VolumeSnapshotImportApplyConfiguration { + b.ID = &value + return b +} + +// WithFilter sets the Filter field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Filter field is set to the value of the last call. +func (b *VolumeSnapshotImportApplyConfiguration) WithFilter(value *VolumeSnapshotFilterApplyConfiguration) *VolumeSnapshotImportApplyConfiguration { + b.Filter = value + return b +} diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshotmetadata.go b/pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshotmetadata.go new file mode 100644 index 000000000..08e0bdb34 --- /dev/null +++ b/pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshotmetadata.go @@ -0,0 +1,48 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by applyconfiguration-gen. DO NOT EDIT. + +package v1alpha1 + +// VolumeSnapshotMetadataApplyConfiguration represents a declarative configuration of the VolumeSnapshotMetadata type for use +// with apply. +type VolumeSnapshotMetadataApplyConfiguration struct { + Name *string `json:"name,omitempty"` + Value *string `json:"value,omitempty"` +} + +// VolumeSnapshotMetadataApplyConfiguration constructs a declarative configuration of the VolumeSnapshotMetadata type for use with +// apply. +func VolumeSnapshotMetadata() *VolumeSnapshotMetadataApplyConfiguration { + return &VolumeSnapshotMetadataApplyConfiguration{} +} + +// WithName sets the Name field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Name field is set to the value of the last call. +func (b *VolumeSnapshotMetadataApplyConfiguration) WithName(value string) *VolumeSnapshotMetadataApplyConfiguration { + b.Name = &value + return b +} + +// WithValue sets the Value field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Value field is set to the value of the last call. +func (b *VolumeSnapshotMetadataApplyConfiguration) WithValue(value string) *VolumeSnapshotMetadataApplyConfiguration { + b.Value = &value + return b +} diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshotmetadatastatus.go b/pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshotmetadatastatus.go new file mode 100644 index 000000000..b260caade --- /dev/null +++ b/pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshotmetadatastatus.go @@ -0,0 +1,48 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by applyconfiguration-gen. DO NOT EDIT. + +package v1alpha1 + +// VolumeSnapshotMetadataStatusApplyConfiguration represents a declarative configuration of the VolumeSnapshotMetadataStatus type for use +// with apply. +type VolumeSnapshotMetadataStatusApplyConfiguration struct { + Name *string `json:"name,omitempty"` + Value *string `json:"value,omitempty"` +} + +// VolumeSnapshotMetadataStatusApplyConfiguration constructs a declarative configuration of the VolumeSnapshotMetadataStatus type for use with +// apply. +func VolumeSnapshotMetadataStatus() *VolumeSnapshotMetadataStatusApplyConfiguration { + return &VolumeSnapshotMetadataStatusApplyConfiguration{} +} + +// WithName sets the Name field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Name field is set to the value of the last call. +func (b *VolumeSnapshotMetadataStatusApplyConfiguration) WithName(value string) *VolumeSnapshotMetadataStatusApplyConfiguration { + b.Name = &value + return b +} + +// WithValue sets the Value field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Value field is set to the value of the last call. +func (b *VolumeSnapshotMetadataStatusApplyConfiguration) WithValue(value string) *VolumeSnapshotMetadataStatusApplyConfiguration { + b.Value = &value + return b +} diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshotresourcespec.go b/pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshotresourcespec.go new file mode 100644 index 000000000..bd7ca6a3d --- /dev/null +++ b/pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshotresourcespec.go @@ -0,0 +1,84 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by applyconfiguration-gen. DO NOT EDIT. + +package v1alpha1 + +import ( + apiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" +) + +// VolumeSnapshotResourceSpecApplyConfiguration represents a declarative configuration of the VolumeSnapshotResourceSpec type for use +// with apply. +type VolumeSnapshotResourceSpecApplyConfiguration struct { + Name *apiv1alpha1.OpenStackName `json:"name,omitempty"` + Description *string `json:"description,omitempty"` + VolumeRef *apiv1alpha1.KubernetesNameRef `json:"volumeRef,omitempty"` + Force *bool `json:"force,omitempty"` + Metadata []VolumeSnapshotMetadataApplyConfiguration `json:"metadata,omitempty"` +} + +// VolumeSnapshotResourceSpecApplyConfiguration constructs a declarative configuration of the VolumeSnapshotResourceSpec type for use with +// apply. +func VolumeSnapshotResourceSpec() *VolumeSnapshotResourceSpecApplyConfiguration { + return &VolumeSnapshotResourceSpecApplyConfiguration{} +} + +// WithName sets the Name field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Name field is set to the value of the last call. +func (b *VolumeSnapshotResourceSpecApplyConfiguration) WithName(value apiv1alpha1.OpenStackName) *VolumeSnapshotResourceSpecApplyConfiguration { + b.Name = &value + return b +} + +// WithDescription sets the Description field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Description field is set to the value of the last call. +func (b *VolumeSnapshotResourceSpecApplyConfiguration) WithDescription(value string) *VolumeSnapshotResourceSpecApplyConfiguration { + b.Description = &value + return b +} + +// WithVolumeRef sets the VolumeRef field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the VolumeRef field is set to the value of the last call. +func (b *VolumeSnapshotResourceSpecApplyConfiguration) WithVolumeRef(value apiv1alpha1.KubernetesNameRef) *VolumeSnapshotResourceSpecApplyConfiguration { + b.VolumeRef = &value + return b +} + +// WithForce sets the Force field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Force field is set to the value of the last call. +func (b *VolumeSnapshotResourceSpecApplyConfiguration) WithForce(value bool) *VolumeSnapshotResourceSpecApplyConfiguration { + b.Force = &value + return b +} + +// WithMetadata adds the given value to the Metadata field in the declarative configuration +// and returns the receiver, so that objects can be build by chaining "With" function invocations. +// If called multiple times, values provided by each call will be appended to the Metadata field. +func (b *VolumeSnapshotResourceSpecApplyConfiguration) WithMetadata(values ...*VolumeSnapshotMetadataApplyConfiguration) *VolumeSnapshotResourceSpecApplyConfiguration { + for i := range values { + if values[i] == nil { + panic("nil value passed to WithMetadata") + } + b.Metadata = append(b.Metadata, *values[i]) + } + return b +} diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshotresourcestatus.go b/pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshotresourcestatus.go new file mode 100644 index 000000000..a7693a783 --- /dev/null +++ b/pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshotresourcestatus.go @@ -0,0 +1,156 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by applyconfiguration-gen. DO NOT EDIT. + +package v1alpha1 + +import ( + v1 "k8s.io/apimachinery/pkg/apis/meta/v1" +) + +// VolumeSnapshotResourceStatusApplyConfiguration represents a declarative configuration of the VolumeSnapshotResourceStatus type for use +// with apply. +type VolumeSnapshotResourceStatusApplyConfiguration struct { + Name *string `json:"name,omitempty"` + Description *string `json:"description,omitempty"` + Status *string `json:"status,omitempty"` + Size *int32 `json:"size,omitempty"` + VolumeID *string `json:"volumeID,omitempty"` + Metadata []VolumeSnapshotMetadataStatusApplyConfiguration `json:"metadata,omitempty"` + Progress *string `json:"progress,omitempty"` + ProjectID *string `json:"projectID,omitempty"` + UserID *string `json:"userID,omitempty"` + GroupSnapshotID *string `json:"groupSnapshotID,omitempty"` + ConsumesQuota *bool `json:"consumesQuota,omitempty"` + CreatedAt *v1.Time `json:"createdAt,omitempty"` + UpdatedAt *v1.Time `json:"updatedAt,omitempty"` +} + +// VolumeSnapshotResourceStatusApplyConfiguration constructs a declarative configuration of the VolumeSnapshotResourceStatus type for use with +// apply. +func VolumeSnapshotResourceStatus() *VolumeSnapshotResourceStatusApplyConfiguration { + return &VolumeSnapshotResourceStatusApplyConfiguration{} +} + +// WithName sets the Name field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Name field is set to the value of the last call. +func (b *VolumeSnapshotResourceStatusApplyConfiguration) WithName(value string) *VolumeSnapshotResourceStatusApplyConfiguration { + b.Name = &value + return b +} + +// WithDescription sets the Description field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Description field is set to the value of the last call. +func (b *VolumeSnapshotResourceStatusApplyConfiguration) WithDescription(value string) *VolumeSnapshotResourceStatusApplyConfiguration { + b.Description = &value + return b +} + +// WithStatus sets the Status field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Status field is set to the value of the last call. +func (b *VolumeSnapshotResourceStatusApplyConfiguration) WithStatus(value string) *VolumeSnapshotResourceStatusApplyConfiguration { + b.Status = &value + return b +} + +// WithSize sets the Size field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Size field is set to the value of the last call. +func (b *VolumeSnapshotResourceStatusApplyConfiguration) WithSize(value int32) *VolumeSnapshotResourceStatusApplyConfiguration { + b.Size = &value + return b +} + +// WithVolumeID sets the VolumeID field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the VolumeID field is set to the value of the last call. +func (b *VolumeSnapshotResourceStatusApplyConfiguration) WithVolumeID(value string) *VolumeSnapshotResourceStatusApplyConfiguration { + b.VolumeID = &value + return b +} + +// WithMetadata adds the given value to the Metadata field in the declarative configuration +// and returns the receiver, so that objects can be build by chaining "With" function invocations. +// If called multiple times, values provided by each call will be appended to the Metadata field. +func (b *VolumeSnapshotResourceStatusApplyConfiguration) WithMetadata(values ...*VolumeSnapshotMetadataStatusApplyConfiguration) *VolumeSnapshotResourceStatusApplyConfiguration { + for i := range values { + if values[i] == nil { + panic("nil value passed to WithMetadata") + } + b.Metadata = append(b.Metadata, *values[i]) + } + return b +} + +// WithProgress sets the Progress field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Progress field is set to the value of the last call. +func (b *VolumeSnapshotResourceStatusApplyConfiguration) WithProgress(value string) *VolumeSnapshotResourceStatusApplyConfiguration { + b.Progress = &value + return b +} + +// WithProjectID sets the ProjectID field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the ProjectID field is set to the value of the last call. +func (b *VolumeSnapshotResourceStatusApplyConfiguration) WithProjectID(value string) *VolumeSnapshotResourceStatusApplyConfiguration { + b.ProjectID = &value + return b +} + +// WithUserID sets the UserID field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the UserID field is set to the value of the last call. +func (b *VolumeSnapshotResourceStatusApplyConfiguration) WithUserID(value string) *VolumeSnapshotResourceStatusApplyConfiguration { + b.UserID = &value + return b +} + +// WithGroupSnapshotID sets the GroupSnapshotID field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the GroupSnapshotID field is set to the value of the last call. +func (b *VolumeSnapshotResourceStatusApplyConfiguration) WithGroupSnapshotID(value string) *VolumeSnapshotResourceStatusApplyConfiguration { + b.GroupSnapshotID = &value + return b +} + +// WithConsumesQuota sets the ConsumesQuota field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the ConsumesQuota field is set to the value of the last call. +func (b *VolumeSnapshotResourceStatusApplyConfiguration) WithConsumesQuota(value bool) *VolumeSnapshotResourceStatusApplyConfiguration { + b.ConsumesQuota = &value + return b +} + +// WithCreatedAt sets the CreatedAt field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the CreatedAt field is set to the value of the last call. +func (b *VolumeSnapshotResourceStatusApplyConfiguration) WithCreatedAt(value v1.Time) *VolumeSnapshotResourceStatusApplyConfiguration { + b.CreatedAt = &value + return b +} + +// WithUpdatedAt sets the UpdatedAt field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the UpdatedAt field is set to the value of the last call. +func (b *VolumeSnapshotResourceStatusApplyConfiguration) WithUpdatedAt(value v1.Time) *VolumeSnapshotResourceStatusApplyConfiguration { + b.UpdatedAt = &value + return b +} diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshotspec.go b/pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshotspec.go new file mode 100644 index 000000000..5a69b59ed --- /dev/null +++ b/pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshotspec.go @@ -0,0 +1,79 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by applyconfiguration-gen. DO NOT EDIT. + +package v1alpha1 + +import ( + apiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" +) + +// VolumeSnapshotSpecApplyConfiguration represents a declarative configuration of the VolumeSnapshotSpec type for use +// with apply. +type VolumeSnapshotSpecApplyConfiguration struct { + Import *VolumeSnapshotImportApplyConfiguration `json:"import,omitempty"` + Resource *VolumeSnapshotResourceSpecApplyConfiguration `json:"resource,omitempty"` + ManagementPolicy *apiv1alpha1.ManagementPolicy `json:"managementPolicy,omitempty"` + ManagedOptions *ManagedOptionsApplyConfiguration `json:"managedOptions,omitempty"` + CloudCredentialsRef *CloudCredentialsReferenceApplyConfiguration `json:"cloudCredentialsRef,omitempty"` +} + +// VolumeSnapshotSpecApplyConfiguration constructs a declarative configuration of the VolumeSnapshotSpec type for use with +// apply. +func VolumeSnapshotSpec() *VolumeSnapshotSpecApplyConfiguration { + return &VolumeSnapshotSpecApplyConfiguration{} +} + +// WithImport sets the Import field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Import field is set to the value of the last call. +func (b *VolumeSnapshotSpecApplyConfiguration) WithImport(value *VolumeSnapshotImportApplyConfiguration) *VolumeSnapshotSpecApplyConfiguration { + b.Import = value + return b +} + +// WithResource sets the Resource field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Resource field is set to the value of the last call. +func (b *VolumeSnapshotSpecApplyConfiguration) WithResource(value *VolumeSnapshotResourceSpecApplyConfiguration) *VolumeSnapshotSpecApplyConfiguration { + b.Resource = value + return b +} + +// WithManagementPolicy sets the ManagementPolicy field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the ManagementPolicy field is set to the value of the last call. +func (b *VolumeSnapshotSpecApplyConfiguration) WithManagementPolicy(value apiv1alpha1.ManagementPolicy) *VolumeSnapshotSpecApplyConfiguration { + b.ManagementPolicy = &value + return b +} + +// WithManagedOptions sets the ManagedOptions field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the ManagedOptions field is set to the value of the last call. +func (b *VolumeSnapshotSpecApplyConfiguration) WithManagedOptions(value *ManagedOptionsApplyConfiguration) *VolumeSnapshotSpecApplyConfiguration { + b.ManagedOptions = value + return b +} + +// WithCloudCredentialsRef sets the CloudCredentialsRef field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the CloudCredentialsRef field is set to the value of the last call. +func (b *VolumeSnapshotSpecApplyConfiguration) WithCloudCredentialsRef(value *CloudCredentialsReferenceApplyConfiguration) *VolumeSnapshotSpecApplyConfiguration { + b.CloudCredentialsRef = value + return b +} diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshotstatus.go b/pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshotstatus.go new file mode 100644 index 000000000..5b383ad5e --- /dev/null +++ b/pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshotstatus.go @@ -0,0 +1,66 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by applyconfiguration-gen. DO NOT EDIT. + +package v1alpha1 + +import ( + v1 "k8s.io/client-go/applyconfigurations/meta/v1" +) + +// VolumeSnapshotStatusApplyConfiguration represents a declarative configuration of the VolumeSnapshotStatus type for use +// with apply. +type VolumeSnapshotStatusApplyConfiguration struct { + Conditions []v1.ConditionApplyConfiguration `json:"conditions,omitempty"` + ID *string `json:"id,omitempty"` + Resource *VolumeSnapshotResourceStatusApplyConfiguration `json:"resource,omitempty"` +} + +// VolumeSnapshotStatusApplyConfiguration constructs a declarative configuration of the VolumeSnapshotStatus type for use with +// apply. +func VolumeSnapshotStatus() *VolumeSnapshotStatusApplyConfiguration { + return &VolumeSnapshotStatusApplyConfiguration{} +} + +// WithConditions adds the given value to the Conditions field in the declarative configuration +// and returns the receiver, so that objects can be build by chaining "With" function invocations. +// If called multiple times, values provided by each call will be appended to the Conditions field. +func (b *VolumeSnapshotStatusApplyConfiguration) WithConditions(values ...*v1.ConditionApplyConfiguration) *VolumeSnapshotStatusApplyConfiguration { + for i := range values { + if values[i] == nil { + panic("nil value passed to WithConditions") + } + b.Conditions = append(b.Conditions, *values[i]) + } + return b +} + +// WithID sets the ID field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the ID field is set to the value of the last call. +func (b *VolumeSnapshotStatusApplyConfiguration) WithID(value string) *VolumeSnapshotStatusApplyConfiguration { + b.ID = &value + return b +} + +// WithResource sets the Resource field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Resource field is set to the value of the last call. +func (b *VolumeSnapshotStatusApplyConfiguration) WithResource(value *VolumeSnapshotResourceStatusApplyConfiguration) *VolumeSnapshotStatusApplyConfiguration { + b.Resource = value + return b +} diff --git a/pkg/clients/applyconfiguration/internal/internal.go b/pkg/clients/applyconfiguration/internal/internal.go index 7a30ca985..227bec87b 100644 --- a/pkg/clients/applyconfiguration/internal/internal.go +++ b/pkg/clients/applyconfiguration/internal/internal.go @@ -3666,6 +3666,170 @@ var schemaYAML = typed.YAMLObject(`types: - name: volumeType type: scalar: string +- name: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.VolumeSnapshot + map: + fields: + - name: apiVersion + type: + scalar: string + - name: kind + type: + scalar: string + - name: metadata + type: + namedType: io.k8s.apimachinery.pkg.apis.meta.v1.ObjectMeta + default: {} + - name: spec + type: + namedType: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.VolumeSnapshotSpec + default: {} + - name: status + type: + namedType: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.VolumeSnapshotStatus + default: {} +- name: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.VolumeSnapshotFilter + map: + fields: + - name: name + type: + scalar: string + - name: status + type: + scalar: string + - name: volumeID + type: + scalar: string +- name: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.VolumeSnapshotImport + map: + fields: + - name: filter + type: + namedType: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.VolumeSnapshotFilter + - name: id + type: + scalar: string +- name: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.VolumeSnapshotMetadata + map: + fields: + - name: name + type: + scalar: string + default: "" + - name: value + type: + scalar: string + default: "" +- name: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.VolumeSnapshotMetadataStatus + map: + fields: + - name: name + type: + scalar: string + - name: value + type: + scalar: string +- name: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.VolumeSnapshotResourceSpec + map: + fields: + - name: description + type: + scalar: string + - name: force + type: + scalar: boolean + - name: metadata + type: + list: + elementType: + namedType: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.VolumeSnapshotMetadata + elementRelationship: atomic + - name: name + type: + scalar: string + - name: volumeRef + type: + scalar: string +- name: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.VolumeSnapshotResourceStatus + map: + fields: + - name: consumesQuota + type: + scalar: boolean + - name: createdAt + type: + namedType: io.k8s.apimachinery.pkg.apis.meta.v1.Time + - name: description + type: + scalar: string + - name: groupSnapshotID + type: + scalar: string + - name: metadata + type: + list: + elementType: + namedType: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.VolumeSnapshotMetadataStatus + elementRelationship: atomic + - name: name + type: + scalar: string + - name: progress + type: + scalar: string + - name: projectID + type: + scalar: string + - name: size + type: + scalar: numeric + - name: status + type: + scalar: string + - name: updatedAt + type: + namedType: io.k8s.apimachinery.pkg.apis.meta.v1.Time + - name: userID + type: + scalar: string + - name: volumeID + type: + scalar: string +- name: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.VolumeSnapshotSpec + map: + fields: + - name: cloudCredentialsRef + type: + namedType: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.CloudCredentialsReference + default: {} + - name: import + type: + namedType: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.VolumeSnapshotImport + - name: managedOptions + type: + namedType: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.ManagedOptions + - name: managementPolicy + type: + scalar: string + - name: resource + type: + namedType: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.VolumeSnapshotResourceSpec +- name: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.VolumeSnapshotStatus + map: + fields: + - name: conditions + type: + list: + elementType: + namedType: io.k8s.apimachinery.pkg.apis.meta.v1.Condition + elementRelationship: associative + keys: + - type + - name: id + type: + scalar: string + - name: resource + type: + namedType: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.VolumeSnapshotResourceStatus - name: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.VolumeSpec map: fields: diff --git a/pkg/clients/applyconfiguration/utils.go b/pkg/clients/applyconfiguration/utils.go index bb76ee624..d827e0b77 100644 --- a/pkg/clients/applyconfiguration/utils.go +++ b/pkg/clients/applyconfiguration/utils.go @@ -420,6 +420,24 @@ func ForKind(kind schema.GroupVersionKind) interface{} { return &apiv1alpha1.VolumeResourceSpecApplyConfiguration{} case v1alpha1.SchemeGroupVersion.WithKind("VolumeResourceStatus"): return &apiv1alpha1.VolumeResourceStatusApplyConfiguration{} + case v1alpha1.SchemeGroupVersion.WithKind("VolumeSnapshot"): + return &apiv1alpha1.VolumeSnapshotApplyConfiguration{} + case v1alpha1.SchemeGroupVersion.WithKind("VolumeSnapshotFilter"): + return &apiv1alpha1.VolumeSnapshotFilterApplyConfiguration{} + case v1alpha1.SchemeGroupVersion.WithKind("VolumeSnapshotImport"): + return &apiv1alpha1.VolumeSnapshotImportApplyConfiguration{} + case v1alpha1.SchemeGroupVersion.WithKind("VolumeSnapshotMetadata"): + return &apiv1alpha1.VolumeSnapshotMetadataApplyConfiguration{} + case v1alpha1.SchemeGroupVersion.WithKind("VolumeSnapshotMetadataStatus"): + return &apiv1alpha1.VolumeSnapshotMetadataStatusApplyConfiguration{} + case v1alpha1.SchemeGroupVersion.WithKind("VolumeSnapshotResourceSpec"): + return &apiv1alpha1.VolumeSnapshotResourceSpecApplyConfiguration{} + case v1alpha1.SchemeGroupVersion.WithKind("VolumeSnapshotResourceStatus"): + return &apiv1alpha1.VolumeSnapshotResourceStatusApplyConfiguration{} + case v1alpha1.SchemeGroupVersion.WithKind("VolumeSnapshotSpec"): + return &apiv1alpha1.VolumeSnapshotSpecApplyConfiguration{} + case v1alpha1.SchemeGroupVersion.WithKind("VolumeSnapshotStatus"): + return &apiv1alpha1.VolumeSnapshotStatusApplyConfiguration{} case v1alpha1.SchemeGroupVersion.WithKind("VolumeSpec"): return &apiv1alpha1.VolumeSpecApplyConfiguration{} case v1alpha1.SchemeGroupVersion.WithKind("VolumeStatus"): diff --git a/pkg/clients/clientset/clientset/typed/api/v1alpha1/api_client.go b/pkg/clients/clientset/clientset/typed/api/v1alpha1/api_client.go index 78e698815..da138d40a 100644 --- a/pkg/clients/clientset/clientset/typed/api/v1alpha1/api_client.go +++ b/pkg/clients/clientset/clientset/typed/api/v1alpha1/api_client.go @@ -50,6 +50,7 @@ type OpenstackV1alpha1Interface interface { TrunksGetter UsersGetter VolumesGetter + VolumeSnapshotsGetter VolumeTypesGetter } @@ -146,6 +147,10 @@ func (c *OpenstackV1alpha1Client) Volumes(namespace string) VolumeInterface { return newVolumes(c, namespace) } +func (c *OpenstackV1alpha1Client) VolumeSnapshots(namespace string) VolumeSnapshotInterface { + return newVolumeSnapshots(c, namespace) +} + func (c *OpenstackV1alpha1Client) VolumeTypes(namespace string) VolumeTypeInterface { return newVolumeTypes(c, namespace) } diff --git a/pkg/clients/clientset/clientset/typed/api/v1alpha1/fake/fake_api_client.go b/pkg/clients/clientset/clientset/typed/api/v1alpha1/fake/fake_api_client.go index 4f4334818..34e51ddc7 100644 --- a/pkg/clients/clientset/clientset/typed/api/v1alpha1/fake/fake_api_client.go +++ b/pkg/clients/clientset/clientset/typed/api/v1alpha1/fake/fake_api_client.go @@ -116,6 +116,10 @@ func (c *FakeOpenstackV1alpha1) Volumes(namespace string) v1alpha1.VolumeInterfa return newFakeVolumes(c, namespace) } +func (c *FakeOpenstackV1alpha1) VolumeSnapshots(namespace string) v1alpha1.VolumeSnapshotInterface { + return newFakeVolumeSnapshots(c, namespace) +} + func (c *FakeOpenstackV1alpha1) VolumeTypes(namespace string) v1alpha1.VolumeTypeInterface { return newFakeVolumeTypes(c, namespace) } diff --git a/pkg/clients/clientset/clientset/typed/api/v1alpha1/fake/fake_volumesnapshot.go b/pkg/clients/clientset/clientset/typed/api/v1alpha1/fake/fake_volumesnapshot.go new file mode 100644 index 000000000..0c7e4ca8a --- /dev/null +++ b/pkg/clients/clientset/clientset/typed/api/v1alpha1/fake/fake_volumesnapshot.go @@ -0,0 +1,53 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by client-gen. DO NOT EDIT. + +package fake + +import ( + v1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + apiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/pkg/clients/applyconfiguration/api/v1alpha1" + typedapiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/pkg/clients/clientset/clientset/typed/api/v1alpha1" + gentype "k8s.io/client-go/gentype" +) + +// fakeVolumeSnapshots implements VolumeSnapshotInterface +type fakeVolumeSnapshots struct { + *gentype.FakeClientWithListAndApply[*v1alpha1.VolumeSnapshot, *v1alpha1.VolumeSnapshotList, *apiv1alpha1.VolumeSnapshotApplyConfiguration] + Fake *FakeOpenstackV1alpha1 +} + +func newFakeVolumeSnapshots(fake *FakeOpenstackV1alpha1, namespace string) typedapiv1alpha1.VolumeSnapshotInterface { + return &fakeVolumeSnapshots{ + gentype.NewFakeClientWithListAndApply[*v1alpha1.VolumeSnapshot, *v1alpha1.VolumeSnapshotList, *apiv1alpha1.VolumeSnapshotApplyConfiguration]( + fake.Fake, + namespace, + v1alpha1.SchemeGroupVersion.WithResource("volumesnapshots"), + v1alpha1.SchemeGroupVersion.WithKind("VolumeSnapshot"), + func() *v1alpha1.VolumeSnapshot { return &v1alpha1.VolumeSnapshot{} }, + func() *v1alpha1.VolumeSnapshotList { return &v1alpha1.VolumeSnapshotList{} }, + func(dst, src *v1alpha1.VolumeSnapshotList) { dst.ListMeta = src.ListMeta }, + func(list *v1alpha1.VolumeSnapshotList) []*v1alpha1.VolumeSnapshot { + return gentype.ToPointerSlice(list.Items) + }, + func(list *v1alpha1.VolumeSnapshotList, items []*v1alpha1.VolumeSnapshot) { + list.Items = gentype.FromPointerSlice(items) + }, + ), + fake, + } +} diff --git a/pkg/clients/clientset/clientset/typed/api/v1alpha1/generated_expansion.go b/pkg/clients/clientset/clientset/typed/api/v1alpha1/generated_expansion.go index fa80c4303..f7a729059 100644 --- a/pkg/clients/clientset/clientset/typed/api/v1alpha1/generated_expansion.go +++ b/pkg/clients/clientset/clientset/typed/api/v1alpha1/generated_expansion.go @@ -62,4 +62,6 @@ type UserExpansion interface{} type VolumeExpansion interface{} +type VolumeSnapshotExpansion interface{} + type VolumeTypeExpansion interface{} diff --git a/pkg/clients/clientset/clientset/typed/api/v1alpha1/volumesnapshot.go b/pkg/clients/clientset/clientset/typed/api/v1alpha1/volumesnapshot.go new file mode 100644 index 000000000..126631064 --- /dev/null +++ b/pkg/clients/clientset/clientset/typed/api/v1alpha1/volumesnapshot.go @@ -0,0 +1,74 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by client-gen. DO NOT EDIT. + +package v1alpha1 + +import ( + context "context" + + apiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + applyconfigurationapiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/pkg/clients/applyconfiguration/api/v1alpha1" + scheme "github.com/k-orc/openstack-resource-controller/v2/pkg/clients/clientset/clientset/scheme" + v1 "k8s.io/apimachinery/pkg/apis/meta/v1" + types "k8s.io/apimachinery/pkg/types" + watch "k8s.io/apimachinery/pkg/watch" + gentype "k8s.io/client-go/gentype" +) + +// VolumeSnapshotsGetter has a method to return a VolumeSnapshotInterface. +// A group's client should implement this interface. +type VolumeSnapshotsGetter interface { + VolumeSnapshots(namespace string) VolumeSnapshotInterface +} + +// VolumeSnapshotInterface has methods to work with VolumeSnapshot resources. +type VolumeSnapshotInterface interface { + Create(ctx context.Context, volumeSnapshot *apiv1alpha1.VolumeSnapshot, opts v1.CreateOptions) (*apiv1alpha1.VolumeSnapshot, error) + Update(ctx context.Context, volumeSnapshot *apiv1alpha1.VolumeSnapshot, opts v1.UpdateOptions) (*apiv1alpha1.VolumeSnapshot, error) + // Add a +genclient:noStatus comment above the type to avoid generating UpdateStatus(). + UpdateStatus(ctx context.Context, volumeSnapshot *apiv1alpha1.VolumeSnapshot, opts v1.UpdateOptions) (*apiv1alpha1.VolumeSnapshot, error) + Delete(ctx context.Context, name string, opts v1.DeleteOptions) error + DeleteCollection(ctx context.Context, opts v1.DeleteOptions, listOpts v1.ListOptions) error + Get(ctx context.Context, name string, opts v1.GetOptions) (*apiv1alpha1.VolumeSnapshot, error) + List(ctx context.Context, opts v1.ListOptions) (*apiv1alpha1.VolumeSnapshotList, error) + Watch(ctx context.Context, opts v1.ListOptions) (watch.Interface, error) + Patch(ctx context.Context, name string, pt types.PatchType, data []byte, opts v1.PatchOptions, subresources ...string) (result *apiv1alpha1.VolumeSnapshot, err error) + Apply(ctx context.Context, volumeSnapshot *applyconfigurationapiv1alpha1.VolumeSnapshotApplyConfiguration, opts v1.ApplyOptions) (result *apiv1alpha1.VolumeSnapshot, err error) + // Add a +genclient:noStatus comment above the type to avoid generating ApplyStatus(). + ApplyStatus(ctx context.Context, volumeSnapshot *applyconfigurationapiv1alpha1.VolumeSnapshotApplyConfiguration, opts v1.ApplyOptions) (result *apiv1alpha1.VolumeSnapshot, err error) + VolumeSnapshotExpansion +} + +// volumeSnapshots implements VolumeSnapshotInterface +type volumeSnapshots struct { + *gentype.ClientWithListAndApply[*apiv1alpha1.VolumeSnapshot, *apiv1alpha1.VolumeSnapshotList, *applyconfigurationapiv1alpha1.VolumeSnapshotApplyConfiguration] +} + +// newVolumeSnapshots returns a VolumeSnapshots +func newVolumeSnapshots(c *OpenstackV1alpha1Client, namespace string) *volumeSnapshots { + return &volumeSnapshots{ + gentype.NewClientWithListAndApply[*apiv1alpha1.VolumeSnapshot, *apiv1alpha1.VolumeSnapshotList, *applyconfigurationapiv1alpha1.VolumeSnapshotApplyConfiguration]( + "volumesnapshots", + c.RESTClient(), + scheme.ParameterCodec, + namespace, + func() *apiv1alpha1.VolumeSnapshot { return &apiv1alpha1.VolumeSnapshot{} }, + func() *apiv1alpha1.VolumeSnapshotList { return &apiv1alpha1.VolumeSnapshotList{} }, + ), + } +} diff --git a/pkg/clients/informers/externalversions/api/v1alpha1/interface.go b/pkg/clients/informers/externalversions/api/v1alpha1/interface.go index 13fa48405..fe3a1968b 100644 --- a/pkg/clients/informers/externalversions/api/v1alpha1/interface.go +++ b/pkg/clients/informers/externalversions/api/v1alpha1/interface.go @@ -68,6 +68,8 @@ type Interface interface { Users() UserInformer // Volumes returns a VolumeInformer. Volumes() VolumeInformer + // VolumeSnapshots returns a VolumeSnapshotInformer. + VolumeSnapshots() VolumeSnapshotInformer // VolumeTypes returns a VolumeTypeInformer. VolumeTypes() VolumeTypeInformer } @@ -193,6 +195,11 @@ func (v *version) Volumes() VolumeInformer { return &volumeInformer{factory: v.factory, namespace: v.namespace, tweakListOptions: v.tweakListOptions} } +// VolumeSnapshots returns a VolumeSnapshotInformer. +func (v *version) VolumeSnapshots() VolumeSnapshotInformer { + return &volumeSnapshotInformer{factory: v.factory, namespace: v.namespace, tweakListOptions: v.tweakListOptions} +} + // VolumeTypes returns a VolumeTypeInformer. func (v *version) VolumeTypes() VolumeTypeInformer { return &volumeTypeInformer{factory: v.factory, namespace: v.namespace, tweakListOptions: v.tweakListOptions} diff --git a/pkg/clients/informers/externalversions/api/v1alpha1/volumesnapshot.go b/pkg/clients/informers/externalversions/api/v1alpha1/volumesnapshot.go new file mode 100644 index 000000000..31117ac65 --- /dev/null +++ b/pkg/clients/informers/externalversions/api/v1alpha1/volumesnapshot.go @@ -0,0 +1,102 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by informer-gen. DO NOT EDIT. + +package v1alpha1 + +import ( + context "context" + time "time" + + v2apiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + clientset "github.com/k-orc/openstack-resource-controller/v2/pkg/clients/clientset/clientset" + internalinterfaces "github.com/k-orc/openstack-resource-controller/v2/pkg/clients/informers/externalversions/internalinterfaces" + apiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/pkg/clients/listers/api/v1alpha1" + v1 "k8s.io/apimachinery/pkg/apis/meta/v1" + runtime "k8s.io/apimachinery/pkg/runtime" + watch "k8s.io/apimachinery/pkg/watch" + cache "k8s.io/client-go/tools/cache" +) + +// VolumeSnapshotInformer provides access to a shared informer and lister for +// VolumeSnapshots. +type VolumeSnapshotInformer interface { + Informer() cache.SharedIndexInformer + Lister() apiv1alpha1.VolumeSnapshotLister +} + +type volumeSnapshotInformer struct { + factory internalinterfaces.SharedInformerFactory + tweakListOptions internalinterfaces.TweakListOptionsFunc + namespace string +} + +// NewVolumeSnapshotInformer constructs a new informer for VolumeSnapshot type. +// Always prefer using an informer factory to get a shared informer instead of getting an independent +// one. This reduces memory footprint and number of connections to the server. +func NewVolumeSnapshotInformer(client clientset.Interface, namespace string, resyncPeriod time.Duration, indexers cache.Indexers) cache.SharedIndexInformer { + return NewFilteredVolumeSnapshotInformer(client, namespace, resyncPeriod, indexers, nil) +} + +// NewFilteredVolumeSnapshotInformer constructs a new informer for VolumeSnapshot type. +// Always prefer using an informer factory to get a shared informer instead of getting an independent +// one. This reduces memory footprint and number of connections to the server. +func NewFilteredVolumeSnapshotInformer(client clientset.Interface, namespace string, resyncPeriod time.Duration, indexers cache.Indexers, tweakListOptions internalinterfaces.TweakListOptionsFunc) cache.SharedIndexInformer { + return cache.NewSharedIndexInformer( + &cache.ListWatch{ + ListFunc: func(options v1.ListOptions) (runtime.Object, error) { + if tweakListOptions != nil { + tweakListOptions(&options) + } + return client.OpenstackV1alpha1().VolumeSnapshots(namespace).List(context.Background(), options) + }, + WatchFunc: func(options v1.ListOptions) (watch.Interface, error) { + if tweakListOptions != nil { + tweakListOptions(&options) + } + return client.OpenstackV1alpha1().VolumeSnapshots(namespace).Watch(context.Background(), options) + }, + ListWithContextFunc: func(ctx context.Context, options v1.ListOptions) (runtime.Object, error) { + if tweakListOptions != nil { + tweakListOptions(&options) + } + return client.OpenstackV1alpha1().VolumeSnapshots(namespace).List(ctx, options) + }, + WatchFuncWithContext: func(ctx context.Context, options v1.ListOptions) (watch.Interface, error) { + if tweakListOptions != nil { + tweakListOptions(&options) + } + return client.OpenstackV1alpha1().VolumeSnapshots(namespace).Watch(ctx, options) + }, + }, + &v2apiv1alpha1.VolumeSnapshot{}, + resyncPeriod, + indexers, + ) +} + +func (f *volumeSnapshotInformer) defaultInformer(client clientset.Interface, resyncPeriod time.Duration) cache.SharedIndexInformer { + return NewFilteredVolumeSnapshotInformer(client, f.namespace, resyncPeriod, cache.Indexers{cache.NamespaceIndex: cache.MetaNamespaceIndexFunc}, f.tweakListOptions) +} + +func (f *volumeSnapshotInformer) Informer() cache.SharedIndexInformer { + return f.factory.InformerFor(&v2apiv1alpha1.VolumeSnapshot{}, f.defaultInformer) +} + +func (f *volumeSnapshotInformer) Lister() apiv1alpha1.VolumeSnapshotLister { + return apiv1alpha1.NewVolumeSnapshotLister(f.Informer().GetIndexer()) +} diff --git a/pkg/clients/informers/externalversions/generic.go b/pkg/clients/informers/externalversions/generic.go index 40c16cf12..cdbc16f49 100644 --- a/pkg/clients/informers/externalversions/generic.go +++ b/pkg/clients/informers/externalversions/generic.go @@ -97,6 +97,8 @@ func (f *sharedInformerFactory) ForResource(resource schema.GroupVersionResource return &genericInformer{resource: resource.GroupResource(), informer: f.Openstack().V1alpha1().Users().Informer()}, nil case v1alpha1.SchemeGroupVersion.WithResource("volumes"): return &genericInformer{resource: resource.GroupResource(), informer: f.Openstack().V1alpha1().Volumes().Informer()}, nil + case v1alpha1.SchemeGroupVersion.WithResource("volumesnapshots"): + return &genericInformer{resource: resource.GroupResource(), informer: f.Openstack().V1alpha1().VolumeSnapshots().Informer()}, nil case v1alpha1.SchemeGroupVersion.WithResource("volumetypes"): return &genericInformer{resource: resource.GroupResource(), informer: f.Openstack().V1alpha1().VolumeTypes().Informer()}, nil diff --git a/pkg/clients/listers/api/v1alpha1/expansion_generated.go b/pkg/clients/listers/api/v1alpha1/expansion_generated.go index 5328b091b..bfd8a6cf9 100644 --- a/pkg/clients/listers/api/v1alpha1/expansion_generated.go +++ b/pkg/clients/listers/api/v1alpha1/expansion_generated.go @@ -194,6 +194,14 @@ type VolumeListerExpansion interface{} // VolumeNamespaceLister. type VolumeNamespaceListerExpansion interface{} +// VolumeSnapshotListerExpansion allows custom methods to be added to +// VolumeSnapshotLister. +type VolumeSnapshotListerExpansion interface{} + +// VolumeSnapshotNamespaceListerExpansion allows custom methods to be added to +// VolumeSnapshotNamespaceLister. +type VolumeSnapshotNamespaceListerExpansion interface{} + // VolumeTypeListerExpansion allows custom methods to be added to // VolumeTypeLister. type VolumeTypeListerExpansion interface{} diff --git a/pkg/clients/listers/api/v1alpha1/volumesnapshot.go b/pkg/clients/listers/api/v1alpha1/volumesnapshot.go new file mode 100644 index 000000000..a0e7bdc51 --- /dev/null +++ b/pkg/clients/listers/api/v1alpha1/volumesnapshot.go @@ -0,0 +1,70 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by lister-gen. DO NOT EDIT. + +package v1alpha1 + +import ( + apiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + labels "k8s.io/apimachinery/pkg/labels" + listers "k8s.io/client-go/listers" + cache "k8s.io/client-go/tools/cache" +) + +// VolumeSnapshotLister helps list VolumeSnapshots. +// All objects returned here must be treated as read-only. +type VolumeSnapshotLister interface { + // List lists all VolumeSnapshots in the indexer. + // Objects returned here must be treated as read-only. + List(selector labels.Selector) (ret []*apiv1alpha1.VolumeSnapshot, err error) + // VolumeSnapshots returns an object that can list and get VolumeSnapshots. + VolumeSnapshots(namespace string) VolumeSnapshotNamespaceLister + VolumeSnapshotListerExpansion +} + +// volumeSnapshotLister implements the VolumeSnapshotLister interface. +type volumeSnapshotLister struct { + listers.ResourceIndexer[*apiv1alpha1.VolumeSnapshot] +} + +// NewVolumeSnapshotLister returns a new VolumeSnapshotLister. +func NewVolumeSnapshotLister(indexer cache.Indexer) VolumeSnapshotLister { + return &volumeSnapshotLister{listers.New[*apiv1alpha1.VolumeSnapshot](indexer, apiv1alpha1.Resource("volumesnapshot"))} +} + +// VolumeSnapshots returns an object that can list and get VolumeSnapshots. +func (s *volumeSnapshotLister) VolumeSnapshots(namespace string) VolumeSnapshotNamespaceLister { + return volumeSnapshotNamespaceLister{listers.NewNamespaced[*apiv1alpha1.VolumeSnapshot](s.ResourceIndexer, namespace)} +} + +// VolumeSnapshotNamespaceLister helps list and get VolumeSnapshots. +// All objects returned here must be treated as read-only. +type VolumeSnapshotNamespaceLister interface { + // List lists all VolumeSnapshots in the indexer for a given namespace. + // Objects returned here must be treated as read-only. + List(selector labels.Selector) (ret []*apiv1alpha1.VolumeSnapshot, err error) + // Get retrieves the VolumeSnapshot from the indexer for a given namespace and name. + // Objects returned here must be treated as read-only. + Get(name string) (*apiv1alpha1.VolumeSnapshot, error) + VolumeSnapshotNamespaceListerExpansion +} + +// volumeSnapshotNamespaceLister implements the VolumeSnapshotNamespaceLister +// interface. +type volumeSnapshotNamespaceLister struct { + listers.ResourceIndexer[*apiv1alpha1.VolumeSnapshot] +} diff --git a/website/docs/crd-reference.md b/website/docs/crd-reference.md index 645c9cd3f..697cba209 100644 --- a/website/docs/crd-reference.md +++ b/website/docs/crd-reference.md @@ -32,6 +32,7 @@ Package v1alpha1 contains API Schema definitions for the openstack v1alpha1 API - [Trunk](#trunk) - [User](#user) - [Volume](#volume) +- [VolumeSnapshot](#volumesnapshot) - [VolumeType](#volumetype) @@ -322,6 +323,7 @@ _Appears in:_ - [SubnetSpec](#subnetspec) - [TrunkSpec](#trunkspec) - [UserSpec](#userspec) +- [VolumeSnapshotSpec](#volumesnapshotspec) - [VolumeSpec](#volumespec) - [VolumeTypeSpec](#volumetypespec) @@ -1948,6 +1950,7 @@ _Appears in:_ - [UserFilter](#userfilter) - [UserResourceSpec](#userresourcespec) - [VolumeResourceSpec](#volumeresourcespec) +- [VolumeSnapshotResourceSpec](#volumesnapshotresourcespec) @@ -2010,6 +2013,7 @@ _Appears in:_ - [SubnetSpec](#subnetspec) - [TrunkSpec](#trunkspec) - [UserSpec](#userspec) +- [VolumeSnapshotSpec](#volumesnapshotspec) - [VolumeSpec](#volumespec) - [VolumeTypeSpec](#volumetypespec) @@ -2048,6 +2052,7 @@ _Appears in:_ - [SubnetSpec](#subnetspec) - [TrunkSpec](#trunkspec) - [UserSpec](#userspec) +- [VolumeSnapshotSpec](#volumesnapshotspec) - [VolumeSpec](#volumespec) - [VolumeTypeSpec](#volumetypespec) @@ -2360,6 +2365,8 @@ _Appears in:_ - [UserResourceSpec](#userresourcespec) - [VolumeFilter](#volumefilter) - [VolumeResourceSpec](#volumeresourcespec) +- [VolumeSnapshotFilter](#volumesnapshotfilter) +- [VolumeSnapshotResourceSpec](#volumesnapshotresourcespec) - [VolumeTypeFilter](#volumetypefilter) - [VolumeTypeResourceSpec](#volumetyperesourcespec) @@ -4675,6 +4682,184 @@ _Appears in:_ | `updatedAt` _[Time](https://kubernetes.io/docs/reference/generated/kubernetes-api/v1.29/#time-v1-meta)_ | updatedAt shows the date and time when the resource was updated. The date and time stamp format is ISO 8601 | | Optional: \{\}
| +#### VolumeSnapshot + + + +VolumeSnapshot is the Schema for an ORC resource. + + + + + +| Field | Description | Default | Validation | +| --- | --- | --- | --- | +| `apiVersion` _string_ | `openstack.k-orc.cloud/v1alpha1` | | | +| `kind` _string_ | `VolumeSnapshot` | | | +| `metadata` _[ObjectMeta](https://kubernetes.io/docs/reference/generated/kubernetes-api/v1.29/#objectmeta-v1-meta)_ | Refer to Kubernetes API documentation for fields of `metadata`. | | | +| `spec` _[VolumeSnapshotSpec](#volumesnapshotspec)_ | spec specifies the desired state of the resource. | | | +| `status` _[VolumeSnapshotStatus](#volumesnapshotstatus)_ | status defines the observed state of the resource. | | | + + +#### VolumeSnapshotFilter + + + +VolumeSnapshotFilter defines an existing resource by its properties + +_Validation:_ +- MinProperties: 1 + +_Appears in:_ +- [VolumeSnapshotImport](#volumesnapshotimport) + +| Field | Description | Default | Validation | +| --- | --- | --- | --- | +| `name` _[OpenStackName](#openstackname)_ | name of the existing resource | | MaxLength: 255
MinLength: 1
Pattern: `^[^,]+$`
| +| `status` _string_ | status of the existing resource | | MaxLength: 255
MinLength: 1
| +| `volumeID` _string_ | volumeID is the ID of the volume the snapshot was created from | | MaxLength: 255
MinLength: 1
| + + +#### VolumeSnapshotImport + + + +VolumeSnapshotImport specifies an existing resource which will be imported instead of +creating a new one + +_Validation:_ +- MaxProperties: 1 +- MinProperties: 1 + +_Appears in:_ +- [VolumeSnapshotSpec](#volumesnapshotspec) + +| Field | Description | Default | Validation | +| --- | --- | --- | --- | +| `id` _string_ | id contains the unique identifier of an existing OpenStack resource. Note
that when specifying an import by ID, the resource MUST already exist.
The ORC object will enter an error state if the resource does not exist. | | Format: uuid
MaxLength: 36
| +| `filter` _[VolumeSnapshotFilter](#volumesnapshotfilter)_ | filter contains a resource query which is expected to return a single
result. The controller will continue to retry if filter returns no
results. If filter returns multiple results the controller will set an
error state and will not continue to retry. | | MinProperties: 1
| + + +#### VolumeSnapshotMetadata + + + + + + + +_Appears in:_ +- [VolumeSnapshotResourceSpec](#volumesnapshotresourcespec) + +| Field | Description | Default | Validation | +| --- | --- | --- | --- | +| `name` _string_ | name is the name of the metadata | | MaxLength: 255
| +| `value` _string_ | value is the value of the metadata | | MaxLength: 255
| + + +#### VolumeSnapshotMetadataStatus + + + + + + + +_Appears in:_ +- [VolumeSnapshotResourceStatus](#volumesnapshotresourcestatus) + +| Field | Description | Default | Validation | +| --- | --- | --- | --- | +| `name` _string_ | name is the name of the metadata | | MaxLength: 255
| +| `value` _string_ | value is the value of the metadata | | MaxLength: 255
| + + +#### VolumeSnapshotResourceSpec + + + +VolumeSnapshotResourceSpec contains the desired state of the resource. + + + +_Appears in:_ +- [VolumeSnapshotSpec](#volumesnapshotspec) + +| Field | Description | Default | Validation | +| --- | --- | --- | --- | +| `name` _[OpenStackName](#openstackname)_ | name will be the name of the created resource. If not specified, the
name of the ORC object will be used. | | MaxLength: 255
MinLength: 1
Pattern: `^[^,]+$`
| +| `description` _string_ | description is a human-readable description for the resource. | | MaxLength: 255
MinLength: 1
| +| `volumeRef` _[KubernetesNameRef](#kubernetesnameref)_ | volumeRef is a reference to the ORC Volume to create a snapshot from. | | MaxLength: 253
MinLength: 1
| +| `force` _boolean_ | force allows creating a snapshot even if the volume is attached. | | | +| `metadata` _[VolumeSnapshotMetadata](#volumesnapshotmetadata) array_ | Refer to Kubernetes API documentation for fields of `metadata`. | | MaxItems: 64
| + + +#### VolumeSnapshotResourceStatus + + + +VolumeSnapshotResourceStatus represents the observed state of the resource. + + + +_Appears in:_ +- [VolumeSnapshotStatus](#volumesnapshotstatus) + +| Field | Description | Default | Validation | +| --- | --- | --- | --- | +| `name` _string_ | name is a human-readable name for the resource. Might not be unique. | | MaxLength: 1024
| +| `description` _string_ | description is a human-readable description for the resource. | | MaxLength: 1024
| +| `status` _string_ | status represents the current status of the snapshot. | | MaxLength: 1024
| +| `size` _integer_ | size is the size of the snapshot in GiB. | | | +| `volumeID` _string_ | volumeID is the ID of the volume the snapshot was created from. | | MaxLength: 1024
| +| `metadata` _[VolumeSnapshotMetadataStatus](#volumesnapshotmetadatastatus) array_ | Refer to Kubernetes API documentation for fields of `metadata`. | | MaxItems: 64
| +| `progress` _string_ | progress is the percentage of completion of the snapshot creation. | | MaxLength: 1024
| +| `projectID` _string_ | projectID is the ID of the project that owns the snapshot. | | MaxLength: 1024
| +| `userID` _string_ | userID is the ID of the user who created the snapshot. | | MaxLength: 1024
| +| `groupSnapshotID` _string_ | groupSnapshotID is the ID of the group snapshot, if applicable. | | MaxLength: 1024
| +| `consumesQuota` _boolean_ | consumesQuota indicates whether the snapshot consumes quota. | | | +| `createdAt` _[Time](https://kubernetes.io/docs/reference/generated/kubernetes-api/v1.29/#time-v1-meta)_ | createdAt shows the date and time when the resource was created. The date and time stamp format is ISO 8601. | | | +| `updatedAt` _[Time](https://kubernetes.io/docs/reference/generated/kubernetes-api/v1.29/#time-v1-meta)_ | updatedAt shows the date and time when the resource was updated. The date and time stamp format is ISO 8601. | | | + + +#### VolumeSnapshotSpec + + + +VolumeSnapshotSpec defines the desired state of an ORC object. + + + +_Appears in:_ +- [VolumeSnapshot](#volumesnapshot) + +| Field | Description | Default | Validation | +| --- | --- | --- | --- | +| `import` _[VolumeSnapshotImport](#volumesnapshotimport)_ | import refers to an existing OpenStack resource which will be imported instead of
creating a new one. | | MaxProperties: 1
MinProperties: 1
| +| `resource` _[VolumeSnapshotResourceSpec](#volumesnapshotresourcespec)_ | resource specifies the desired state of the resource.
resource may not be specified if the management policy is `unmanaged`.
resource must be specified if the management policy is `managed`. | | | +| `managementPolicy` _[ManagementPolicy](#managementpolicy)_ | managementPolicy defines how ORC will treat the object. Valid values are
`managed`: ORC will create, update, and delete the resource; `unmanaged`:
ORC will import an existing resource, and will not apply updates to it or
delete it. | managed | Enum: [managed unmanaged]
| +| `managedOptions` _[ManagedOptions](#managedoptions)_ | managedOptions specifies options which may be applied to managed objects. | | | +| `cloudCredentialsRef` _[CloudCredentialsReference](#cloudcredentialsreference)_ | cloudCredentialsRef points to a secret containing OpenStack credentials | | | + + +#### VolumeSnapshotStatus + + + +VolumeSnapshotStatus defines the observed state of an ORC resource. + + + +_Appears in:_ +- [VolumeSnapshot](#volumesnapshot) + +| Field | Description | Default | Validation | +| --- | --- | --- | --- | +| `conditions` _[Condition](https://kubernetes.io/docs/reference/generated/kubernetes-api/v1.29/#condition-v1-meta) array_ | conditions represents the observed status of the object.
Known .status.conditions.type are: "Available", "Progressing"
Available represents the availability of the OpenStack resource. If it is
true then the resource is ready for use.
Progressing indicates whether the controller is still attempting to
reconcile the current state of the OpenStack resource to the desired
state. Progressing will be False either because the desired state has
been achieved, or because some terminal error prevents it from ever being
achieved and the controller is no longer attempting to reconcile. If
Progressing is True, an observer waiting on the resource should continue
to wait. | | MaxItems: 32
| +| `id` _string_ | id is the unique identifier of the OpenStack resource. | | MaxLength: 1024
| +| `resource` _[VolumeSnapshotResourceStatus](#volumesnapshotresourcestatus)_ | resource contains the observed state of the OpenStack resource. | | | + + #### VolumeSpec From ce37b4d8d706e9b0936f8937bf2091cdece2f17f Mon Sep 17 00:00:00 2001 From: Mohammed Al-Dokimi Date: Sat, 21 Feb 2026 03:20:51 +0000 Subject: [PATCH 8/9] Add descrioption to filter --- api/v1alpha1/volumesnapshot_types.go | 6 ++++++ api/v1alpha1/zz_generated.deepcopy.go | 5 +++++ cmd/models-schema/zz_generated.openapi.go | 7 +++++++ .../openstack.k-orc.cloud_volumesnapshots.yaml | 5 +++++ internal/controllers/volumesnapshot/actuator.go | 10 +++++++++- .../00-create-resources.yaml | 2 -- .../01-import-resource.yaml | 2 +- .../api/v1alpha1/volumesnapshotfilter.go | 15 ++++++++++++--- .../applyconfiguration/internal/internal.go | 3 +++ website/docs/crd-reference.md | 1 + 10 files changed, 49 insertions(+), 7 deletions(-) diff --git a/api/v1alpha1/volumesnapshot_types.go b/api/v1alpha1/volumesnapshot_types.go index 486698bb4..7ba93c356 100644 --- a/api/v1alpha1/volumesnapshot_types.go +++ b/api/v1alpha1/volumesnapshot_types.go @@ -56,6 +56,12 @@ type VolumeSnapshotFilter struct { // +optional Name *OpenStackName `json:"name,omitempty"` + // description of the existing resource + // +kubebuilder:validation:MinLength:=1 + // +kubebuilder:validation:MaxLength:=255 + // +optional + Description *string `json:"description,omitempty"` + // status of the existing resource // +kubebuilder:validation:MinLength:=1 // +kubebuilder:validation:MaxLength:=255 diff --git a/api/v1alpha1/zz_generated.deepcopy.go b/api/v1alpha1/zz_generated.deepcopy.go index 0c0a14311..53cbcf9b0 100644 --- a/api/v1alpha1/zz_generated.deepcopy.go +++ b/api/v1alpha1/zz_generated.deepcopy.go @@ -6322,6 +6322,11 @@ func (in *VolumeSnapshotFilter) DeepCopyInto(out *VolumeSnapshotFilter) { *out = new(OpenStackName) **out = **in } + if in.Description != nil { + in, out := &in.Description, &out.Description + *out = new(string) + **out = **in + } if in.Status != nil { in, out := &in.Status, &out.Status *out = new(string) diff --git a/cmd/models-schema/zz_generated.openapi.go b/cmd/models-schema/zz_generated.openapi.go index 78533fc7d..ccf41fdc6 100644 --- a/cmd/models-schema/zz_generated.openapi.go +++ b/cmd/models-schema/zz_generated.openapi.go @@ -12202,6 +12202,13 @@ func schema_openstack_resource_controller_v2_api_v1alpha1_VolumeSnapshotFilter(r Format: "", }, }, + "description": { + SchemaProps: spec.SchemaProps{ + Description: "description of the existing resource", + Type: []string{"string"}, + Format: "", + }, + }, "status": { SchemaProps: spec.SchemaProps{ Description: "status of the existing resource", diff --git a/config/crd/bases/openstack.k-orc.cloud_volumesnapshots.yaml b/config/crd/bases/openstack.k-orc.cloud_volumesnapshots.yaml index 9d8109023..cde26d20f 100644 --- a/config/crd/bases/openstack.k-orc.cloud_volumesnapshots.yaml +++ b/config/crd/bases/openstack.k-orc.cloud_volumesnapshots.yaml @@ -91,6 +91,11 @@ spec: error state and will not continue to retry. minProperties: 1 properties: + description: + description: description of the existing resource + maxLength: 255 + minLength: 1 + type: string name: description: name of the existing resource maxLength: 255 diff --git a/internal/controllers/volumesnapshot/actuator.go b/internal/controllers/volumesnapshot/actuator.go index 3aae26f16..41f66f0be 100644 --- a/internal/controllers/volumesnapshot/actuator.go +++ b/internal/controllers/volumesnapshot/actuator.go @@ -92,13 +92,21 @@ func (actuator volumesnapshotActuator) ListOSResourcesForAdoption(ctx context.Co } func (actuator volumesnapshotActuator) ListOSResourcesForImport(ctx context.Context, obj orcObjectPT, filter filterT) (iter.Seq2[*osResourceT, error], progress.ReconcileStatus) { + var filters []osclients.ResourceFilter[osResourceT] + + if filter.Description != nil { + filters = append(filters, func(s *snapshots.Snapshot) bool { + return s.Description == *filter.Description + }) + } + listOpts := snapshots.ListOpts{ Name: string(ptr.Deref(filter.Name, "")), Status: ptr.Deref(filter.Status, ""), VolumeID: ptr.Deref(filter.VolumeID, ""), } - return actuator.osClient.ListVolumeSnapshots(ctx, listOpts), nil + return actuator.listOSResources(ctx, filters, listOpts), nil } func (actuator volumesnapshotActuator) listOSResources(ctx context.Context, filters []osclients.ResourceFilter[osResourceT], listOpts snapshots.ListOptsBuilder) iter.Seq2[*snapshots.Snapshot, error] { diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/00-create-resources.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/00-create-resources.yaml index e624cc438..f467f0357 100644 --- a/internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/00-create-resources.yaml +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/00-create-resources.yaml @@ -21,7 +21,6 @@ spec: secretName: openstack-clouds managementPolicy: managed resource: - name: volumesnapshot-import-error-external description: VolumeSnapshot from "import error" test volumeRef: volumesnapshot-import-error --- @@ -35,6 +34,5 @@ spec: secretName: openstack-clouds managementPolicy: managed resource: - name: volumesnapshot-import-error-external description: VolumeSnapshot from "import error" test volumeRef: volumesnapshot-import-error diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/01-import-resource.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/01-import-resource.yaml index bb29378ba..9cade4b31 100644 --- a/internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/01-import-resource.yaml +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/01-import-resource.yaml @@ -10,4 +10,4 @@ spec: managementPolicy: unmanaged import: filter: - name: volumesnapshot-import-error-external + description: VolumeSnapshot from "import error" test diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshotfilter.go b/pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshotfilter.go index 19aa9bde0..f66a9beb3 100644 --- a/pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshotfilter.go +++ b/pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshotfilter.go @@ -25,9 +25,10 @@ import ( // VolumeSnapshotFilterApplyConfiguration represents a declarative configuration of the VolumeSnapshotFilter type for use // with apply. type VolumeSnapshotFilterApplyConfiguration struct { - Name *apiv1alpha1.OpenStackName `json:"name,omitempty"` - Status *string `json:"status,omitempty"` - VolumeID *string `json:"volumeID,omitempty"` + Name *apiv1alpha1.OpenStackName `json:"name,omitempty"` + Description *string `json:"description,omitempty"` + Status *string `json:"status,omitempty"` + VolumeID *string `json:"volumeID,omitempty"` } // VolumeSnapshotFilterApplyConfiguration constructs a declarative configuration of the VolumeSnapshotFilter type for use with @@ -44,6 +45,14 @@ func (b *VolumeSnapshotFilterApplyConfiguration) WithName(value apiv1alpha1.Open return b } +// WithDescription sets the Description field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Description field is set to the value of the last call. +func (b *VolumeSnapshotFilterApplyConfiguration) WithDescription(value string) *VolumeSnapshotFilterApplyConfiguration { + b.Description = &value + return b +} + // WithStatus sets the Status field in the declarative configuration to the given value // and returns the receiver, so that objects can be built by chaining "With" function invocations. // If called multiple times, the Status field is set to the value of the last call. diff --git a/pkg/clients/applyconfiguration/internal/internal.go b/pkg/clients/applyconfiguration/internal/internal.go index 227bec87b..0cce46be7 100644 --- a/pkg/clients/applyconfiguration/internal/internal.go +++ b/pkg/clients/applyconfiguration/internal/internal.go @@ -3690,6 +3690,9 @@ var schemaYAML = typed.YAMLObject(`types: - name: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.VolumeSnapshotFilter map: fields: + - name: description + type: + scalar: string - name: name type: scalar: string diff --git a/website/docs/crd-reference.md b/website/docs/crd-reference.md index 697cba209..dc4209abe 100644 --- a/website/docs/crd-reference.md +++ b/website/docs/crd-reference.md @@ -4716,6 +4716,7 @@ _Appears in:_ | Field | Description | Default | Validation | | --- | --- | --- | --- | | `name` _[OpenStackName](#openstackname)_ | name of the existing resource | | MaxLength: 255
MinLength: 1
Pattern: `^[^,]+$`
| +| `description` _string_ | description of the existing resource | | MaxLength: 255
MinLength: 1
| | `status` _string_ | status of the existing resource | | MaxLength: 255
MinLength: 1
| | `volumeID` _string_ | volumeID is the ID of the volume the snapshot was created from | | MaxLength: 255
MinLength: 1
| From 9a0001ab5f83c8fc8fa0e770239c74c8892fbcbe Mon Sep 17 00:00:00 2001 From: Mohammed Al-Dokimi Date: Sat, 11 Apr 2026 21:52:10 +0000 Subject: [PATCH 9/9] Fix bugs + CI issues --- .gitignore | 1 + api/v1alpha1/volumesnapshot_types.go | 6 +- api/v1alpha1/zz_generated.deepcopy.go | 6 +- cmd/models-schema/zz_generated.openapi.go | 4 +- ...openstack.k-orc.cloud_volumesnapshots.yaml | 10 +- .../controllers/volumesnapshot/actuator.go | 30 ++- .../volumesnapshot/actuator_test.go | 234 +++++++++++++++++- internal/controllers/volumesnapshot/status.go | 29 ++- .../controllers/volumesnapshot/status_test.go | 111 +++++++++ .../01-import-resource.yaml | 1 + .../volumesnapshot-import/00-assert.yaml | 2 - .../00-import-resource.yaml | 13 + .../volumesnapshot-import/01-assert.yaml | 2 - .../02-create-resource.yaml | 12 - .../api/v1alpha1/volumesnapshotfilter.go | 16 +- .../applyconfiguration/internal/internal.go | 2 +- website/docs/crd-reference.md | 79 +++--- 17 files changed, 469 insertions(+), 89 deletions(-) create mode 100644 internal/controllers/volumesnapshot/status_test.go diff --git a/.gitignore b/.gitignore index e859277d7..e184ea058 100644 --- a/.gitignore +++ b/.gitignore @@ -33,6 +33,7 @@ __pycache__/ /openapi.json /.custom-deploy /.custom-gcl.yml +.cursor/ # kuttl generates a kubeconfig /kubeconfig diff --git a/api/v1alpha1/volumesnapshot_types.go b/api/v1alpha1/volumesnapshot_types.go index 7ba93c356..37509d7d1 100644 --- a/api/v1alpha1/volumesnapshot_types.go +++ b/api/v1alpha1/volumesnapshot_types.go @@ -68,11 +68,9 @@ type VolumeSnapshotFilter struct { // +optional Status *string `json:"status,omitempty"` - // volumeID is the ID of the volume the snapshot was created from - // +kubebuilder:validation:MinLength:=1 - // +kubebuilder:validation:MaxLength:=255 + // volumeRef references the ORC Volume used to filter snapshots by source volume. // +optional - VolumeID *string `json:"volumeID,omitempty"` + VolumeRef *KubernetesNameRef `json:"volumeRef,omitempty"` } // VolumeSnapshotResourceStatus represents the observed state of the resource. diff --git a/api/v1alpha1/zz_generated.deepcopy.go b/api/v1alpha1/zz_generated.deepcopy.go index 53cbcf9b0..7d4cc3455 100644 --- a/api/v1alpha1/zz_generated.deepcopy.go +++ b/api/v1alpha1/zz_generated.deepcopy.go @@ -6332,9 +6332,9 @@ func (in *VolumeSnapshotFilter) DeepCopyInto(out *VolumeSnapshotFilter) { *out = new(string) **out = **in } - if in.VolumeID != nil { - in, out := &in.VolumeID, &out.VolumeID - *out = new(string) + if in.VolumeRef != nil { + in, out := &in.VolumeRef, &out.VolumeRef + *out = new(KubernetesNameRef) **out = **in } } diff --git a/cmd/models-schema/zz_generated.openapi.go b/cmd/models-schema/zz_generated.openapi.go index ccf41fdc6..94881b770 100644 --- a/cmd/models-schema/zz_generated.openapi.go +++ b/cmd/models-schema/zz_generated.openapi.go @@ -12216,9 +12216,9 @@ func schema_openstack_resource_controller_v2_api_v1alpha1_VolumeSnapshotFilter(r Format: "", }, }, - "volumeID": { + "volumeRef": { SchemaProps: spec.SchemaProps{ - Description: "volumeID is the ID of the volume the snapshot was created from", + Description: "volumeRef references the ORC Volume used to filter snapshots by source volume.", Type: []string{"string"}, Format: "", }, diff --git a/config/crd/bases/openstack.k-orc.cloud_volumesnapshots.yaml b/config/crd/bases/openstack.k-orc.cloud_volumesnapshots.yaml index cde26d20f..975d25e31 100644 --- a/config/crd/bases/openstack.k-orc.cloud_volumesnapshots.yaml +++ b/config/crd/bases/openstack.k-orc.cloud_volumesnapshots.yaml @@ -3,7 +3,7 @@ apiVersion: apiextensions.k8s.io/v1 kind: CustomResourceDefinition metadata: annotations: - controller-gen.kubebuilder.io/version: v0.17.1 + controller-gen.kubebuilder.io/version: v0.20.1 name: volumesnapshots.openstack.k-orc.cloud spec: group: openstack.k-orc.cloud @@ -107,10 +107,10 @@ spec: maxLength: 255 minLength: 1 type: string - volumeID: - description: volumeID is the ID of the volume the snapshot - was created from - maxLength: 255 + volumeRef: + description: volumeRef references the ORC Volume used to filter + snapshots by source volume. + maxLength: 253 minLength: 1 type: string type: object diff --git a/internal/controllers/volumesnapshot/actuator.go b/internal/controllers/volumesnapshot/actuator.go index 41f66f0be..b051c2512 100644 --- a/internal/controllers/volumesnapshot/actuator.go +++ b/internal/controllers/volumesnapshot/actuator.go @@ -23,6 +23,8 @@ import ( "github.com/gophercloud/gophercloud/v2/openstack/blockstorage/v3/snapshots" corev1 "k8s.io/api/core/v1" + apierrors "k8s.io/apimachinery/pkg/api/errors" + "k8s.io/apimachinery/pkg/types" "k8s.io/utils/ptr" ctrl "sigs.k8s.io/controller-runtime" "sigs.k8s.io/controller-runtime/pkg/client" @@ -100,15 +102,41 @@ func (actuator volumesnapshotActuator) ListOSResourcesForImport(ctx context.Cont }) } + volumeID, reconcileStatus := actuator.getVolumeIDForImport(ctx, obj, filter) + if needsReschedule, _ := reconcileStatus.NeedsReschedule(); needsReschedule { + return nil, reconcileStatus + } + listOpts := snapshots.ListOpts{ Name: string(ptr.Deref(filter.Name, "")), Status: ptr.Deref(filter.Status, ""), - VolumeID: ptr.Deref(filter.VolumeID, ""), + VolumeID: volumeID, } return actuator.listOSResources(ctx, filters, listOpts), nil } +func (actuator volumesnapshotActuator) getVolumeIDForImport(ctx context.Context, obj orcObjectPT, filter filterT) (string, progress.ReconcileStatus) { + if filter.VolumeRef == nil { + return "", nil + } + + volumeName := string(*filter.VolumeRef) + volume := &orcv1alpha1.Volume{} + if err := actuator.k8sClient.Get(ctx, types.NamespacedName{Name: volumeName, Namespace: obj.GetNamespace()}, volume); err != nil { + if apierrors.IsNotFound(err) { + return "", progress.WaitingOnObject("Volume", volumeName, progress.WaitingOnCreation) + } + return "", progress.WrapError(err) + } + + if !orcv1alpha1.IsAvailable(volume) || volume.Status.ID == nil || *volume.Status.ID == "" { + return "", progress.WaitingOnObject("Volume", volumeName, progress.WaitingOnReady) + } + + return *volume.Status.ID, nil +} + func (actuator volumesnapshotActuator) listOSResources(ctx context.Context, filters []osclients.ResourceFilter[osResourceT], listOpts snapshots.ListOptsBuilder) iter.Seq2[*snapshots.Snapshot, error] { results := actuator.osClient.ListVolumeSnapshots(ctx, listOpts) return osclients.Filter(results, filters...) diff --git a/internal/controllers/volumesnapshot/actuator_test.go b/internal/controllers/volumesnapshot/actuator_test.go index 1465c7c89..f425041d1 100644 --- a/internal/controllers/volumesnapshot/actuator_test.go +++ b/internal/controllers/volumesnapshot/actuator_test.go @@ -17,13 +17,60 @@ limitations under the License. package volumesnapshot import ( + "context" + "errors" + "iter" + "strings" "testing" "github.com/gophercloud/gophercloud/v2/openstack/blockstorage/v3/snapshots" - orcv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + v1 "k8s.io/apimachinery/pkg/apis/meta/v1" + "k8s.io/apimachinery/pkg/runtime" "k8s.io/utils/ptr" + "sigs.k8s.io/controller-runtime/pkg/client/fake" + + orcv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" ) +var errNotImplemented = errors.New("not implemented") + +type testVolumeSnapshotClient struct { + listOpts snapshots.ListOptsBuilder + listCalled bool +} + +func (c *testVolumeSnapshotClient) ListVolumeSnapshots(_ context.Context, listOpts snapshots.ListOptsBuilder) iter.Seq2[*snapshots.Snapshot, error] { + c.listCalled = true + c.listOpts = listOpts + return func(yield func(*snapshots.Snapshot, error) bool) {} +} + +func (c *testVolumeSnapshotClient) CreateVolumeSnapshot(_ context.Context, _ snapshots.CreateOptsBuilder) (*snapshots.Snapshot, error) { + return nil, errNotImplemented +} + +func (c *testVolumeSnapshotClient) DeleteVolumeSnapshot(_ context.Context, _ string) error { + return errNotImplemented +} + +func (c *testVolumeSnapshotClient) GetVolumeSnapshot(_ context.Context, _ string) (*snapshots.Snapshot, error) { + return nil, errNotImplemented +} + +func (c *testVolumeSnapshotClient) UpdateVolumeSnapshot(_ context.Context, _ string, _ snapshots.UpdateOptsBuilder) (*snapshots.Snapshot, error) { + return nil, errNotImplemented +} + +func newTestScheme(t *testing.T) *runtime.Scheme { + t.Helper() + + scheme := runtime.NewScheme() + if err := orcv1alpha1.AddToScheme(scheme); err != nil { + t.Fatalf("failed adding API scheme: %v", err) + } + return scheme +} + func TestNeedsUpdate(t *testing.T) { testCases := []struct { name string @@ -44,7 +91,10 @@ func TestNeedsUpdate(t *testing.T) { for _, tt := range testCases { t.Run(tt.name, func(t *testing.T) { - got, _ := needsUpdate(tt.updateOpts) + got, err := needsUpdate(tt.updateOpts) + if err != nil { + t.Fatalf("Expected no error, got: %v", err) + } if got != tt.expectChange { t.Errorf("Expected change: %v, got: %v", tt.expectChange, got) } @@ -78,7 +128,10 @@ func TestHandleNameUpdate(t *testing.T) { updateOpts := snapshots.UpdateOpts{} handleNameUpdate(&updateOpts, resource, osResource) - got, _ := needsUpdate(updateOpts) + got, err := needsUpdate(updateOpts) + if err != nil { + t.Fatalf("Expected no error, got: %v", err) + } if got != tt.expectChange { t.Errorf("Expected change: %v, got: %v", tt.expectChange, got) } @@ -109,7 +162,10 @@ func TestHandleDescriptionUpdate(t *testing.T) { updateOpts := snapshots.UpdateOpts{} handleDescriptionUpdate(&updateOpts, resource, osResource) - got, _ := needsUpdate(updateOpts) + got, err := needsUpdate(updateOpts) + if err != nil { + t.Fatalf("Expected no error, got: %v", err) + } if got != tt.expectChange { t.Errorf("Expected change: %v, got: %v", tt.expectChange, got) } @@ -117,3 +173,173 @@ func TestHandleDescriptionUpdate(t *testing.T) { } } + +func TestGetVolumeIDForImport(t *testing.T) { + ctx := context.Background() + namespace := "default" + volumeRef := orcv1alpha1.KubernetesNameRef("import-volume") + orcObject := &orcv1alpha1.VolumeSnapshot{ + ObjectMeta: v1.ObjectMeta{ + Name: "import-snapshot", + Namespace: namespace, + }, + } + + t.Run("waits for missing volume", func(t *testing.T) { + actuator := volumesnapshotActuator{ + k8sClient: fake.NewClientBuilder(). + WithScheme(newTestScheme(t)). + Build(), + } + + volumeID, reconcileStatus := actuator.getVolumeIDForImport(ctx, orcObject, orcv1alpha1.VolumeSnapshotFilter{ + VolumeRef: &volumeRef, + }) + if volumeID != "" { + t.Fatalf("expected empty volume ID, got %q", volumeID) + } + if reconcileStatus == nil { + t.Fatalf("expected reconcile status, got nil") + } + needsReschedule, err := reconcileStatus.NeedsReschedule() + if err != nil { + t.Fatalf("expected no error, got %v", err) + } + if !needsReschedule { + t.Fatalf("expected reconcile status to require reschedule") + } + if !strings.Contains(strings.Join(reconcileStatus.GetProgressMessages(), "\n"), "Waiting for Volume/import-volume to be created") { + t.Fatalf("expected waiting for volume creation message, got %v", reconcileStatus.GetProgressMessages()) + } + }) + + t.Run("waits for not-ready volume", func(t *testing.T) { + volume := &orcv1alpha1.Volume{ + ObjectMeta: v1.ObjectMeta{ + Name: "import-volume", + Namespace: namespace, + }, + } + + actuator := volumesnapshotActuator{ + k8sClient: fake.NewClientBuilder(). + WithScheme(newTestScheme(t)). + WithObjects(volume). + Build(), + } + + volumeID, reconcileStatus := actuator.getVolumeIDForImport(ctx, orcObject, orcv1alpha1.VolumeSnapshotFilter{ + VolumeRef: &volumeRef, + }) + if volumeID != "" { + t.Fatalf("expected empty volume ID, got %q", volumeID) + } + if reconcileStatus == nil { + t.Fatalf("expected reconcile status, got nil") + } + needsReschedule, err := reconcileStatus.NeedsReschedule() + if err != nil { + t.Fatalf("expected no error, got %v", err) + } + if !needsReschedule { + t.Fatalf("expected reconcile status to require reschedule") + } + if !strings.Contains(strings.Join(reconcileStatus.GetProgressMessages(), "\n"), "Waiting for Volume/import-volume to be ready") { + t.Fatalf("expected waiting for volume ready message, got %v", reconcileStatus.GetProgressMessages()) + } + }) + + t.Run("returns volume ID when volume is ready", func(t *testing.T) { + volume := &orcv1alpha1.Volume{ + ObjectMeta: v1.ObjectMeta{ + Name: "import-volume", + Namespace: namespace, + }, + Status: orcv1alpha1.VolumeStatus{ + ID: ptr.To("volume-id"), + Conditions: []v1.Condition{ + { + Type: orcv1alpha1.ConditionAvailable, + Status: v1.ConditionTrue, + }, + }, + }, + } + + actuator := volumesnapshotActuator{ + k8sClient: fake.NewClientBuilder(). + WithScheme(newTestScheme(t)). + WithObjects(volume). + Build(), + } + + volumeID, reconcileStatus := actuator.getVolumeIDForImport(ctx, orcObject, orcv1alpha1.VolumeSnapshotFilter{ + VolumeRef: &volumeRef, + }) + if reconcileStatus != nil { + t.Fatalf("expected nil reconcile status, got %v", reconcileStatus) + } + if volumeID != "volume-id" { + t.Fatalf("expected volume-id, got %q", volumeID) + } + }) +} + +func TestListOSResourcesForImport_ResolvesVolumeRefToVolumeID(t *testing.T) { + ctx := context.Background() + namespace := "default" + volumeRef := orcv1alpha1.KubernetesNameRef("import-volume") + + volume := &orcv1alpha1.Volume{ + ObjectMeta: v1.ObjectMeta{ + Name: "import-volume", + Namespace: namespace, + }, + Status: orcv1alpha1.VolumeStatus{ + ID: ptr.To("volume-id"), + Conditions: []v1.Condition{ + { + Type: orcv1alpha1.ConditionAvailable, + Status: v1.ConditionTrue, + }, + }, + }, + } + + osClient := &testVolumeSnapshotClient{} + actuator := volumesnapshotActuator{ + osClient: osClient, + k8sClient: fake.NewClientBuilder(). + WithScheme(newTestScheme(t)). + WithObjects(volume). + Build(), + } + + orcObject := &orcv1alpha1.VolumeSnapshot{ + ObjectMeta: v1.ObjectMeta{ + Name: "import-snapshot", + Namespace: namespace, + }, + } + + filter := orcv1alpha1.VolumeSnapshotFilter{ + Name: ptr.To(orcv1alpha1.OpenStackName("snapshot-name")), + VolumeRef: &volumeRef, + } + + _, reconcileStatus := actuator.ListOSResourcesForImport(ctx, orcObject, filter) + if reconcileStatus != nil { + t.Fatalf("expected nil reconcile status, got %v", reconcileStatus) + } + if !osClient.listCalled { + t.Fatalf("expected ListVolumeSnapshots to be called") + } + + listOpts, ok := osClient.listOpts.(snapshots.ListOpts) + if !ok { + t.Fatalf("expected snapshots.ListOpts, got %T", osClient.listOpts) + } + if listOpts.VolumeID != "volume-id" { + t.Fatalf("expected ListOpts.VolumeID to be volume-id, got %q", listOpts.VolumeID) + } +} diff --git a/internal/controllers/volumesnapshot/status.go b/internal/controllers/volumesnapshot/status.go index f82b04732..e1b950efb 100644 --- a/internal/controllers/volumesnapshot/status.go +++ b/internal/controllers/volumesnapshot/status.go @@ -17,18 +17,22 @@ limitations under the License. package volumesnapshot import ( + "sort" + "github.com/go-logr/logr" metav1 "k8s.io/apimachinery/pkg/apis/meta/v1" orcv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/generic/interfaces" "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/generic/progress" + orcerrors "github.com/k-orc/openstack-resource-controller/v2/internal/util/errors" orcapplyconfigv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/pkg/clients/applyconfiguration/api/v1alpha1" ) const ( SnapshotStatusAvailable = "available" SnapshotStatusDeleting = "deleting" + SnapshotStatusError = "error" ) type volumesnapshotStatusWriter struct{} @@ -53,6 +57,14 @@ func (volumesnapshotStatusWriter) ResourceAvailableStatus(orcObject *orcv1alpha1 if osResource.Status == SnapshotStatusAvailable { return metav1.ConditionTrue, nil } + if osResource.Status == SnapshotStatusError { + return metav1.ConditionFalse, progress.WrapError( + orcerrors.Terminal( + orcv1alpha1.ConditionReasonUnrecoverableError, + "OpenStack volume snapshot is in error state", + ), + ) + } // Otherwise we should continue to poll return metav1.ConditionFalse, progress.WaitingOnOpenStack(progress.WaitingOnReady, volumesnapshotAvailablePollingPeriod) @@ -64,7 +76,11 @@ func (volumesnapshotStatusWriter) ApplyResourceStatus(log logr.Logger, osResourc WithVolumeID(osResource.VolumeID). WithStatus(osResource.Status). WithSize(int32(osResource.Size)). - WithCreatedAt(metav1.NewTime(osResource.CreatedAt)) + WithConsumesQuota(osResource.ConsumesQuota) + + if !osResource.CreatedAt.IsZero() { + resourceStatus.WithCreatedAt(metav1.NewTime(osResource.CreatedAt)) + } if !osResource.UpdatedAt.IsZero() { resourceStatus.WithUpdatedAt(metav1.NewTime(osResource.UpdatedAt)) @@ -90,14 +106,15 @@ func (volumesnapshotStatusWriter) ApplyResourceStatus(log logr.Logger, osResourc resourceStatus.WithGroupSnapshotID(osResource.GroupSnapshotID) } - if osResource.ConsumesQuota { - resourceStatus.WithConsumesQuota(osResource.ConsumesQuota) + metadataKeys := make([]string, 0, len(osResource.Metadata)) + for k := range osResource.Metadata { + metadataKeys = append(metadataKeys, k) } - - for k, v := range osResource.Metadata { + sort.Strings(metadataKeys) + for _, k := range metadataKeys { resourceStatus.WithMetadata(orcapplyconfigv1alpha1.VolumeSnapshotMetadataStatus(). WithName(k). - WithValue(v)) + WithValue(osResource.Metadata[k])) } statusApply.WithResource(resourceStatus) diff --git a/internal/controllers/volumesnapshot/status_test.go b/internal/controllers/volumesnapshot/status_test.go new file mode 100644 index 000000000..e4ce04238 --- /dev/null +++ b/internal/controllers/volumesnapshot/status_test.go @@ -0,0 +1,111 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package volumesnapshot + +import ( + "errors" + "testing" + + "github.com/go-logr/logr" + orcv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + orcerrors "github.com/k-orc/openstack-resource-controller/v2/internal/util/errors" + orcapplyconfigv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/pkg/clients/applyconfiguration/api/v1alpha1" + metav1 "k8s.io/apimachinery/pkg/apis/meta/v1" +) + +func TestApplyResourceStatus_ConsumesQuotaFalseIsPreserved(t *testing.T) { + writer := volumesnapshotStatusWriter{} + statusApply := orcapplyconfigv1alpha1.VolumeSnapshotStatus() + + writer.ApplyResourceStatus(logr.Discard(), &osResourceT{ + Name: "snapshot-1", + VolumeID: "volume-1", + Status: SnapshotStatusAvailable, + Size: 1, + ConsumesQuota: false, + }, statusApply) + + if statusApply.Resource == nil { + t.Fatalf("expected status resource to be set") + } + if statusApply.Resource.ConsumesQuota == nil { + t.Fatalf("expected consumesQuota to be present, got nil") + } + if *statusApply.Resource.ConsumesQuota { + t.Fatalf("expected consumesQuota=false, got true") + } +} + +func TestApplyResourceStatus_MetadataOrderIsDeterministic(t *testing.T) { + writer := volumesnapshotStatusWriter{} + statusApply := orcapplyconfigv1alpha1.VolumeSnapshotStatus() + + writer.ApplyResourceStatus(logr.Discard(), &osResourceT{ + Name: "snapshot-1", + VolumeID: "volume-1", + Status: SnapshotStatusAvailable, + Size: 1, + Metadata: map[string]string{ + "z-key": "z-value", + "a-key": "a-value", + }, + }, statusApply) + + if statusApply.Resource == nil { + t.Fatalf("expected status resource to be set") + } + if len(statusApply.Resource.Metadata) != 2 { + t.Fatalf("expected 2 metadata items, got %d", len(statusApply.Resource.Metadata)) + } + + firstName := statusApply.Resource.Metadata[0].Name + secondName := statusApply.Resource.Metadata[1].Name + if firstName == nil || secondName == nil { + t.Fatalf("expected metadata names to be set") + } + if *firstName != "a-key" || *secondName != "z-key" { + t.Fatalf("expected metadata sorted by key, got %q then %q", *firstName, *secondName) + } +} + +func TestResourceAvailableStatus_ErrorIsTerminal(t *testing.T) { + writer := volumesnapshotStatusWriter{} + orcObject := &orcv1alpha1.VolumeSnapshot{} + + available, reconcileStatus := writer.ResourceAvailableStatus(orcObject, &osResourceT{ + Status: SnapshotStatusError, + }) + if available != metav1.ConditionFalse { + t.Fatalf("expected available condition false, got %q", available) + } + if reconcileStatus == nil { + t.Fatalf("expected terminal reconcile status, got nil") + } + + err := reconcileStatus.GetError() + if err == nil { + t.Fatalf("expected terminal error, got nil") + } + + var terminalErr *orcerrors.TerminalError + if !errors.As(err, &terminalErr) { + t.Fatalf("expected terminal error type, got %T", err) + } + if terminalErr.Reason != orcv1alpha1.ConditionReasonUnrecoverableError { + t.Fatalf("expected reason %q, got %q", orcv1alpha1.ConditionReasonUnrecoverableError, terminalErr.Reason) + } +} diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/01-import-resource.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/01-import-resource.yaml index 9cade4b31..c540bc5c9 100644 --- a/internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/01-import-resource.yaml +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-import-error/01-import-resource.yaml @@ -11,3 +11,4 @@ spec: import: filter: description: VolumeSnapshot from "import error" test + volumeRef: volumesnapshot-import-error diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-import/00-assert.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-import/00-assert.yaml index 01002b11f..6fcaaeb60 100644 --- a/internal/controllers/volumesnapshot/tests/volumesnapshot-import/00-assert.yaml +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-import/00-assert.yaml @@ -6,10 +6,8 @@ metadata: status: conditions: - type: Available - message: Waiting for OpenStack resource to be created externally status: "False" reason: Progressing - type: Progressing - message: Waiting for OpenStack resource to be created externally status: "True" reason: Progressing diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-import/00-import-resource.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-import/00-import-resource.yaml index cc29be4ae..68e1a4208 100644 --- a/internal/controllers/volumesnapshot/tests/volumesnapshot-import/00-import-resource.yaml +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-import/00-import-resource.yaml @@ -1,5 +1,17 @@ --- apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Volume +metadata: + name: volumesnapshot-import +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + size: 1 +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 kind: VolumeSnapshot metadata: name: volumesnapshot-import @@ -11,3 +23,4 @@ spec: import: filter: name: volumesnapshot-import-external + volumeRef: volumesnapshot-import diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-import/01-assert.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-import/01-assert.yaml index 94621f9d3..d7881e0e0 100644 --- a/internal/controllers/volumesnapshot/tests/volumesnapshot-import/01-assert.yaml +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-import/01-assert.yaml @@ -24,10 +24,8 @@ metadata: status: conditions: - type: Available - message: Waiting for OpenStack resource to be created externally status: "False" reason: Progressing - type: Progressing - message: Waiting for OpenStack resource to be created externally status: "True" reason: Progressing diff --git a/internal/controllers/volumesnapshot/tests/volumesnapshot-import/02-create-resource.yaml b/internal/controllers/volumesnapshot/tests/volumesnapshot-import/02-create-resource.yaml index 4da7e7a3a..763859c4c 100644 --- a/internal/controllers/volumesnapshot/tests/volumesnapshot-import/02-create-resource.yaml +++ b/internal/controllers/volumesnapshot/tests/volumesnapshot-import/02-create-resource.yaml @@ -1,17 +1,5 @@ --- apiVersion: openstack.k-orc.cloud/v1alpha1 -kind: Volume -metadata: - name: volumesnapshot-import -spec: - cloudCredentialsRef: - cloudName: openstack - secretName: openstack-clouds - managementPolicy: managed - resource: - size: 1 ---- -apiVersion: openstack.k-orc.cloud/v1alpha1 kind: VolumeSnapshot metadata: name: volumesnapshot-import-external diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshotfilter.go b/pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshotfilter.go index f66a9beb3..a0c1c91fe 100644 --- a/pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshotfilter.go +++ b/pkg/clients/applyconfiguration/api/v1alpha1/volumesnapshotfilter.go @@ -25,10 +25,10 @@ import ( // VolumeSnapshotFilterApplyConfiguration represents a declarative configuration of the VolumeSnapshotFilter type for use // with apply. type VolumeSnapshotFilterApplyConfiguration struct { - Name *apiv1alpha1.OpenStackName `json:"name,omitempty"` - Description *string `json:"description,omitempty"` - Status *string `json:"status,omitempty"` - VolumeID *string `json:"volumeID,omitempty"` + Name *apiv1alpha1.OpenStackName `json:"name,omitempty"` + Description *string `json:"description,omitempty"` + Status *string `json:"status,omitempty"` + VolumeRef *apiv1alpha1.KubernetesNameRef `json:"volumeRef,omitempty"` } // VolumeSnapshotFilterApplyConfiguration constructs a declarative configuration of the VolumeSnapshotFilter type for use with @@ -61,10 +61,10 @@ func (b *VolumeSnapshotFilterApplyConfiguration) WithStatus(value string) *Volum return b } -// WithVolumeID sets the VolumeID field in the declarative configuration to the given value +// WithVolumeRef sets the VolumeRef field in the declarative configuration to the given value // and returns the receiver, so that objects can be built by chaining "With" function invocations. -// If called multiple times, the VolumeID field is set to the value of the last call. -func (b *VolumeSnapshotFilterApplyConfiguration) WithVolumeID(value string) *VolumeSnapshotFilterApplyConfiguration { - b.VolumeID = &value +// If called multiple times, the VolumeRef field is set to the value of the last call. +func (b *VolumeSnapshotFilterApplyConfiguration) WithVolumeRef(value apiv1alpha1.KubernetesNameRef) *VolumeSnapshotFilterApplyConfiguration { + b.VolumeRef = &value return b } diff --git a/pkg/clients/applyconfiguration/internal/internal.go b/pkg/clients/applyconfiguration/internal/internal.go index 0cce46be7..9b82f75fc 100644 --- a/pkg/clients/applyconfiguration/internal/internal.go +++ b/pkg/clients/applyconfiguration/internal/internal.go @@ -3699,7 +3699,7 @@ var schemaYAML = typed.YAMLObject(`types: - name: status type: scalar: string - - name: volumeID + - name: volumeRef type: scalar: string - name: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.VolumeSnapshotImport diff --git a/website/docs/crd-reference.md b/website/docs/crd-reference.md index dc4209abe..9e7528bb6 100644 --- a/website/docs/crd-reference.md +++ b/website/docs/crd-reference.md @@ -1950,6 +1950,7 @@ _Appears in:_ - [UserFilter](#userfilter) - [UserResourceSpec](#userresourcespec) - [VolumeResourceSpec](#volumeresourcespec) +- [VolumeSnapshotFilter](#volumesnapshotfilter) - [VolumeSnapshotResourceSpec](#volumesnapshotresourcespec) @@ -4696,9 +4697,9 @@ VolumeSnapshot is the Schema for an ORC resource. | --- | --- | --- | --- | | `apiVersion` _string_ | `openstack.k-orc.cloud/v1alpha1` | | | | `kind` _string_ | `VolumeSnapshot` | | | -| `metadata` _[ObjectMeta](https://kubernetes.io/docs/reference/generated/kubernetes-api/v1.29/#objectmeta-v1-meta)_ | Refer to Kubernetes API documentation for fields of `metadata`. | | | -| `spec` _[VolumeSnapshotSpec](#volumesnapshotspec)_ | spec specifies the desired state of the resource. | | | -| `status` _[VolumeSnapshotStatus](#volumesnapshotstatus)_ | status defines the observed state of the resource. | | | +| `metadata` _[ObjectMeta](https://kubernetes.io/docs/reference/generated/kubernetes-api/v1.29/#objectmeta-v1-meta)_ | Refer to Kubernetes API documentation for fields of `metadata`. | | Optional: \{\}
| +| `spec` _[VolumeSnapshotSpec](#volumesnapshotspec)_ | spec specifies the desired state of the resource. | | Required: \{\}
| +| `status` _[VolumeSnapshotStatus](#volumesnapshotstatus)_ | status defines the observed state of the resource. | | Optional: \{\}
| #### VolumeSnapshotFilter @@ -4715,10 +4716,10 @@ _Appears in:_ | Field | Description | Default | Validation | | --- | --- | --- | --- | -| `name` _[OpenStackName](#openstackname)_ | name of the existing resource | | MaxLength: 255
MinLength: 1
Pattern: `^[^,]+$`
| -| `description` _string_ | description of the existing resource | | MaxLength: 255
MinLength: 1
| -| `status` _string_ | status of the existing resource | | MaxLength: 255
MinLength: 1
| -| `volumeID` _string_ | volumeID is the ID of the volume the snapshot was created from | | MaxLength: 255
MinLength: 1
| +| `name` _[OpenStackName](#openstackname)_ | name of the existing resource | | MaxLength: 255
MinLength: 1
Pattern: `^[^,]+$`
Optional: \{\}
| +| `description` _string_ | description of the existing resource | | MaxLength: 255
MinLength: 1
Optional: \{\}
| +| `status` _string_ | status of the existing resource | | MaxLength: 255
MinLength: 1
Optional: \{\}
| +| `volumeRef` _[KubernetesNameRef](#kubernetesnameref)_ | volumeRef references the ORC Volume used to filter snapshots by source volume. | | MaxLength: 253
MinLength: 1
Optional: \{\}
| #### VolumeSnapshotImport @@ -4737,8 +4738,8 @@ _Appears in:_ | Field | Description | Default | Validation | | --- | --- | --- | --- | -| `id` _string_ | id contains the unique identifier of an existing OpenStack resource. Note
that when specifying an import by ID, the resource MUST already exist.
The ORC object will enter an error state if the resource does not exist. | | Format: uuid
MaxLength: 36
| -| `filter` _[VolumeSnapshotFilter](#volumesnapshotfilter)_ | filter contains a resource query which is expected to return a single
result. The controller will continue to retry if filter returns no
results. If filter returns multiple results the controller will set an
error state and will not continue to retry. | | MinProperties: 1
| +| `id` _string_ | id contains the unique identifier of an existing OpenStack resource. Note
that when specifying an import by ID, the resource MUST already exist.
The ORC object will enter an error state if the resource does not exist. | | Format: uuid
MaxLength: 36
Optional: \{\}
| +| `filter` _[VolumeSnapshotFilter](#volumesnapshotfilter)_ | filter contains a resource query which is expected to return a single
result. The controller will continue to retry if filter returns no
results. If filter returns multiple results the controller will set an
error state and will not continue to retry. | | MinProperties: 1
Optional: \{\}
| #### VolumeSnapshotMetadata @@ -4754,8 +4755,8 @@ _Appears in:_ | Field | Description | Default | Validation | | --- | --- | --- | --- | -| `name` _string_ | name is the name of the metadata | | MaxLength: 255
| -| `value` _string_ | value is the value of the metadata | | MaxLength: 255
| +| `name` _string_ | name is the name of the metadata | | MaxLength: 255
Required: \{\}
| +| `value` _string_ | value is the value of the metadata | | MaxLength: 255
Required: \{\}
| #### VolumeSnapshotMetadataStatus @@ -4771,8 +4772,8 @@ _Appears in:_ | Field | Description | Default | Validation | | --- | --- | --- | --- | -| `name` _string_ | name is the name of the metadata | | MaxLength: 255
| -| `value` _string_ | value is the value of the metadata | | MaxLength: 255
| +| `name` _string_ | name is the name of the metadata | | MaxLength: 255
Optional: \{\}
| +| `value` _string_ | value is the value of the metadata | | MaxLength: 255
Optional: \{\}
| #### VolumeSnapshotResourceSpec @@ -4788,11 +4789,11 @@ _Appears in:_ | Field | Description | Default | Validation | | --- | --- | --- | --- | -| `name` _[OpenStackName](#openstackname)_ | name will be the name of the created resource. If not specified, the
name of the ORC object will be used. | | MaxLength: 255
MinLength: 1
Pattern: `^[^,]+$`
| -| `description` _string_ | description is a human-readable description for the resource. | | MaxLength: 255
MinLength: 1
| -| `volumeRef` _[KubernetesNameRef](#kubernetesnameref)_ | volumeRef is a reference to the ORC Volume to create a snapshot from. | | MaxLength: 253
MinLength: 1
| -| `force` _boolean_ | force allows creating a snapshot even if the volume is attached. | | | -| `metadata` _[VolumeSnapshotMetadata](#volumesnapshotmetadata) array_ | Refer to Kubernetes API documentation for fields of `metadata`. | | MaxItems: 64
| +| `name` _[OpenStackName](#openstackname)_ | name will be the name of the created resource. If not specified, the
name of the ORC object will be used. | | MaxLength: 255
MinLength: 1
Pattern: `^[^,]+$`
Optional: \{\}
| +| `description` _string_ | description is a human-readable description for the resource. | | MaxLength: 255
MinLength: 1
Optional: \{\}
| +| `volumeRef` _[KubernetesNameRef](#kubernetesnameref)_ | volumeRef is a reference to the ORC Volume to create a snapshot from. | | MaxLength: 253
MinLength: 1
Required: \{\}
| +| `force` _boolean_ | force allows creating a snapshot even if the volume is attached. | | Optional: \{\}
| +| `metadata` _[VolumeSnapshotMetadata](#volumesnapshotmetadata) array_ | Refer to Kubernetes API documentation for fields of `metadata`. | | MaxItems: 64
Optional: \{\}
| #### VolumeSnapshotResourceStatus @@ -4808,19 +4809,19 @@ _Appears in:_ | Field | Description | Default | Validation | | --- | --- | --- | --- | -| `name` _string_ | name is a human-readable name for the resource. Might not be unique. | | MaxLength: 1024
| -| `description` _string_ | description is a human-readable description for the resource. | | MaxLength: 1024
| -| `status` _string_ | status represents the current status of the snapshot. | | MaxLength: 1024
| -| `size` _integer_ | size is the size of the snapshot in GiB. | | | -| `volumeID` _string_ | volumeID is the ID of the volume the snapshot was created from. | | MaxLength: 1024
| -| `metadata` _[VolumeSnapshotMetadataStatus](#volumesnapshotmetadatastatus) array_ | Refer to Kubernetes API documentation for fields of `metadata`. | | MaxItems: 64
| -| `progress` _string_ | progress is the percentage of completion of the snapshot creation. | | MaxLength: 1024
| -| `projectID` _string_ | projectID is the ID of the project that owns the snapshot. | | MaxLength: 1024
| -| `userID` _string_ | userID is the ID of the user who created the snapshot. | | MaxLength: 1024
| -| `groupSnapshotID` _string_ | groupSnapshotID is the ID of the group snapshot, if applicable. | | MaxLength: 1024
| -| `consumesQuota` _boolean_ | consumesQuota indicates whether the snapshot consumes quota. | | | -| `createdAt` _[Time](https://kubernetes.io/docs/reference/generated/kubernetes-api/v1.29/#time-v1-meta)_ | createdAt shows the date and time when the resource was created. The date and time stamp format is ISO 8601. | | | -| `updatedAt` _[Time](https://kubernetes.io/docs/reference/generated/kubernetes-api/v1.29/#time-v1-meta)_ | updatedAt shows the date and time when the resource was updated. The date and time stamp format is ISO 8601. | | | +| `name` _string_ | name is a human-readable name for the resource. Might not be unique. | | MaxLength: 1024
Optional: \{\}
| +| `description` _string_ | description is a human-readable description for the resource. | | MaxLength: 1024
Optional: \{\}
| +| `status` _string_ | status represents the current status of the snapshot. | | MaxLength: 1024
Optional: \{\}
| +| `size` _integer_ | size is the size of the snapshot in GiB. | | Optional: \{\}
| +| `volumeID` _string_ | volumeID is the ID of the volume the snapshot was created from. | | MaxLength: 1024
Optional: \{\}
| +| `metadata` _[VolumeSnapshotMetadataStatus](#volumesnapshotmetadatastatus) array_ | Refer to Kubernetes API documentation for fields of `metadata`. | | MaxItems: 64
Optional: \{\}
| +| `progress` _string_ | progress is the percentage of completion of the snapshot creation. | | MaxLength: 1024
Optional: \{\}
| +| `projectID` _string_ | projectID is the ID of the project that owns the snapshot. | | MaxLength: 1024
Optional: \{\}
| +| `userID` _string_ | userID is the ID of the user who created the snapshot. | | MaxLength: 1024
Optional: \{\}
| +| `groupSnapshotID` _string_ | groupSnapshotID is the ID of the group snapshot, if applicable. | | MaxLength: 1024
Optional: \{\}
| +| `consumesQuota` _boolean_ | consumesQuota indicates whether the snapshot consumes quota. | | Optional: \{\}
| +| `createdAt` _[Time](https://kubernetes.io/docs/reference/generated/kubernetes-api/v1.29/#time-v1-meta)_ | createdAt shows the date and time when the resource was created. The date and time stamp format is ISO 8601. | | Optional: \{\}
| +| `updatedAt` _[Time](https://kubernetes.io/docs/reference/generated/kubernetes-api/v1.29/#time-v1-meta)_ | updatedAt shows the date and time when the resource was updated. The date and time stamp format is ISO 8601. | | Optional: \{\}
| #### VolumeSnapshotSpec @@ -4836,11 +4837,11 @@ _Appears in:_ | Field | Description | Default | Validation | | --- | --- | --- | --- | -| `import` _[VolumeSnapshotImport](#volumesnapshotimport)_ | import refers to an existing OpenStack resource which will be imported instead of
creating a new one. | | MaxProperties: 1
MinProperties: 1
| -| `resource` _[VolumeSnapshotResourceSpec](#volumesnapshotresourcespec)_ | resource specifies the desired state of the resource.
resource may not be specified if the management policy is `unmanaged`.
resource must be specified if the management policy is `managed`. | | | -| `managementPolicy` _[ManagementPolicy](#managementpolicy)_ | managementPolicy defines how ORC will treat the object. Valid values are
`managed`: ORC will create, update, and delete the resource; `unmanaged`:
ORC will import an existing resource, and will not apply updates to it or
delete it. | managed | Enum: [managed unmanaged]
| -| `managedOptions` _[ManagedOptions](#managedoptions)_ | managedOptions specifies options which may be applied to managed objects. | | | -| `cloudCredentialsRef` _[CloudCredentialsReference](#cloudcredentialsreference)_ | cloudCredentialsRef points to a secret containing OpenStack credentials | | | +| `import` _[VolumeSnapshotImport](#volumesnapshotimport)_ | import refers to an existing OpenStack resource which will be imported instead of
creating a new one. | | MaxProperties: 1
MinProperties: 1
Optional: \{\}
| +| `resource` _[VolumeSnapshotResourceSpec](#volumesnapshotresourcespec)_ | resource specifies the desired state of the resource.
resource may not be specified if the management policy is `unmanaged`.
resource must be specified if the management policy is `managed`. | | Optional: \{\}
| +| `managementPolicy` _[ManagementPolicy](#managementpolicy)_ | managementPolicy defines how ORC will treat the object. Valid values are
`managed`: ORC will create, update, and delete the resource; `unmanaged`:
ORC will import an existing resource, and will not apply updates to it or
delete it. | managed | Enum: [managed unmanaged]
Optional: \{\}
| +| `managedOptions` _[ManagedOptions](#managedoptions)_ | managedOptions specifies options which may be applied to managed objects. | | Optional: \{\}
| +| `cloudCredentialsRef` _[CloudCredentialsReference](#cloudcredentialsreference)_ | cloudCredentialsRef points to a secret containing OpenStack credentials | | Required: \{\}
| #### VolumeSnapshotStatus @@ -4856,9 +4857,9 @@ _Appears in:_ | Field | Description | Default | Validation | | --- | --- | --- | --- | -| `conditions` _[Condition](https://kubernetes.io/docs/reference/generated/kubernetes-api/v1.29/#condition-v1-meta) array_ | conditions represents the observed status of the object.
Known .status.conditions.type are: "Available", "Progressing"
Available represents the availability of the OpenStack resource. If it is
true then the resource is ready for use.
Progressing indicates whether the controller is still attempting to
reconcile the current state of the OpenStack resource to the desired
state. Progressing will be False either because the desired state has
been achieved, or because some terminal error prevents it from ever being
achieved and the controller is no longer attempting to reconcile. If
Progressing is True, an observer waiting on the resource should continue
to wait. | | MaxItems: 32
| -| `id` _string_ | id is the unique identifier of the OpenStack resource. | | MaxLength: 1024
| -| `resource` _[VolumeSnapshotResourceStatus](#volumesnapshotresourcestatus)_ | resource contains the observed state of the OpenStack resource. | | | +| `conditions` _[Condition](https://kubernetes.io/docs/reference/generated/kubernetes-api/v1.29/#condition-v1-meta) array_ | conditions represents the observed status of the object.
Known .status.conditions.type are: "Available", "Progressing"
Available represents the availability of the OpenStack resource. If it is
true then the resource is ready for use.
Progressing indicates whether the controller is still attempting to
reconcile the current state of the OpenStack resource to the desired
state. Progressing will be False either because the desired state has
been achieved, or because some terminal error prevents it from ever being
achieved and the controller is no longer attempting to reconcile. If
Progressing is True, an observer waiting on the resource should continue
to wait. | | MaxItems: 32
Optional: \{\}
| +| `id` _string_ | id is the unique identifier of the OpenStack resource. | | MaxLength: 1024
Optional: \{\}
| +| `resource` _[VolumeSnapshotResourceStatus](#volumesnapshotresourcestatus)_ | resource contains the observed state of the OpenStack resource. | | Optional: \{\}
| #### VolumeSpec